Compare commits
53 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
15f536cb79 | ||
|
|
ac8b76d3fc | ||
|
|
62d1407d17 | ||
|
|
eb169ae0a2 | ||
|
|
abdee3b780 | ||
|
|
38c861442c | ||
|
|
1ce5f3e069 | ||
|
|
d0da644c26 | ||
|
|
76e7e22b49 | ||
|
|
72e395c5da | ||
|
|
be65aaa19a | ||
|
|
feae5aba3e | ||
|
|
3a587ce730 | ||
|
|
6bb62bdf82 | ||
|
|
f233d0e4a2 | ||
|
|
035276dcfc | ||
|
|
3a16277867 | ||
|
|
591a75dabc | ||
|
|
cde957b01f | ||
|
|
71d1b35aac | ||
|
|
5cd7034fc8 | ||
|
|
e0ccba1af8 | ||
|
|
21c21ec059 | ||
|
|
cfb6b17bc7 | ||
|
|
2d16cb666b | ||
|
|
1a6d98a4b2 | ||
|
|
85c1ae95c1 | ||
|
|
fd13f13a3c | ||
|
|
8b916829d1 | ||
|
|
05f30ee755 | ||
|
|
5166a67e48 | ||
|
|
d1aae4cc15 | ||
|
|
f38c1f802f | ||
|
|
af9c398571 | ||
|
|
36e30a1fdf | ||
|
|
fb8fa41dd0 | ||
|
|
33cec015ab | ||
|
|
6dec6530c5 | ||
|
|
596ad18412 | ||
|
|
fe282b445b | ||
|
|
0ee94bcb0d | ||
|
|
96001e4d40 | ||
|
|
6898eeb42c | ||
|
|
5250f48d38 | ||
|
|
802daebe56 | ||
|
|
f49e184dbb | ||
|
|
d634763eef | ||
|
|
5902bf9aa3 | ||
|
|
6d91972e97 | ||
|
|
879a12f912 | ||
|
|
e4d421d4e0 | ||
|
|
e2f65b540a | ||
|
|
5788b098e9 |
@@ -1,10 +0,0 @@
|
|||||||
<?xml version="1.0" encoding="UTF-8"?>
|
|
||||||
<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
|
|
||||||
<plist version="1.0">
|
|
||||||
<dict>
|
|
||||||
<key>com.apple.security.app-sandbox</key>
|
|
||||||
<true/>
|
|
||||||
<key>com.apple.security.files.user-selected.read-only</key>
|
|
||||||
<true/>
|
|
||||||
</dict>
|
|
||||||
</plist>
|
|
||||||
@@ -4,5 +4,49 @@
|
|||||||
<dict>
|
<dict>
|
||||||
<key>CFBundleIconFile</key>
|
<key>CFBundleIconFile</key>
|
||||||
<string>AppIcon</string>
|
<string>AppIcon</string>
|
||||||
|
<key>UTImportedTypeDeclarations</key>
|
||||||
|
<array>
|
||||||
|
<dict>
|
||||||
|
<key>UTTypeConformsTo</key>
|
||||||
|
<array>
|
||||||
|
<string>public.data</string>
|
||||||
|
</array>
|
||||||
|
<key>UTTypeIdentifier</key>
|
||||||
|
<string>com.opa334.trollstore.tipa</string>
|
||||||
|
<key>UTTypeDescription</key>
|
||||||
|
<string>AirDrop friendly iOS app</string>
|
||||||
|
<key>UTTypeTagSpecification</key>
|
||||||
|
<dict>
|
||||||
|
<key>public.mime-type</key>
|
||||||
|
<array>
|
||||||
|
<string>application/trollstore-ipa</string>
|
||||||
|
</array>
|
||||||
|
<key>public.filename-extension</key>
|
||||||
|
<array>
|
||||||
|
<string>tipa</string>
|
||||||
|
</array>
|
||||||
|
</dict>
|
||||||
|
</dict>
|
||||||
|
<dict>
|
||||||
|
<key>UTTypeConformsTo</key>
|
||||||
|
<array>
|
||||||
|
<string>public.data</string>
|
||||||
|
</array>
|
||||||
|
<key>UTTypeIdentifier</key>
|
||||||
|
<string>com.google.android.apk</string>
|
||||||
|
<key>UTTypeTagSpecification</key>
|
||||||
|
<dict>
|
||||||
|
<key>public.mime-type</key>
|
||||||
|
<array>
|
||||||
|
<string>application/vnd.android.package-archive</string>
|
||||||
|
</array>
|
||||||
|
<key>public.filename-extension</key>
|
||||||
|
<array>
|
||||||
|
<string>apk</string>
|
||||||
|
<string>apkm</string>
|
||||||
|
</array>
|
||||||
|
</dict>
|
||||||
|
</dict>
|
||||||
|
</array>
|
||||||
</dict>
|
</dict>
|
||||||
</plist>
|
</plist>
|
||||||
|
|||||||
@@ -1,61 +1,55 @@
|
|||||||
import Foundation
|
import Foundation
|
||||||
import AppKit // NSImage
|
import AppKit // NSImage
|
||||||
import CoreUI // CUICatalog
|
private import CoreUI // CUICatalog
|
||||||
import os // OSLog
|
private import os // OSLog
|
||||||
|
|
||||||
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "AppIcon+Car")
|
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "AssetCarReader")
|
||||||
|
|
||||||
// this has been written from scratch but general usage on
|
public class CarReader {
|
||||||
// including the private framework has been taken from:
|
private let catalog: CUICatalog
|
||||||
// https://github.com/showxu/cartools
|
|
||||||
// also see:
|
public init?(_ data: Data) {
|
||||||
// https://blog.timac.org/2018/1018-reverse-engineering-the-car-file-format/
|
|
||||||
|
|
||||||
extension AppIcon {
|
|
||||||
/// Use `CUICatalog` to extract an image from `Assets.car`
|
|
||||||
func imageFromAssetsCar(_ imageName: String) -> NSImage? {
|
|
||||||
guard let data = meta.readPayloadFile("Assets.car") else {
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
let catalog: CUICatalog
|
|
||||||
do {
|
do {
|
||||||
catalog = try data.withUnsafeBytes { try CUICatalog(bytes: $0.baseAddress!, length: UInt64(data.count)) }
|
catalog = try data.withUnsafeBytes { try CUICatalog(bytes: $0.baseAddress!, length: UInt64(data.count)) }
|
||||||
} catch {
|
} catch {
|
||||||
os_log(.error, log: log, "[icon-car] ERROR: could not open catalog: %{public}@", error.localizedDescription)
|
os_log(.error, log: log, "[asset-car] ERROR: could not open catalog: %{public}@", error.localizedDescription)
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
}
|
||||||
if let validName = carVerifyNameExists(imageName, in: catalog) {
|
|
||||||
if let bestImage = carFindHighestResolutionIcon(catalog.images(withName: validName)) {
|
/// Use `CUICatalog` to extract an image from `Assets.car`
|
||||||
os_log(.debug, log: log, "[icon-car] using Assets.car with key %{public}@", validName)
|
public func imageFromAssetsCar(_ imageName: String) -> NSImage? {
|
||||||
|
if let validName = verifyNameExists(imageName, in: catalog) {
|
||||||
|
if let bestImage = findHighestResolutionIcon(catalog.images(withName: validName)) {
|
||||||
|
os_log(.debug, log: log, "[asset-car] using Assets.car with key %{public}@", validName)
|
||||||
return NSImage(cgImage: bestImage.image, size: bestImage.size)
|
return NSImage(cgImage: bestImage.image, size: bestImage.size)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return nil;
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
// MARK: - Helper: Assets.car
|
// MARK: - Private methods
|
||||||
|
|
||||||
/// Helper method to check available icon names. Will return a valid name or `nil` if no image with that key is found.
|
/// Helper method to check available icon names. Will return a valid name or `nil` if no image with that key is found.
|
||||||
func carVerifyNameExists(_ imageName: String, in catalog: CUICatalog) -> String? {
|
private func verifyNameExists(_ imageName: String, in catalog: CUICatalog) -> String? {
|
||||||
if let availableNames = catalog.allImageNames(), !availableNames.contains(imageName) {
|
if let availableNames = catalog.allImageNames(), !availableNames.contains(imageName) {
|
||||||
// Theoretically this should never happen. Assuming the image name is found in an image file.
|
// Theoretically this should never happen. Assuming the image name is found in an image file.
|
||||||
os_log(.info, log: log, "[icon-car] WARN: key '%{public}@' does not match any available key", imageName)
|
os_log(.info, log: log, "[asset-car] WARN: key '%{public}@' does not match any available key", imageName)
|
||||||
|
|
||||||
if let alternativeName = carSearchAlternativeName(imageName, inAvailable: availableNames) {
|
if let alternativeName = searchAlternativeName(imageName, inAvailable: availableNames) {
|
||||||
os_log(.info, log: log, "[icon-car] falling back to '%{public}@'", alternativeName)
|
os_log(.info, log: log, "[asset-car] falling back to '%{public}@'", alternativeName)
|
||||||
return alternativeName
|
return alternativeName
|
||||||
}
|
}
|
||||||
os_log(.debug, log: log, "[icon-car] available keys: %{public}@", catalog.allImageNames() ?? [])
|
os_log(.debug, log: log, "[asset-car] available keys: %{public}@", catalog.allImageNames() ?? [])
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
return imageName;
|
return imageName
|
||||||
}
|
}
|
||||||
|
|
||||||
/// If exact name does not exist in catalog, search for a name that shares the same prefix.
|
/// If exact name does not exist in catalog, search for a name that shares the same prefix.
|
||||||
/// E.g., "AppIcon60x60" may match "AppIcon" or "AppIcon60x60_small"
|
/// E.g., "AppIcon60x60" may match "AppIcon" or "AppIcon60x60_small"
|
||||||
func carSearchAlternativeName(_ originalName: String, inAvailable availableNames: [String]) -> String? {
|
private func searchAlternativeName(_ originalName: String, inAvailable availableNames: [String]) -> String? {
|
||||||
var bestOption: String? = nil
|
var bestOption: String? = nil
|
||||||
var bestDiff: Int = 999
|
var bestDiff: Int = 999
|
||||||
|
|
||||||
@@ -72,7 +66,7 @@ extension AppIcon {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Given a list of `CUINamedImage`, return the one with the highest resolution. Vector graphics are ignored.
|
/// Given a list of `CUINamedImage`, return the one with the highest resolution. Vector graphics are ignored.
|
||||||
func carFindHighestResolutionIcon(_ availableImages: [CUINamedImage]) -> CUINamedImage? {
|
private func findHighestResolutionIcon(_ availableImages: [CUINamedImage]) -> CUINamedImage? {
|
||||||
var largestWidth: CGFloat = 0
|
var largestWidth: CGFloat = 0
|
||||||
var largestImage: CUINamedImage? = nil
|
var largestImage: CUINamedImage? = nil
|
||||||
// cast to NSArray is necessary as otherwise this will crash
|
// cast to NSArray is necessary as otherwise this will crash
|
||||||
9
AssetCarReader/AssetCarReader.xcconfig
Normal file
9
AssetCarReader/AssetCarReader.xcconfig
Normal file
@@ -0,0 +1,9 @@
|
|||||||
|
// Configuration settings file format documentation can be found at:
|
||||||
|
// https://help.apple.com/xcode/#/dev745c5c974
|
||||||
|
|
||||||
|
FRAMEWORK_SEARCH_PATHS = $(PROJECT_DIR)/AssetCarReader/PrivateFrameworks
|
||||||
|
SYSTEM_FRAMEWORK_SEARCH_PATHS = $(SYSTEM_LIBRARY_DIR)/PrivateFrameworks
|
||||||
|
SWIFT_INCLUDE_PATHS = $(SRCROOT)/AssetCarReader/PrivateFrameworks/CoreUI.framework
|
||||||
|
|
||||||
|
DYLIB_COMPATIBILITY_VERSION = 1
|
||||||
|
DYLIB_CURRENT_VERSION = 42
|
||||||
60
CHANGELOG.md
Normal file
60
CHANGELOG.md
Normal file
@@ -0,0 +1,60 @@
|
|||||||
|
# Changelog
|
||||||
|
All notable changes to this project will be documented in this file.
|
||||||
|
|
||||||
|
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||||
|
and this project does adhere to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||||
|
|
||||||
|
|
||||||
|
## [1.5.0] – 2025-12-01
|
||||||
|
Fixed:
|
||||||
|
- `.appex` macOS extensions (`Info.plist` was not found)
|
||||||
|
- Removed `.appex` from `ThumbnailProvider` (extension probably dont have icons anyway)
|
||||||
|
|
||||||
|
Changed:
|
||||||
|
- Template uses `{{X}}` instead of `__X__`
|
||||||
|
|
||||||
|
|
||||||
|
## [1.4.0] – 2025-11-29
|
||||||
|
Added:
|
||||||
|
- Support for `.apk` files
|
||||||
|
- Support for `.apkm` files
|
||||||
|
|
||||||
|
|
||||||
|
## [1.3.0] – 2025-11-06
|
||||||
|
Added:
|
||||||
|
- Show macOS apps in `.xcarchive`
|
||||||
|
- Show `.xcarchive` developer notes
|
||||||
|
|
||||||
|
Fixed:
|
||||||
|
- Cancel preview (and allow other plugins to run) if there is no `Info.plist` in `.xcarchive`
|
||||||
|
|
||||||
|
Changed:
|
||||||
|
- Hide Transport Security and Entitlements if they are empty
|
||||||
|
|
||||||
|
|
||||||
|
## [1.2.0] – 2025-11-04
|
||||||
|
Added:
|
||||||
|
- Customizable HTML template
|
||||||
|
|
||||||
|
Fixed:
|
||||||
|
- Properly handle `Assets.car` files by abstracting relevant code into `.framework`
|
||||||
|
|
||||||
|
Changed:
|
||||||
|
- Updated HTML template
|
||||||
|
|
||||||
|
|
||||||
|
## [1.1.0] – 2025-10-30
|
||||||
|
Added:
|
||||||
|
- Support for `.tipa` files
|
||||||
|
|
||||||
|
|
||||||
|
## [1.0.0] – 2025-10-30
|
||||||
|
Initial release
|
||||||
|
|
||||||
|
|
||||||
|
[1.5.0]: https://github.com/relikd/QLAppBundle/compare/v1.4.0...v1.5.0
|
||||||
|
[1.4.0]: https://github.com/relikd/QLAppBundle/compare/v1.3.0...v1.4.0
|
||||||
|
[1.3.0]: https://github.com/relikd/QLAppBundle/compare/v1.2.0...v1.3.0
|
||||||
|
[1.2.0]: https://github.com/relikd/QLAppBundle/compare/v1.1.0...v1.2.0
|
||||||
|
[1.1.0]: https://github.com/relikd/QLAppBundle/compare/v1.0.0...v1.1.0
|
||||||
|
[1.0.0]: https://github.com/relikd/QLAppBundle/compare/9b0761318c85090d1ef22f12d3eab67a9a194882...v1.0.0
|
||||||
6
Config-debug.xcconfig
Normal file
6
Config-debug.xcconfig
Normal file
@@ -0,0 +1,6 @@
|
|||||||
|
// Configuration settings file format documentation can be found at:
|
||||||
|
// https://help.apple.com/xcode/#/dev745c5c974
|
||||||
|
|
||||||
|
#include "Config.xcconfig"
|
||||||
|
|
||||||
|
PRODUCT_BUNDLE_IDENTIFIER = de.relikd.QLAppBundle.debug
|
||||||
14
Config.xcconfig
Normal file
14
Config.xcconfig
Normal file
@@ -0,0 +1,14 @@
|
|||||||
|
// Configuration settings file format documentation can be found at:
|
||||||
|
// https://help.apple.com/xcode/#/dev745c5c974
|
||||||
|
|
||||||
|
CODE_SIGN_STYLE = Manual
|
||||||
|
CODE_SIGN_IDENTITY = Apple Development
|
||||||
|
ENABLE_HARDENED_RUNTIME = YES
|
||||||
|
|
||||||
|
SWIFT_VERSION = 5.0
|
||||||
|
|
||||||
|
MACOSX_DEPLOYMENT_TARGET = 10.15
|
||||||
|
MARKETING_VERSION = 1.5.0
|
||||||
|
PRODUCT_NAME = QLAppBundle
|
||||||
|
PRODUCT_BUNDLE_IDENTIFIER = de.relikd.QLAppBundle
|
||||||
|
CURRENT_PROJECT_VERSION = 2018
|
||||||
File diff suppressed because it is too large
Load Diff
@@ -0,0 +1,15 @@
|
|||||||
|
{
|
||||||
|
"originHash" : "c869761611793a3eebb4e2f56e7aebab4faa8db4159e6116b059292c98af7094",
|
||||||
|
"pins" : [
|
||||||
|
{
|
||||||
|
"identity" : "androidxml",
|
||||||
|
"kind" : "remoteSourceControl",
|
||||||
|
"location" : "https://github.com/relikd/AndroidXML",
|
||||||
|
"state" : {
|
||||||
|
"revision" : "d9fe646bcc3b05548aebbd20b4eee0af675c129f",
|
||||||
|
"version" : "0.9.4"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
],
|
||||||
|
"version" : 3
|
||||||
|
}
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
<?xml version="1.0" encoding="UTF-8"?>
|
<?xml version="1.0" encoding="UTF-8"?>
|
||||||
<Scheme
|
<Scheme
|
||||||
LastUpgradeVersion = "1640"
|
LastUpgradeVersion = "2600"
|
||||||
wasCreatedForAppExtension = "YES"
|
wasCreatedForAppExtension = "YES"
|
||||||
version = "2.0">
|
version = "2.0">
|
||||||
<BuildAction
|
<BuildAction
|
||||||
@@ -17,8 +17,8 @@
|
|||||||
<BuildableReference
|
<BuildableReference
|
||||||
BuildableIdentifier = "primary"
|
BuildableIdentifier = "primary"
|
||||||
BlueprintIdentifier = "54442C1F2E378BAF008A870E"
|
BlueprintIdentifier = "54442C1F2E378BAF008A870E"
|
||||||
BuildableName = "QLPreview.appex"
|
BuildableName = "QLAppBundle Preview Extension.appex"
|
||||||
BlueprintName = "QLPreview"
|
BlueprintName = "QL Preview"
|
||||||
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
</BuildableReference>
|
</BuildableReference>
|
||||||
</BuildActionEntry>
|
</BuildActionEntry>
|
||||||
@@ -32,7 +32,7 @@
|
|||||||
BuildableIdentifier = "primary"
|
BuildableIdentifier = "primary"
|
||||||
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
||||||
BuildableName = "QLAppBundle.app"
|
BuildableName = "QLAppBundle.app"
|
||||||
BlueprintName = "QLAppBundle"
|
BlueprintName = "App"
|
||||||
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
</BuildableReference>
|
</BuildableReference>
|
||||||
</BuildActionEntry>
|
</BuildActionEntry>
|
||||||
@@ -63,7 +63,7 @@
|
|||||||
BuildableIdentifier = "primary"
|
BuildableIdentifier = "primary"
|
||||||
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
||||||
BuildableName = "QLAppBundle.app"
|
BuildableName = "QLAppBundle.app"
|
||||||
BlueprintName = "QLAppBundle"
|
BlueprintName = "App"
|
||||||
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
</BuildableReference>
|
</BuildableReference>
|
||||||
</BuildableProductRunnable>
|
</BuildableProductRunnable>
|
||||||
@@ -82,7 +82,7 @@
|
|||||||
BuildableIdentifier = "primary"
|
BuildableIdentifier = "primary"
|
||||||
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
||||||
BuildableName = "QLAppBundle.app"
|
BuildableName = "QLAppBundle.app"
|
||||||
BlueprintName = "QLAppBundle"
|
BlueprintName = "App"
|
||||||
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
</BuildableReference>
|
</BuildableReference>
|
||||||
</BuildableProductRunnable>
|
</BuildableProductRunnable>
|
||||||
@@ -0,0 +1,97 @@
|
|||||||
|
<?xml version="1.0" encoding="UTF-8"?>
|
||||||
|
<Scheme
|
||||||
|
LastUpgradeVersion = "2600"
|
||||||
|
wasCreatedForAppExtension = "YES"
|
||||||
|
version = "2.0">
|
||||||
|
<BuildAction
|
||||||
|
parallelizeBuildables = "YES"
|
||||||
|
buildImplicitDependencies = "YES"
|
||||||
|
buildArchitectures = "Automatic">
|
||||||
|
<BuildActionEntries>
|
||||||
|
<BuildActionEntry
|
||||||
|
buildForTesting = "YES"
|
||||||
|
buildForRunning = "YES"
|
||||||
|
buildForProfiling = "YES"
|
||||||
|
buildForArchiving = "YES"
|
||||||
|
buildForAnalyzing = "YES">
|
||||||
|
<BuildableReference
|
||||||
|
BuildableIdentifier = "primary"
|
||||||
|
BlueprintIdentifier = "54581FCE2EB29A0B0043A0B3"
|
||||||
|
BuildableName = "QLAppBundle Thumbnail Extension.appex"
|
||||||
|
BlueprintName = "QL Thumbnail"
|
||||||
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
|
</BuildableReference>
|
||||||
|
</BuildActionEntry>
|
||||||
|
<BuildActionEntry
|
||||||
|
buildForTesting = "YES"
|
||||||
|
buildForRunning = "YES"
|
||||||
|
buildForProfiling = "YES"
|
||||||
|
buildForArchiving = "YES"
|
||||||
|
buildForAnalyzing = "YES">
|
||||||
|
<BuildableReference
|
||||||
|
BuildableIdentifier = "primary"
|
||||||
|
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
||||||
|
BuildableName = "QLAppBundle.app"
|
||||||
|
BlueprintName = "App"
|
||||||
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
|
</BuildableReference>
|
||||||
|
</BuildActionEntry>
|
||||||
|
</BuildActionEntries>
|
||||||
|
</BuildAction>
|
||||||
|
<TestAction
|
||||||
|
buildConfiguration = "Debug"
|
||||||
|
selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
|
||||||
|
selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
|
||||||
|
shouldUseLaunchSchemeArgsEnv = "YES"
|
||||||
|
shouldAutocreateTestPlan = "YES">
|
||||||
|
</TestAction>
|
||||||
|
<LaunchAction
|
||||||
|
buildConfiguration = "Debug"
|
||||||
|
selectedDebuggerIdentifier = ""
|
||||||
|
selectedLauncherIdentifier = "Xcode.IDEFoundation.Launcher.PosixSpawn"
|
||||||
|
launchStyle = "0"
|
||||||
|
askForAppToLaunch = "Yes"
|
||||||
|
useCustomWorkingDirectory = "NO"
|
||||||
|
ignoresPersistentStateOnLaunch = "NO"
|
||||||
|
debugDocumentVersioning = "YES"
|
||||||
|
debugServiceExtension = "internal"
|
||||||
|
allowLocationSimulation = "YES"
|
||||||
|
launchAutomaticallySubstyle = "2">
|
||||||
|
<BuildableProductRunnable
|
||||||
|
runnableDebuggingMode = "0">
|
||||||
|
<BuildableReference
|
||||||
|
BuildableIdentifier = "primary"
|
||||||
|
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
||||||
|
BuildableName = "QLAppBundle.app"
|
||||||
|
BlueprintName = "App"
|
||||||
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
|
</BuildableReference>
|
||||||
|
</BuildableProductRunnable>
|
||||||
|
</LaunchAction>
|
||||||
|
<ProfileAction
|
||||||
|
buildConfiguration = "Release"
|
||||||
|
shouldUseLaunchSchemeArgsEnv = "YES"
|
||||||
|
savedToolIdentifier = ""
|
||||||
|
useCustomWorkingDirectory = "NO"
|
||||||
|
debugDocumentVersioning = "YES"
|
||||||
|
askForAppToLaunch = "Yes"
|
||||||
|
launchAutomaticallySubstyle = "2">
|
||||||
|
<BuildableProductRunnable
|
||||||
|
runnableDebuggingMode = "0">
|
||||||
|
<BuildableReference
|
||||||
|
BuildableIdentifier = "primary"
|
||||||
|
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
||||||
|
BuildableName = "QLAppBundle.app"
|
||||||
|
BlueprintName = "App"
|
||||||
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
|
</BuildableReference>
|
||||||
|
</BuildableProductRunnable>
|
||||||
|
</ProfileAction>
|
||||||
|
<AnalyzeAction
|
||||||
|
buildConfiguration = "Debug">
|
||||||
|
</AnalyzeAction>
|
||||||
|
<ArchiveAction
|
||||||
|
buildConfiguration = "Release"
|
||||||
|
revealArchiveInOrganizer = "YES">
|
||||||
|
</ArchiveAction>
|
||||||
|
</Scheme>
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
<?xml version="1.0" encoding="UTF-8"?>
|
<?xml version="1.0" encoding="UTF-8"?>
|
||||||
<Scheme
|
<Scheme
|
||||||
LastUpgradeVersion = "1640"
|
LastUpgradeVersion = "2600"
|
||||||
version = "1.7">
|
version = "1.7">
|
||||||
<BuildAction
|
<BuildAction
|
||||||
parallelizeBuildables = "YES"
|
parallelizeBuildables = "YES"
|
||||||
@@ -17,7 +17,7 @@
|
|||||||
BuildableIdentifier = "primary"
|
BuildableIdentifier = "primary"
|
||||||
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
||||||
BuildableName = "QLAppBundle.app"
|
BuildableName = "QLAppBundle.app"
|
||||||
BlueprintName = "QLAppBundle"
|
BlueprintName = "App"
|
||||||
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
</BuildableReference>
|
</BuildableReference>
|
||||||
</BuildActionEntry>
|
</BuildActionEntry>
|
||||||
@@ -46,7 +46,7 @@
|
|||||||
BuildableIdentifier = "primary"
|
BuildableIdentifier = "primary"
|
||||||
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
||||||
BuildableName = "QLAppBundle.app"
|
BuildableName = "QLAppBundle.app"
|
||||||
BlueprintName = "QLAppBundle"
|
BlueprintName = "App"
|
||||||
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
</BuildableReference>
|
</BuildableReference>
|
||||||
</BuildableProductRunnable>
|
</BuildableProductRunnable>
|
||||||
@@ -63,7 +63,7 @@
|
|||||||
BuildableIdentifier = "primary"
|
BuildableIdentifier = "primary"
|
||||||
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
BlueprintIdentifier = "54442BF32E378B71008A870E"
|
||||||
BuildableName = "QLAppBundle.app"
|
BuildableName = "QLAppBundle.app"
|
||||||
BlueprintName = "QLAppBundle"
|
BlueprintName = "App"
|
||||||
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
ReferencedContainer = "container:QLAppBundle.xcodeproj">
|
||||||
</BuildableReference>
|
</BuildableReference>
|
||||||
</BuildableProductRunnable>
|
</BuildableProductRunnable>
|
||||||
|
|||||||
@@ -13,6 +13,12 @@
|
|||||||
<string>com.apple.itunes.ipa</string>
|
<string>com.apple.itunes.ipa</string>
|
||||||
<string>com.apple.application-and-system-extension</string>
|
<string>com.apple.application-and-system-extension</string>
|
||||||
<string>com.apple.xcode.archive</string>
|
<string>com.apple.xcode.archive</string>
|
||||||
|
<string>com.opa334.trollstore.tipa</string>
|
||||||
|
<string>dyn.ah62d4rv4ge81k4puqe</string>
|
||||||
|
<string>com.google.android.apk</string>
|
||||||
|
<string>dyn.ah62d4rv4ge80c6dp</string>
|
||||||
|
<string>public.archive.apk</string>
|
||||||
|
<string>dyn.ah62d4rv4ge80c6dpry</string>
|
||||||
</array>
|
</array>
|
||||||
<key>QLSupportsSearchableItems</key>
|
<key>QLSupportsSearchableItems</key>
|
||||||
<false/>
|
<false/>
|
||||||
|
|||||||
@@ -3,7 +3,6 @@ import Quartz // QLPreviewingController
|
|||||||
import WebKit // WebView
|
import WebKit // WebView
|
||||||
import os // OSLog
|
import os // OSLog
|
||||||
|
|
||||||
// show Console logs with subsystem:de.relikd.QLApps
|
|
||||||
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "preview-plugin")
|
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "preview-plugin")
|
||||||
|
|
||||||
class PreviewViewController: NSViewController, QLPreviewingController {
|
class PreviewViewController: NSViewController, QLPreviewingController {
|
||||||
@@ -12,9 +11,24 @@ class PreviewViewController: NSViewController, QLPreviewingController {
|
|||||||
return NSNib.Name("PreviewViewController")
|
return NSNib.Name("PreviewViewController")
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Load resource file either from user documents dir (if exists) or app bundle (default).
|
||||||
|
func bundleFile(filename: String, ext: String) throws -> String {
|
||||||
|
if let userFile = URL.UserModDir?.appendingPathComponent(filename + "." + ext, isDirectory: false), userFile.exists() {
|
||||||
|
return try String(contentsOf: userFile, encoding: .utf8)
|
||||||
|
// else: do NOT copy! Breaks on future updates
|
||||||
|
}
|
||||||
|
// else, load bundle file
|
||||||
|
let path = Bundle.main.url(forResource: filename, withExtension: ext)
|
||||||
|
return try String(contentsOf: path!, encoding: .utf8)
|
||||||
|
}
|
||||||
|
|
||||||
func preparePreviewOfFile(at url: URL) async throws {
|
func preparePreviewOfFile(at url: URL) async throws {
|
||||||
let meta = MetaInfo(url)
|
let meta = MetaInfo(url)
|
||||||
let html = HtmlGenerator(meta).applyHtmlTemplate()
|
// throws an exception if appPlist not found. Thus allowing another QuickLook plugin to try
|
||||||
|
let html = try PreviewGenerator(meta).generate(
|
||||||
|
template: try bundleFile(filename: "template", ext: "html"),
|
||||||
|
css: try bundleFile(filename: "style", ext: "css"),
|
||||||
|
)
|
||||||
// sure, we could use `WKWebView`, but that requires the `com.apple.security.network.client` entitlement
|
// sure, we could use `WKWebView`, but that requires the `com.apple.security.network.client` entitlement
|
||||||
//let web = WKWebView(frame: self.view.bounds)
|
//let web = WKWebView(frame: self.view.bounds)
|
||||||
let web = WebView(frame: self.view.bounds)
|
let web = WebView(frame: self.view.bounds)
|
||||||
|
|||||||
@@ -1,10 +0,0 @@
|
|||||||
<?xml version="1.0" encoding="UTF-8"?>
|
|
||||||
<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
|
|
||||||
<plist version="1.0">
|
|
||||||
<dict>
|
|
||||||
<key>com.apple.security.app-sandbox</key>
|
|
||||||
<true/>
|
|
||||||
<key>com.apple.security.files.user-selected.read-only</key>
|
|
||||||
<true/>
|
|
||||||
</dict>
|
|
||||||
</plist>
|
|
||||||
@@ -9,8 +9,13 @@
|
|||||||
<key>QLSupportedContentTypes</key>
|
<key>QLSupportedContentTypes</key>
|
||||||
<array>
|
<array>
|
||||||
<string>com.apple.itunes.ipa</string>
|
<string>com.apple.itunes.ipa</string>
|
||||||
<string>com.apple.application-and-system-extension</string>
|
|
||||||
<string>com.apple.xcode.archive</string>
|
<string>com.apple.xcode.archive</string>
|
||||||
|
<string>com.opa334.trollstore.tipa</string>
|
||||||
|
<string>dyn.ah62d4rv4ge81k4puqe</string>
|
||||||
|
<string>com.google.android.apk</string>
|
||||||
|
<string>dyn.ah62d4rv4ge80c6dp</string>
|
||||||
|
<string>public.archive.apk</string>
|
||||||
|
<string>dyn.ah62d4rv4ge80c6dpry</string>
|
||||||
</array>
|
</array>
|
||||||
<key>QLThumbnailMinimumDimension</key>
|
<key>QLThumbnailMinimumDimension</key>
|
||||||
<integer>16</integer>
|
<integer>16</integer>
|
||||||
|
|||||||
@@ -1,10 +0,0 @@
|
|||||||
<?xml version="1.0" encoding="UTF-8"?>
|
|
||||||
<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
|
|
||||||
<plist version="1.0">
|
|
||||||
<dict>
|
|
||||||
<key>com.apple.security.app-sandbox</key>
|
|
||||||
<true/>
|
|
||||||
<key>com.apple.security.files.user-selected.read-only</key>
|
|
||||||
<true/>
|
|
||||||
</dict>
|
|
||||||
</plist>
|
|
||||||
@@ -1,7 +1,6 @@
|
|||||||
import QuickLookThumbnailing
|
import QuickLookThumbnailing
|
||||||
import os // OSLog
|
import os // OSLog
|
||||||
|
|
||||||
// show Console logs with subsystem:de.relikd.QLApps
|
|
||||||
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "thumbnail-plugin")
|
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "thumbnail-plugin")
|
||||||
|
|
||||||
extension QLThumbnailReply {
|
extension QLThumbnailReply {
|
||||||
@@ -17,13 +16,9 @@ extension QLThumbnailReply {
|
|||||||
}
|
}
|
||||||
|
|
||||||
class ThumbnailProvider: QLThumbnailProvider {
|
class ThumbnailProvider: QLThumbnailProvider {
|
||||||
|
|
||||||
// TODO: sadly, this does not seem to work for .xarchive and .appex
|
|
||||||
// Probably overwritten by Apple somehow
|
|
||||||
|
|
||||||
override func provideThumbnail(for request: QLFileThumbnailRequest, _ handler: @escaping (QLThumbnailReply?, Error?) -> Void) {
|
override func provideThumbnail(for request: QLFileThumbnailRequest, _ handler: @escaping (QLThumbnailReply?, Error?) -> Void) {
|
||||||
let meta = MetaInfo(request.fileURL)
|
let meta = MetaInfo(request.fileURL)
|
||||||
let img = AppIcon(meta).extractImage(from: meta.readPlistApp()).withRoundCorners()
|
let img = AppIcon(meta).extractImageForThumbnail().withRoundCorners()
|
||||||
|
|
||||||
// First way: Draw the thumbnail into the current context, set up with UIKit's coordinate system.
|
// First way: Draw the thumbnail into the current context, set up with UIKit's coordinate system.
|
||||||
let reply = QLThumbnailReply(contextSize: request.maximumSize, currentContextDrawing: { () -> Bool in
|
let reply = QLThumbnailReply(contextSize: request.maximumSize, currentContextDrawing: { () -> Bool in
|
||||||
@@ -39,3 +34,4 @@ class ThumbnailProvider: QLThumbnailProvider {
|
|||||||
reply.setFlavor(meta.type == .Archive ? 12 : 0) // .archive looks like "in development"
|
reply.setFlavor(meta.type == .Archive ? 12 : 0) // .archive looks like "in development"
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
43
README.md
43
README.md
@@ -6,9 +6,10 @@
|
|||||||
QLAppBundle
|
QLAppBundle
|
||||||
===========
|
===========
|
||||||
|
|
||||||
A QuickLook plugin for app bundles (`.ipa`, `.appex`, `.xcarchive`).
|
A QuickLook plugin for app bundles (`.ipa`, `.tipa`, `.appex`, `.xcarchive`, `.apk`, `.apkm`).
|
||||||
|
|
||||||

|

|
||||||
|

|
||||||
|
|
||||||
|
|
||||||
## Why?
|
## Why?
|
||||||
@@ -24,31 +25,31 @@ I merely want things to be done.
|
|||||||
Also, I've removed support for provisioning profiles (`.mobileprovision`, `.provisionprofile`) to focus on app bundles.
|
Also, I've removed support for provisioning profiles (`.mobileprovision`, `.provisionprofile`) to focus on app bundles.
|
||||||
|
|
||||||
|
|
||||||
## ToDO
|
|
||||||
|
|
||||||
- [ ] support for `.apk` files
|
## ToDo
|
||||||
|
|
||||||
|
- [x] support for `.apk` files
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
## Features
|
||||||
|
|
||||||
|
### Customize HTML / CSS
|
||||||
|
|
||||||
|
1. Right click on the app and select "Show Package Contents"
|
||||||
|
2. Go to `PlugIns` and repeat "Show Package Contents" on the Preview extension.
|
||||||
|
3. Copy `Contents/Resources/template.html` (or `style.css`)
|
||||||
|
4. Open `~/Library/Containers/de.relikd.QLAppBundle.Preview/Data/Documents/`
|
||||||
|
5. Paste the previous file and modify it to your liking
|
||||||
|
6. `QLAppBundle` will use the new file from now on
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
## Development notes
|
## Development notes
|
||||||
|
|
||||||
If you encounter compile errors like:
|
### Debug
|
||||||
|
|
||||||
```
|
You can show Console logs with `subsystem:de.relikd.QLAppBundle`
|
||||||
Command SwiftEmitModule failed with a nonzero exit code
|
|
||||||
```
|
|
||||||
|
|
||||||
or
|
|
||||||
|
|
||||||
```
|
|
||||||
Could not build Objective-C module 'ExtensionFoundation'
|
|
||||||
```
|
|
||||||
|
|
||||||
remove the `SYSTEM_FRAMEWORK_SEARCH_PATHS` attribute from Project > Build Settings then try to compile again (it will fail).
|
|
||||||
Afterwards, restore the value in the attribute.
|
|
||||||
Now, the build index should be up-to-date and the app should compile fine.
|
|
||||||
|
|
||||||
I havent figured out the exact issue, consider it a workaround.
|
|
||||||
It should only be necessary once (or if you delete your `DerivedData` folder).
|
|
||||||
|
|
||||||
|
|
||||||
[1]: https://github.com/ealeksandrov/ProvisionQL
|
[1]: https://github.com/ealeksandrov/ProvisionQL
|
||||||
|
|||||||
@@ -6,7 +6,7 @@ body {
|
|||||||
line-height: 1.3;
|
line-height: 1.3;
|
||||||
}
|
}
|
||||||
|
|
||||||
.hiddenDiv {
|
.hidden, .not- {
|
||||||
display: none;
|
display: none;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -2,82 +2,100 @@
|
|||||||
<html lang="en">
|
<html lang="en">
|
||||||
<head>
|
<head>
|
||||||
<meta charset="UTF-8">
|
<meta charset="UTF-8">
|
||||||
<style>__CSS__</style>
|
<style>{{CSS}}</style>
|
||||||
</head>
|
</head>
|
||||||
<body>
|
<body>
|
||||||
<div class="app __AppInfoHidden__">
|
<h1>{{QuickLookTitle}}</h1>
|
||||||
<h1>__AppInfoTitle__</h1>
|
|
||||||
<div class="floatLeft icon"><img alt="App icon" src="data:image/png;base64,__AppIcon__"/></div>
|
<div class="app {{AppInfoHidden}}">
|
||||||
|
<div class="floatLeft icon"><img alt="App icon" src="data:image/png;base64,{{AppIcon}}"/></div>
|
||||||
<div class="floatLeft info">
|
<div class="floatLeft info">
|
||||||
Name: <strong>__CFBundleName__</strong><br />
|
Name: <strong>{{AppName}}</strong><br />
|
||||||
Version: __CFBundleShortVersionString__ (__CFBundleVersion__)<br />
|
Version: {{AppVersion}} ({{AppBuildVer}})<br />
|
||||||
BundleId: __CFBundleIdentifier__<br />
|
BundleId: {{AppId}}<br />
|
||||||
<div class="__ExtensionTypeHidden__">
|
<div class="{{AppExtensionTypeHidden}}">
|
||||||
Extension type: __ExtensionType__<br />
|
Extension type: {{AppExtensionType}}<br />
|
||||||
</div>
|
</div>
|
||||||
DeviceFamily: __UIDeviceFamily__<br />
|
DeviceFamily: {{AppDeviceFamily}}<br />
|
||||||
SDK: __DTSDKName__<br />
|
SDK: {{AppSDK}}<br />
|
||||||
Minimum OS Version: __MinimumOSVersion__<br />
|
Minimum OS Version: {{AppMinOS}}<br />
|
||||||
</div>
|
</div>
|
||||||
<br class="clear" />
|
<br class="clear" />
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div class="not-{{AppInfoHidden}}">
|
||||||
|
Could not find any Info.plist
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div class="{{ArchiveHidden}}">
|
||||||
|
<h2>Archive Notes</h2>
|
||||||
|
<pre>{{ArchiveComment}}</pre>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div class="{{iTunesHidden}}">
|
||||||
|
<h2>iTunes Metadata</h2>
|
||||||
|
iTunesId: {{iTunesId}}<br />
|
||||||
|
Title: {{iTunesName}}<br />
|
||||||
|
Genres: {{iTunesGenres}}<br />
|
||||||
|
Released: {{iTunesReleaseDate}}<br />
|
||||||
|
<br />
|
||||||
|
AppleId: {{iTunesAppleId}}<br />
|
||||||
|
Purchased: {{iTunesPurchaseDate}}<br />
|
||||||
|
Price: {{iTunesPrice}}<br />
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div class="{{TransportSecurityHidden}}">
|
||||||
<h2>App Transport Security</h2>
|
<h2>App Transport Security</h2>
|
||||||
__AppTransportSecurityFormatted__
|
{{TransportSecurityDict}}
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="__ProvisionHidden__">
|
<div class="{{EntitlementsHidden}}">
|
||||||
<div class="__AppInfoHidden__">
|
|
||||||
<h2>Provisioning</h2>
|
|
||||||
Profile name: <strong>__ProfileName__</strong><br />
|
|
||||||
</div>
|
|
||||||
<div class="__ProvisionTitleHidden__">
|
|
||||||
<h1><span class="__ExpStatus__">__ProfileName__</span></h1>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
Profile UUID: __ProfileUUID__<br />
|
|
||||||
Profile Type: __ProfilePlatform__ __ProfileType__<br />
|
|
||||||
Team: __TeamName__ (__TeamIds__)<br />
|
|
||||||
Creation date: __CreationDateFormatted__<br />
|
|
||||||
Expiration Date: <strong><span class="__ExpStatus__">__ExpirationDateFormatted__</span></strong><br />
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div>
|
|
||||||
<h2>Entitlements</h2>
|
<h2>Entitlements</h2>
|
||||||
<div class="__EntitlementsWarningHidden__ warning">
|
<div class="warning {{EntitlementsWarningHidden}}">
|
||||||
<strong>Entitlements extraction failed.</strong>
|
<strong>Entitlements extraction failed.</strong>
|
||||||
</div>
|
</div>
|
||||||
__EntitlementsFormatted__
|
{{EntitlementsDict}}
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="__ProvisionHidden__">
|
<div class="{{ProvisionHidden}}">
|
||||||
|
<h2>Provisioning</h2>
|
||||||
|
Profile name: <strong>{{ProvisionProfileName}}</strong><br />
|
||||||
|
Profile UUID: {{ProvisionProfileId}}<br />
|
||||||
|
Profile Type: {{ProvisionProfilePlatform}} {{ProvisionProfileType}}<br />
|
||||||
|
Team: {{ProvisionTeamName}} ({{ProvisionTeamIds}})<br />
|
||||||
|
Creation date: {{ProvisionCreateDate}}<br />
|
||||||
|
Expiration Date: <strong><span class="{{ProvisionExpireStatus}}">{{ProvisionExpireDate}}</span></strong><br />
|
||||||
|
|
||||||
<h2>Developer Certificates</h2>
|
<h2>Developer Certificates</h2>
|
||||||
__DeveloperCertificatesFormatted__
|
{{ProvisionDevelopCertificates}}
|
||||||
|
|
||||||
|
<h2>Devices ({{ProvisionDeviceCount}})</h2>
|
||||||
|
{{ProvisionDeviceIds}}
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="__ProvisionHidden__">
|
<div class="{{ApkFeaturesRequiredHidden}}">
|
||||||
<h2>Devices (__ProvisionedDevicesCount__)</h2>
|
<h2>Features (required)</h2>
|
||||||
__ProvisionedDevicesFormatted__
|
{{ApkFeaturesRequiredList}}
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="__iTunesHidden__">
|
<div class="{{ApkFeaturesOptionalHidden}}">
|
||||||
<h2>iTunes Metadata</h2>
|
<h2>Features (optional)</h2>
|
||||||
iTunesId: __iTunesId__<br />
|
{{ApkFeaturesOptionalList}}
|
||||||
Title: __iTunesName__<br />
|
|
||||||
Genres: __iTunesGenres__<br />
|
|
||||||
Released: __iTunesReleaseDate__<br />
|
|
||||||
<br />
|
|
||||||
AppleId: __iTunesAppleId__<br />
|
|
||||||
Purchased: __iTunesPurchaseDate__<br />
|
|
||||||
Price: __iTunesPrice__<br />
|
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
<div class="{{ApkPermissionsHidden}}">
|
||||||
|
<h2>Permissions</h2>
|
||||||
|
{{ApkPermissionsList}}
|
||||||
|
</div>
|
||||||
|
|
||||||
<div>
|
<div>
|
||||||
<h2>File info</h2>
|
<h2>File info</h2>
|
||||||
__FileName__<br />
|
{{FileName}}<br />
|
||||||
__FileInfo__<br />
|
{{FileSize}}, Modified {{FileModified}}<br />
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="footer">
|
<div class="footer">
|
||||||
<p>__SrcAppName__ v__BundleShortVersionString__ (__BundleVersion__) (Github: <a href="__SrcLinkUrl__">__SrcLinkName__</a>)</p>
|
<p>{{SrcAppName}} v{{SrcVersion}} ({{SrcBuildVer}}) (Github: <a href="{{SrcLinkUrl}}">{{SrcLinkName}}</a>)</p>
|
||||||
</div>
|
</div>
|
||||||
</body>
|
</body>
|
||||||
</html>
|
</html>
|
||||||
|
|||||||
BIN
screenshot.png
Normal file
BIN
screenshot.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 251 KiB |
BIN
screenshot2.png
Normal file
BIN
screenshot2.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 230 KiB |
@@ -1,5 +1,6 @@
|
|||||||
import Foundation
|
import Foundation
|
||||||
import AppKit // NSImage
|
import AppKit // NSImage
|
||||||
|
import AssetCarReader // CarReader
|
||||||
import os // OSLog
|
import os // OSLog
|
||||||
|
|
||||||
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "AppIcon")
|
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "AppIcon")
|
||||||
@@ -12,24 +13,44 @@ struct AppIcon {
|
|||||||
self.meta = meta
|
self.meta = meta
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Convenience getter to extract app icon regardless of bundle-type.
|
||||||
|
func extractImageForThumbnail() -> NSImage {
|
||||||
|
switch meta.type {
|
||||||
|
case .IPA, .Archive, .Extension:
|
||||||
|
extractImage(from: meta.readPlist_Icon()?.filenames)
|
||||||
|
case .APK:
|
||||||
|
extractImage(from: meta.readApk_Icon())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Extract image from Android app bundle.
|
||||||
|
func extractImage(from apkIcon: Apk_Icon?) -> NSImage {
|
||||||
|
if let data = apkIcon?.data, let img = NSImage(data: data) {
|
||||||
|
return img
|
||||||
|
}
|
||||||
|
return defaultIcon()
|
||||||
|
}
|
||||||
|
|
||||||
/// Try multiple methods to extract image.
|
/// Try multiple methods to extract image.
|
||||||
/// This method will always return an image even if none is found, in which case it returns the default image.
|
/// This method will always return an image even if none is found, in which case it returns the default image.
|
||||||
func extractImage(from appPlist: PlistDict?) -> NSImage {
|
func extractImage(from plistIcons: [String]?) -> NSImage {
|
||||||
// no need to unwrap the plist, and most .ipa should include the Artwork anyway
|
// no need to unwrap the plist, and most .ipa should include the Artwork anyway
|
||||||
if meta.type == .IPA {
|
if meta.type == .IPA {
|
||||||
if let data = meta.zipFile!.unzipFile("iTunesArtwork") {
|
if let data = meta.zipFile!.unzipFile("iTunesArtwork") {
|
||||||
os_log(.debug, log: log, "[icon] using iTunesArtwork.")
|
os_log(.debug, log: log, "[icon] using iTunesArtwork.")
|
||||||
return NSImage(data: data)!
|
return NSImage(data: data)!
|
||||||
}
|
}
|
||||||
|
// else, fallthrough
|
||||||
}
|
}
|
||||||
|
|
||||||
// Extract image name from app plist
|
// Extract image name from app plist
|
||||||
var plistImgNames = iconNamesFromPlist(appPlist)
|
var plistImgNames = plistIcons ?? []
|
||||||
os_log(.debug, log: log, "[icon] icon names in plist: %{public}@", plistImgNames)
|
os_log(.debug, log: log, "[icon] icon names in plist: %{public}@", plistImgNames)
|
||||||
|
|
||||||
// If no previous filename works (or empty), try default icon names
|
// If no previous filename works (or empty), try default icon names
|
||||||
plistImgNames.append("Icon")
|
plistImgNames.append("Icon")
|
||||||
plistImgNames.append("icon")
|
plistImgNames.append("icon")
|
||||||
|
plistImgNames.append("AppIcon")
|
||||||
|
|
||||||
// First, try if an image file with that name exists.
|
// First, try if an image file with that name exists.
|
||||||
if let actualName = expandImageName(plistImgNames) {
|
if let actualName = expandImageName(plistImgNames) {
|
||||||
@@ -47,55 +68,36 @@ struct AppIcon {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Fallback to default icon
|
// Fallback to default icon
|
||||||
|
return defaultIcon()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Return the bundled default icon `"defaultIcon.png"`
|
||||||
|
private func defaultIcon() -> NSImage {
|
||||||
let iconURL = Bundle.main.url(forResource: "defaultIcon", withExtension: "png")!
|
let iconURL = Bundle.main.url(forResource: "defaultIcon", withExtension: "png")!
|
||||||
return NSImage(contentsOf: iconURL)!
|
return NSImage(contentsOf: iconURL)!
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Extract an image from `Assets.car`
|
||||||
|
func imageFromAssetsCar(_ imageName: String) -> NSImage? {
|
||||||
|
guard let data = meta.readPayloadFile("Assets.car", osxSubdir: "Resources") else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
return CarReader(data)?.imageFromAssetsCar(imageName)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
// MARK: - Plist
|
// MARK: - Plist
|
||||||
|
|
||||||
extension AppIcon {
|
extension AppIcon {
|
||||||
/// Parse app plist to find the bundle icon filename.
|
|
||||||
/// @param appPlist If `nil`, will load plist on the fly (used for thumbnail)
|
|
||||||
/// @return Filenames which do not necessarily exist on filesystem. This may include `@2x` and/or no file extension.
|
|
||||||
private func iconNamesFromPlist(_ appPlist: PlistDict?) -> [String] {
|
|
||||||
let appPlist = appPlist == nil ? meta.readPlistApp()! : appPlist!
|
|
||||||
// Check for CFBundleIcons (since 5.0)
|
|
||||||
if let icons = unpackNameListFromPlistDict(appPlist["CFBundleIcons"]), !icons.isEmpty {
|
|
||||||
return icons
|
|
||||||
}
|
|
||||||
// iPad-only apps
|
|
||||||
if let icons = unpackNameListFromPlistDict(appPlist["CFBundleIcons~ipad"]), !icons.isEmpty {
|
|
||||||
return icons
|
|
||||||
}
|
|
||||||
// Check for CFBundleIconFiles (since 3.2)
|
|
||||||
if let icons = appPlist["CFBundleIconFiles"] as? [String], !icons.isEmpty {
|
|
||||||
return icons
|
|
||||||
}
|
|
||||||
// key found on iTunesU app
|
|
||||||
if let icons = appPlist["Icon files"] as? [String], !icons.isEmpty {
|
|
||||||
return icons
|
|
||||||
}
|
|
||||||
// Check for CFBundleIconFile (legacy, before 3.2)
|
|
||||||
if let icon = appPlist["CFBundleIconFile"] as? String { // may be nil
|
|
||||||
return [icon]
|
|
||||||
}
|
|
||||||
return [] // [self sortedByResolution:icons];
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Given a filename, search Bundle or Filesystem for files that match. Select the filename with the highest resolution.
|
/// Given a filename, search Bundle or Filesystem for files that match. Select the filename with the highest resolution.
|
||||||
private func expandImageName(_ iconList: [String]) -> String? {
|
private func expandImageName(_ iconList: [String]) -> String? {
|
||||||
var matches: [String] = []
|
var matches: [String] = []
|
||||||
switch meta.type {
|
switch meta.type {
|
||||||
case .IPA:
|
case .IPA:
|
||||||
guard let zipFile = meta.zipFile else {
|
|
||||||
// in case unzip in memory is not available, fallback to pattern matching with dynamic suffix
|
|
||||||
return "Payload/*.app/\(iconList.first!)*"
|
|
||||||
}
|
|
||||||
for iconPath in iconList {
|
for iconPath in iconList {
|
||||||
let zipPath = "Payload/*.app/\(iconPath)*"
|
let zipPath = "Payload/*.app/\(iconPath)*"
|
||||||
for zip in zipFile.filesMatching(zipPath) {
|
for zip in meta.zipFile!.filesMatching(zipPath) {
|
||||||
if zip.sizeUncompressed > 0 {
|
if zip.sizeUncompressed > 0 {
|
||||||
matches.append(zip.filepath)
|
matches.append(zip.filepath)
|
||||||
}
|
}
|
||||||
@@ -105,11 +107,13 @@ extension AppIcon {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
case .APK:
|
||||||
|
return nil // handled in `extractImage()`
|
||||||
|
|
||||||
case .Archive, .Extension:
|
case .Archive, .Extension:
|
||||||
let basePath = meta.effectiveUrl ?? meta.url
|
|
||||||
for iconPath in iconList {
|
for iconPath in iconList {
|
||||||
let fileName = iconPath.components(separatedBy: "/").last!
|
let fileName = iconPath.components(separatedBy: "/").last!
|
||||||
let parentDir = basePath.appendingPathComponent(iconPath, isDirectory: false).deletingLastPathComponent().path
|
let parentDir = meta.effectiveUrl("Resources", iconPath).parentDir().path
|
||||||
guard let files = try? FileManager.default.contentsOfDirectory(atPath: parentDir) else {
|
guard let files = try? FileManager.default.contentsOfDirectory(atPath: parentDir) else {
|
||||||
continue
|
continue
|
||||||
}
|
}
|
||||||
@@ -130,21 +134,6 @@ extension AppIcon {
|
|||||||
}
|
}
|
||||||
return matches.isEmpty ? nil : sortedByResolution(matches).first
|
return matches.isEmpty ? nil : sortedByResolution(matches).first
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Deep select icons from plist key `CFBundleIcons` and `CFBundleIcons~ipad`
|
|
||||||
private func unpackNameListFromPlistDict(_ bundleDict: Any?) -> [String]? {
|
|
||||||
if let bundleDict = bundleDict as? PlistDict {
|
|
||||||
if let primaryDict = bundleDict["CFBundlePrimaryIcon"] as? PlistDict {
|
|
||||||
if let icons = primaryDict["CFBundleIconFiles"] as? [String] {
|
|
||||||
return icons
|
|
||||||
}
|
|
||||||
if let name = primaryDict["CFBundleIconName"] as? String { // key found on a .tipa file
|
|
||||||
return [name]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
|
|
||||||
/// @return lower index means higher resolution.
|
/// @return lower index means higher resolution.
|
||||||
private func resolutionIndex(_ iconName: String) -> Int {
|
private func resolutionIndex(_ iconName: String) -> Int {
|
||||||
@@ -210,7 +199,6 @@ extension NSImage {
|
|||||||
|
|
||||||
/// Convert image to PNG and encode with base64 to be embeded in html output.
|
/// Convert image to PNG and encode with base64 to be embeded in html output.
|
||||||
func asBase64() -> String {
|
func asBase64() -> String {
|
||||||
// appIcon = [self roundCorners:appIcon];
|
|
||||||
let imageData = tiffRepresentation!
|
let imageData = tiffRepresentation!
|
||||||
let imageRep = NSBitmapImageRep(data: imageData)!
|
let imageRep = NSBitmapImageRep(data: imageData)!
|
||||||
let imageDataPNG = imageRep.representation(using: .png, properties: [:])!
|
let imageDataPNG = imageRep.representation(using: .png, properties: [:])!
|
||||||
134
src/Common/MetaInfo.swift
Normal file
134
src/Common/MetaInfo.swift
Normal file
@@ -0,0 +1,134 @@
|
|||||||
|
import Foundation
|
||||||
|
import os // OSLog
|
||||||
|
|
||||||
|
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "MetaInfo")
|
||||||
|
|
||||||
|
typealias PlistDict = [String: Any] // basically an untyped Dict
|
||||||
|
|
||||||
|
|
||||||
|
// Init QuickLook Type
|
||||||
|
enum FileType {
|
||||||
|
case IPA
|
||||||
|
case Archive
|
||||||
|
case Extension
|
||||||
|
case APK
|
||||||
|
}
|
||||||
|
|
||||||
|
struct MetaInfo {
|
||||||
|
let UTI: String
|
||||||
|
let url: URL
|
||||||
|
private let effectiveUrl: URL // if set, will point to the app inside of an archive
|
||||||
|
|
||||||
|
let type: FileType
|
||||||
|
let zipFile: ZipFile? // only set for zipped file types
|
||||||
|
let isOSX: Bool
|
||||||
|
|
||||||
|
/// Use file url and UTI type to generate an info object to pass around.
|
||||||
|
init(_ url: URL) {
|
||||||
|
self.url = url
|
||||||
|
self.UTI = try! url.resourceValues(forKeys: [.typeIdentifierKey]).typeIdentifier ?? "Unknown"
|
||||||
|
|
||||||
|
var isOSX = false
|
||||||
|
var effective: URL? = nil
|
||||||
|
var zipFile: ZipFile? = nil
|
||||||
|
|
||||||
|
switch self.UTI {
|
||||||
|
case "com.apple.itunes.ipa", "com.opa334.trollstore.tipa", "dyn.ah62d4rv4ge81k4puqe" /* tipa */:
|
||||||
|
self.type = FileType.IPA
|
||||||
|
zipFile = ZipFile(self.url.path)
|
||||||
|
case "com.apple.xcode.archive":
|
||||||
|
self.type = FileType.Archive
|
||||||
|
let productsDir = url.appendingPathComponent("Products", isDirectory: true)
|
||||||
|
if productsDir.exists(), let bundleDir = recursiveSearchInfoPlist(productsDir) {
|
||||||
|
isOSX = bundleDir.appendingPathComponent("MacOS").exists() && bundleDir.lastPathComponent == "Contents"
|
||||||
|
effective = bundleDir
|
||||||
|
} else {
|
||||||
|
effective = productsDir // this is wrong but dont use `url` either because that will find the `Info.plist` of the archive itself
|
||||||
|
}
|
||||||
|
case "com.apple.application-and-system-extension":
|
||||||
|
self.type = FileType.Extension
|
||||||
|
if let bundleDir = recursiveSearchInfoPlist(url) {
|
||||||
|
isOSX = bundleDir.appendingPathComponent("MacOS").exists() && bundleDir.lastPathComponent == "Contents"
|
||||||
|
effective = bundleDir
|
||||||
|
}
|
||||||
|
case "com.google.android.apk", "dyn.ah62d4rv4ge80c6dp" /* apk */, "public.archive.apk", "dyn.ah62d4rv4ge80c6dpry" /* apkm */:
|
||||||
|
self.type = FileType.APK
|
||||||
|
zipFile = ZipFile(self.url.path)
|
||||||
|
default:
|
||||||
|
os_log(.error, log: log, "Unsupported file type: %{public}@", self.UTI)
|
||||||
|
fatalError()
|
||||||
|
}
|
||||||
|
self.isOSX = isOSX
|
||||||
|
self.zipFile = zipFile
|
||||||
|
self.effectiveUrl = effective ?? url
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Evaluate path with `osxSubdir` and `filename`
|
||||||
|
func effectiveUrl(_ osxSubdir: String?, _ filename: String) -> URL {
|
||||||
|
switch self.type {
|
||||||
|
case .IPA, .APK:
|
||||||
|
return effectiveUrl
|
||||||
|
case .Archive, .Extension:
|
||||||
|
if isOSX, let osxSubdir {
|
||||||
|
return effectiveUrl
|
||||||
|
.appendingPathComponent(osxSubdir, isDirectory: true)
|
||||||
|
.appendingPathComponent(filename, isDirectory: false)
|
||||||
|
}
|
||||||
|
return effectiveUrl.appendingPathComponent(filename, isDirectory: false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Load a file from bundle into memory. Either by file path or via unzip.
|
||||||
|
func readPayloadFile(_ filename: String, osxSubdir: String?) -> Data? {
|
||||||
|
switch self.type {
|
||||||
|
case .IPA:
|
||||||
|
return zipFile!.unzipFile("Payload/*.app/".appending(filename))
|
||||||
|
case .APK:
|
||||||
|
return nil // not applicable for .apk
|
||||||
|
case .Archive, .Extension:
|
||||||
|
return try? Data(contentsOf: self.effectiveUrl(osxSubdir, filename))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// MARK: - Plist
|
||||||
|
|
||||||
|
extension Data {
|
||||||
|
/// Helper for optional chaining.
|
||||||
|
func asPlistOrNil() -> PlistDict? {
|
||||||
|
if self.isEmpty {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
// var format: PropertyListSerialization.PropertyListFormat = .xml
|
||||||
|
do {
|
||||||
|
return try PropertyListSerialization.propertyList(from: self, format: nil) as? PlistDict
|
||||||
|
} catch {
|
||||||
|
os_log(.error, log: log, "ERROR reading plist %{public}@", error.localizedDescription)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// MARK: - helper methods
|
||||||
|
|
||||||
|
/// breadth-first search for `Info.plist`
|
||||||
|
private func recursiveSearchInfoPlist(_ url: URL) -> URL? {
|
||||||
|
var queue: [URL] = [url]
|
||||||
|
while !queue.isEmpty {
|
||||||
|
let current = queue.removeLast()
|
||||||
|
if current.pathExtension == "framework" {
|
||||||
|
continue // do not evaluate bundled frameworks
|
||||||
|
}
|
||||||
|
if let subfiles = try? FileManager.default.contentsOfDirectory(at: current, includingPropertiesForKeys: []) {
|
||||||
|
for fname in subfiles {
|
||||||
|
if fname.lastPathComponent == "Info.plist" {
|
||||||
|
return fname.parentDir()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
queue.append(contentsOf: subfiles)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
17
src/Common/URL+File.swift
Normal file
17
src/Common/URL+File.swift
Normal file
@@ -0,0 +1,17 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
extension URL {
|
||||||
|
/// Folder where user can mofifications to html template
|
||||||
|
static let UserModDir: URL? =
|
||||||
|
FileManager.default.urls(for: .documentDirectory, in: .userDomainMask).first
|
||||||
|
|
||||||
|
/// Returns `true` if file or folder exists.
|
||||||
|
@inlinable func exists() -> Bool {
|
||||||
|
FileManager.default.fileExists(atPath: self.path)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns URL by deleting last path component
|
||||||
|
@inlinable func parentDir() -> URL {
|
||||||
|
self.deletingLastPathComponent()
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -175,7 +175,6 @@ func unzipFileEntry(_ path: String, _ entry: ZipEntry) -> Data? {
|
|||||||
}
|
}
|
||||||
fp.seek(toFileOffset: UInt64(entry.offset))
|
fp.seek(toFileOffset: UInt64(entry.offset))
|
||||||
let file_record = ZIP_LocalFile(fp.readData(ofLength: ZIP_LocalFile.LENGTH))
|
let file_record = ZIP_LocalFile(fp.readData(ofLength: ZIP_LocalFile.LENGTH))
|
||||||
os_log(.debug, log: log, "header: %{public}@ vs %{public}@", String(describing: file_record), String(describing: entry))
|
|
||||||
|
|
||||||
// central directory size and local file size may differ! use local file for ground truth
|
// central directory size and local file size may differ! use local file for ground truth
|
||||||
let dataOffset = Int(entry.offset) + ZIP_LocalFile.LENGTH + Int(file_record.fileNameLength) + Int(file_record.extraFieldLength)
|
let dataOffset = Int(entry.offset) + ZIP_LocalFile.LENGTH + Int(file_record.fileNameLength) + Int(file_record.extraFieldLength)
|
||||||
@@ -225,9 +224,9 @@ private func listZip(_ path: String) -> [ZipEntry] {
|
|||||||
}
|
}
|
||||||
|
|
||||||
guard let endRecord = findCentralDirectory(fp), endRecord.sizeOfCentralDirectory > 0 else {
|
guard let endRecord = findCentralDirectory(fp), endRecord.sizeOfCentralDirectory > 0 else {
|
||||||
return [];
|
return []
|
||||||
}
|
}
|
||||||
return listDirectoryEntries(fp, endRecord);
|
return listDirectoryEntries(fp, endRecord)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Find signature for central directory.
|
/// Find signature for central directory.
|
||||||
@@ -355,12 +354,23 @@ struct ZipFile {
|
|||||||
/// Unzip file to filesystem.
|
/// Unzip file to filesystem.
|
||||||
/// @param filePath File path inside zip file.
|
/// @param filePath File path inside zip file.
|
||||||
/// @param targetDir Directory in which to unzip the file.
|
/// @param targetDir Directory in which to unzip the file.
|
||||||
func unzipFile(_ filePath: String, toDir targetDir: String) throws {
|
@discardableResult
|
||||||
if let data = self.unzipFile(filePath) {
|
func unzipFile(_ filePath: String, toDir targetDir: String) throws -> String? {
|
||||||
let filename = filePath.components(separatedBy: "/").last!
|
guard let data = self.unzipFile(filePath) else {
|
||||||
let outputPath = targetDir.appending("/" + filename)
|
return nil
|
||||||
os_log(.debug, log: log, "[unzip] write to %{public}@", outputPath)
|
|
||||||
try data.write(to: URL(fileURLWithPath: outputPath), options: .atomic)
|
|
||||||
}
|
}
|
||||||
|
let filename = filePath.components(separatedBy: "/").last!
|
||||||
|
let outputPath = targetDir.appending("/" + filename)
|
||||||
|
os_log(.debug, log: log, "[unzip] write to %{public}@", outputPath)
|
||||||
|
try data.write(to: URL(fileURLWithPath: outputPath), options: .atomic)
|
||||||
|
return outputPath
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Extract selected `filePath` inside zip to a new temporary directory and return path to that file.
|
||||||
|
/// @return Path to extracted data. Returns `nil` or throws exception if data could not be extracted.
|
||||||
|
func unzipFileToTempDir(_ filePath: String) throws -> String? {
|
||||||
|
let tmpPath = NSTemporaryDirectory() + "/" + UUID().uuidString
|
||||||
|
try! FileManager.default.createDirectory(atPath: tmpPath, withIntermediateDirectories: true)
|
||||||
|
return try unzipFile(filePath, toDir: tmpPath)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
45
src/Data - Android/AndroidSdkMap.swift
Normal file
45
src/Data - Android/AndroidSdkMap.swift
Normal file
@@ -0,0 +1,45 @@
|
|||||||
|
// see https://developer.android.com/guide/topics/manifest/uses-sdk-element#api-level-table
|
||||||
|
|
||||||
|
let AndroidSdkMap: [Int: String] = [
|
||||||
|
1: "1.0",
|
||||||
|
2: "1.1",
|
||||||
|
3: "1.5",
|
||||||
|
4: "1.6",
|
||||||
|
5: "2.0",
|
||||||
|
6: "2.0.1",
|
||||||
|
7: "2.1.x",
|
||||||
|
8: "2.2.x",
|
||||||
|
9: "2.3, 2.3.1, 2.3.2",
|
||||||
|
10: "2.3.3, 2.3.4",
|
||||||
|
11: "3.0.x",
|
||||||
|
12: "3.1.x",
|
||||||
|
13: "3.2",
|
||||||
|
14: "4.0, 4.0.1, 4.0.2",
|
||||||
|
15: "4.0.3, 4.0.4",
|
||||||
|
16: "4.1, 4.1.1",
|
||||||
|
17: "4.2, 4.2.2",
|
||||||
|
18: "4.3",
|
||||||
|
19: "4.4",
|
||||||
|
20: "4.4W",
|
||||||
|
21: "5.0",
|
||||||
|
22: "5.1",
|
||||||
|
23: "6.0",
|
||||||
|
24: "7.0",
|
||||||
|
25: "7.1, 7.1.1",
|
||||||
|
26: "8.0",
|
||||||
|
27: "8.1",
|
||||||
|
28: "9",
|
||||||
|
29: "10",
|
||||||
|
30: "11",
|
||||||
|
31: "12",
|
||||||
|
32: "12",
|
||||||
|
33: "13",
|
||||||
|
34: "14",
|
||||||
|
35: "15",
|
||||||
|
36: "16",
|
||||||
|
// can we assume new versions will stick to this scheme?
|
||||||
|
37: "17",
|
||||||
|
38: "18",
|
||||||
|
39: "19",
|
||||||
|
40: "20",
|
||||||
|
]
|
||||||
74
src/Data - Android/Apk+Icon.swift
Normal file
74
src/Data - Android/Apk+Icon.swift
Normal file
@@ -0,0 +1,74 @@
|
|||||||
|
import Foundation
|
||||||
|
import AndroidXML
|
||||||
|
|
||||||
|
extension MetaInfo {
|
||||||
|
/// Read `AndroidManifest.xml` but only extract `appIcon`.
|
||||||
|
func readApk_Icon() -> Apk_Icon? {
|
||||||
|
assert(type == .APK)
|
||||||
|
var apk = Apk(self)
|
||||||
|
return Apk_Icon(&apk)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// MARK: - Apk_Icon
|
||||||
|
|
||||||
|
/// Representation of `AndroidManifest.xml` (containing only the icon extractor).
|
||||||
|
/// Seperate from main class because everything else is not needed for `ThumbnailProvider`
|
||||||
|
struct Apk_Icon {
|
||||||
|
let path: String
|
||||||
|
let data: Data
|
||||||
|
|
||||||
|
init?(_ apk: inout Apk, iconRef: String? = nil) {
|
||||||
|
if apk.isApkm, let iconData = apk.mainZip.unzipFile("icon.png") {
|
||||||
|
path = "icon.png"
|
||||||
|
data = iconData
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
guard let manifest = apk.manifest else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
var ref = iconRef
|
||||||
|
// no need to parse xml if reference already supplied
|
||||||
|
if ref == nil {
|
||||||
|
if let xml = try? AndroidXML.init(data: manifest) {
|
||||||
|
let parser = xml.parseXml()
|
||||||
|
try? parser.iterElements({ startTag, attributes in
|
||||||
|
if startTag == "application" {
|
||||||
|
ref = try? attributes.get("android:icon")?.resolve(parser.stringPool)
|
||||||
|
}
|
||||||
|
}) {_ in}
|
||||||
|
} else {
|
||||||
|
// fallback to xml-string parser
|
||||||
|
ref = ApkXmlIconParser().run(manifest)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
guard let img = apk.resolveIcon(&ref) else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
path = ref!
|
||||||
|
data = img
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Shorter form of `ApkXmlManifestParser` to only exctract the icon reference (used for Thumbnail Provider)
|
||||||
|
private class ApkXmlIconParser: NSObject, XMLParserDelegate {
|
||||||
|
var result: String? = nil
|
||||||
|
|
||||||
|
func run(_ data: Data) -> String? {
|
||||||
|
let parser = XMLParser(data: data)
|
||||||
|
parser.delegate = self
|
||||||
|
parser.parse()
|
||||||
|
return result
|
||||||
|
}
|
||||||
|
|
||||||
|
func parser(_ parser: XMLParser, didStartElement elementName: String, namespaceURI: String?, qualifiedName qName: String?, attributes attrs: [String : String] = [:]) {
|
||||||
|
if elementName == "application" {
|
||||||
|
result = attrs["android:icon"]
|
||||||
|
parser.abortParsing()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
123
src/Data - Android/Apk+Manifest.swift
Normal file
123
src/Data - Android/Apk+Manifest.swift
Normal file
@@ -0,0 +1,123 @@
|
|||||||
|
import Foundation
|
||||||
|
import AndroidXML
|
||||||
|
|
||||||
|
extension MetaInfo {
|
||||||
|
/// Read `AndroidManifest.xml` and parse its content
|
||||||
|
func readApk_Manifest() -> Apk_Manifest? {
|
||||||
|
assert(type == .APK)
|
||||||
|
var apk = Apk(self)
|
||||||
|
return Apk_Manifest.from(&apk)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// MARK: - Apk_Manifest
|
||||||
|
|
||||||
|
/// Representation of `AndroidManifest.xml`.
|
||||||
|
/// See: <https://developer.android.com/guide/topics/manifest/manifest-element>
|
||||||
|
struct Apk_Manifest {
|
||||||
|
var packageId: String? = nil
|
||||||
|
var appName: String? = nil
|
||||||
|
var icon: Apk_Icon? = nil
|
||||||
|
/// Computed property
|
||||||
|
var appIconData: Data? = nil
|
||||||
|
var versionName: String? = nil
|
||||||
|
var versionCode: String? = nil
|
||||||
|
var sdkVerMin: Int? = nil
|
||||||
|
var sdkVerTarget: Int? = nil
|
||||||
|
|
||||||
|
var featuresRequired: [String] = []
|
||||||
|
var featuresOptional: [String] = []
|
||||||
|
var permissions: [String] = []
|
||||||
|
|
||||||
|
static func from(_ apk: inout Apk) -> Self? {
|
||||||
|
guard let manifest = apk.manifest else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
let storage = ApkXmlManifestParser()
|
||||||
|
if let xml = try? AndroidXML.init(data: manifest) {
|
||||||
|
let parser = xml.parseXml()
|
||||||
|
let ignore = XMLParser()
|
||||||
|
try? parser.iterElements({ startTag, attributes in
|
||||||
|
if ALLOWED_TAGS.contains(startTag) {
|
||||||
|
storage.parser(ignore, didStartElement: startTag, namespaceURI: nil, qualifiedName: nil, attributes: try attributes.asDictStr())
|
||||||
|
}
|
||||||
|
}) { endTag in
|
||||||
|
if ALLOWED_TAGS.contains(endTag) {
|
||||||
|
storage.parser(ignore, didEndElement: endTag, namespaceURI: nil, qualifiedName: nil)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
// fallback to xml-string parser
|
||||||
|
let parser = XMLParser(data: manifest)
|
||||||
|
parser.delegate = storage
|
||||||
|
parser.parse()
|
||||||
|
}
|
||||||
|
|
||||||
|
var rv = storage.result
|
||||||
|
apk.resolveName(&rv.appName)
|
||||||
|
rv.icon = Apk_Icon(&apk, iconRef: storage.iconRef)
|
||||||
|
return rv
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// keep in sync with `ApkXmlManifestParser` below
|
||||||
|
private let ALLOWED_TAGS = [
|
||||||
|
"manifest",
|
||||||
|
"application",
|
||||||
|
"uses-feature",
|
||||||
|
"uses-permission",
|
||||||
|
"uses-permission-sdk-23",
|
||||||
|
"uses-sdk",
|
||||||
|
]
|
||||||
|
|
||||||
|
/// Wrapper to use same code for binary-xml and string-xml parsing
|
||||||
|
private class ApkXmlManifestParser: NSObject, XMLParserDelegate {
|
||||||
|
private var _scope: [String] = []
|
||||||
|
var result = Apk_Manifest()
|
||||||
|
var iconRef: String? = nil
|
||||||
|
|
||||||
|
func parser(_ parser: XMLParser, didStartElement elementName: String, namespaceURI: String?, qualifiedName qName: String?, attributes attrs: [String : String] = [:]) {
|
||||||
|
// keep in sync with `ALLOWED_TAGS` above
|
||||||
|
switch elementName {
|
||||||
|
case "manifest":
|
||||||
|
if _scope == [] {
|
||||||
|
result.packageId = attrs["package"] // "org.bundle.id"
|
||||||
|
result.versionName = attrs["android:versionName"] // "7.62.3"
|
||||||
|
result.versionCode = attrs["android:versionCode"] // "160700"
|
||||||
|
// attrs["platformBuildVersionCode"] // "35"
|
||||||
|
// attrs["platformBuildVersionName"] // "15"
|
||||||
|
}
|
||||||
|
case "application":
|
||||||
|
if _scope == ["manifest"] {
|
||||||
|
result.appName = attrs["android:label"] // @resource-ref
|
||||||
|
iconRef = attrs["android:icon"] // @resource-ref
|
||||||
|
}
|
||||||
|
case "uses-permission", "uses-permission-sdk-23":
|
||||||
|
// no "permission" because that will produce duplicates with "uses-permission"
|
||||||
|
if _scope == ["manifest"], let name = attrs["android:name"] {
|
||||||
|
result.permissions.append(name)
|
||||||
|
}
|
||||||
|
case "uses-feature":
|
||||||
|
if _scope == ["manifest"], let name = attrs["android:name"] {
|
||||||
|
if attrs["android:required"] == "false" {
|
||||||
|
result.featuresOptional.append(name)
|
||||||
|
} else {
|
||||||
|
result.featuresRequired.append(name)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
case "uses-sdk":
|
||||||
|
if _scope == ["manifest"] {
|
||||||
|
result.sdkVerMin = Int(attrs["android:minSdkVersion"] ?? "1") // "21"
|
||||||
|
result.sdkVerTarget = Int(attrs["android:targetSdkVersion"] ?? "-1") // "35"
|
||||||
|
}
|
||||||
|
default: break // ignore
|
||||||
|
}
|
||||||
|
_scope.append(elementName)
|
||||||
|
}
|
||||||
|
|
||||||
|
func parser(_ parser: XMLParser, didEndElement elementName: String, namespaceURI: String?, qualifiedName qName: String?) {
|
||||||
|
_scope.removeLast()
|
||||||
|
}
|
||||||
|
}
|
||||||
130
src/Data - Android/Apk.swift
Normal file
130
src/Data - Android/Apk.swift
Normal file
@@ -0,0 +1,130 @@
|
|||||||
|
import Foundation
|
||||||
|
import AndroidXML
|
||||||
|
|
||||||
|
/// Data structure for processing the content of `.apk` files.
|
||||||
|
struct Apk {
|
||||||
|
let isApkm: Bool
|
||||||
|
let mainZip: ZipFile
|
||||||
|
|
||||||
|
init(_ meta: MetaInfo) {
|
||||||
|
isApkm = meta.url.pathExtension.lowercased() == "apkm"
|
||||||
|
mainZip = meta.zipFile!
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Unzip `AndroidManifest.xml` (once). Data is cached until deconstructor.
|
||||||
|
lazy var manifest: Data? = { effectiveZip?.unzipFile("AndroidManifest.xml") }()
|
||||||
|
|
||||||
|
/// Select zip-file depending on `.apk` or `.apkm` extension
|
||||||
|
private lazy var effectiveZip: ZipFile? = { isApkm ? nestedZip : mainZip }()
|
||||||
|
|
||||||
|
/// `.apkm` may contain multiple `.apk` files. (plus "icon.png" and "info.json" files)
|
||||||
|
private lazy var nestedZip: ZipFile? = {
|
||||||
|
if isApkm, let pth = try? mainZip.unzipFileToTempDir("base.apk") {
|
||||||
|
return ZipFile(pth)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}()
|
||||||
|
|
||||||
|
/// Shared instance for resolving resources
|
||||||
|
private lazy var resourceParser: Tbl_Parser? = {
|
||||||
|
guard let data = effectiveZip?.unzipFile("resources.arsc"),
|
||||||
|
let xml = try? AndroidXML.init(data: data), xml.type == .Table else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
return xml.parseTable()
|
||||||
|
}()
|
||||||
|
|
||||||
|
/// Lookup app bundle name / label
|
||||||
|
mutating func resolveName(_ name: inout String?) {
|
||||||
|
if let val = name, let ref = try? TblTableRef(val), let parser = resourceParser {
|
||||||
|
name = parser.getName(ref)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Lookup image path and image data
|
||||||
|
mutating func resolveIcon(_ iconRef: inout String?) -> Data? {
|
||||||
|
if let val = iconRef, let ref = try? TblTableRef(val), let parser = resourceParser {
|
||||||
|
if let iconPath = parser.getIconDirect(ref) ?? parser.getIconIndirect(ref) {
|
||||||
|
iconRef = iconPath
|
||||||
|
return effectiveZip?.unzipFile(iconPath)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private extension Tbl_Parser {
|
||||||
|
func getName(_ ref: TblTableRef) -> String? {
|
||||||
|
// why the heck are these even allowed?
|
||||||
|
// apparently there can be references onto references
|
||||||
|
var ref = ref
|
||||||
|
while let res = try? self.getResource(ref) {
|
||||||
|
guard let val = res.entries.first?.entry.value else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
switch val.dataType {
|
||||||
|
case .Reference: ref = val.asTableRef // and continue
|
||||||
|
case .String: return val.resolve(self.stringPool)
|
||||||
|
default: return nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Lookup resource with matching id. Choose the icon with the highest density.
|
||||||
|
func getIconDirect(_ ref: TblTableRef) -> String? {
|
||||||
|
guard let res = try? self.getResource(ref) else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
var best: ResValue? = nil
|
||||||
|
var bestScore: UInt16 = 0
|
||||||
|
for e in res.entries {
|
||||||
|
switch e.config.screenType.density {
|
||||||
|
case .Default, .any, .None: continue
|
||||||
|
case let density:
|
||||||
|
if density.rawValue > bestScore, let val = e.entry.value {
|
||||||
|
bestScore = density.rawValue
|
||||||
|
best = val
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return best?.resolve(self.stringPool)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over all entries and choose best-rated icon file.
|
||||||
|
/// Rating prefers files which have an attribute name `"app_icon"` or `"ic_launcher"`.
|
||||||
|
func getIconIndirect(_ ref: TblTableRef) -> String? {
|
||||||
|
// sadly we cannot just `getResource()` because that can point to an app banner
|
||||||
|
guard let pkg = try? self.getPackage(ref.package),
|
||||||
|
var pool = pkg.stringPool(for: .Keys),
|
||||||
|
let (_, types) = try? pkg.getType(ref.type) else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
// density is 120-640
|
||||||
|
let rates: [String: UInt16] = [
|
||||||
|
"app_icon": 1000,
|
||||||
|
"ic_launcher": 800,
|
||||||
|
"ic_launcher_foreground": 200,
|
||||||
|
]
|
||||||
|
var best: ResValue? = nil
|
||||||
|
var bestScore: UInt16 = 0
|
||||||
|
for typ in types {
|
||||||
|
switch typ.config.screenType.density {
|
||||||
|
case .any, .None: continue
|
||||||
|
case let density:
|
||||||
|
try? typ.iterValues {
|
||||||
|
if let val = $1.value {
|
||||||
|
let attrName = pool.getStringCached($1.key)
|
||||||
|
let score = density.rawValue + (rates[attrName] ?? 0)
|
||||||
|
if score > bestScore {
|
||||||
|
bestScore = score
|
||||||
|
best = val
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return best?.resolve(self.stringPool)
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,5 +1,3 @@
|
|||||||
import Foundation
|
|
||||||
|
|
||||||
/*
|
/*
|
||||||
#!/usr/bin/env python3
|
#!/usr/bin/env python3
|
||||||
# download: https://itunes.apple.com/WebObjects/MZStoreServices.woa/ws/genres
|
# download: https://itunes.apple.com/WebObjects/MZStoreServices.woa/ws/genres
|
||||||
@@ -67,6 +67,8 @@ struct Entitlements {
|
|||||||
|
|
||||||
// MARK: - SecCode in-memory reader
|
// MARK: - SecCode in-memory reader
|
||||||
|
|
||||||
|
// Same as system call:
|
||||||
|
// `codesign -d ./binary --entitlements - --xml` or: `codesign -d ./binary --entitlements :-`
|
||||||
/// use in-memory `SecCode` for entitlement extraction
|
/// use in-memory `SecCode` for entitlement extraction
|
||||||
private func getSecCodeEntitlements() -> PlistDict? {
|
private func getSecCodeEntitlements() -> PlistDict? {
|
||||||
let url = URL(fileURLWithPath: self.binaryPath)
|
let url = URL(fileURLWithPath: self.binaryPath)
|
||||||
@@ -84,13 +86,13 @@ struct Entitlements {
|
|||||||
|
|
||||||
// if 'entitlements-dict' key exists, use that one
|
// if 'entitlements-dict' key exists, use that one
|
||||||
os_log(.debug, log: log, "[entitlements] read SecCode 'entitlements-dict' key")
|
os_log(.debug, log: log, "[entitlements] read SecCode 'entitlements-dict' key")
|
||||||
if let plist = requirementInfo[kSecCodeInfoEntitlementsDict as String] as? PlistDict {
|
if let plist = requirementInfo[kSecCodeInfoEntitlementsDict as String] as? PlistDict, !plist.isEmpty {
|
||||||
return plist
|
return plist
|
||||||
}
|
}
|
||||||
|
|
||||||
// else, fallback to parse data from 'entitlements' key
|
// else, fallback to parse data from 'entitlements' key
|
||||||
os_log(.debug, log: log, "[entitlements] read SecCode 'entitlements' key")
|
os_log(.debug, log: log, "[entitlements] read SecCode 'entitlements' key")
|
||||||
guard let data = requirementInfo[kSecCodeInfoEntitlements as String] as? Data else {
|
guard let data = requirementInfo[kSecCodeInfoEntitlements as String] as? Data, !data.isEmpty else {
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -107,7 +109,10 @@ struct Entitlements {
|
|||||||
os_log(.error, log: log, "[entitlements] unpack error for FADE7171 size %lu != %lu", data.count, size)
|
os_log(.error, log: log, "[entitlements] unpack error for FADE7171 size %lu != %lu", data.count, size)
|
||||||
// but try anyway
|
// but try anyway
|
||||||
}
|
}
|
||||||
return data.subdata(in: 8..<data.count).asPlistOrNil()
|
guard let rv = data.subdata(in: 8..<data.count).asPlistOrNil(), !rv.isEmpty else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
return rv
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
65
src/Data - Apple/Plist+Icon.swift
Normal file
65
src/Data - Apple/Plist+Icon.swift
Normal file
@@ -0,0 +1,65 @@
|
|||||||
|
|
||||||
|
extension MetaInfo {
|
||||||
|
/// Read `Info.plist`. (used for `ThumbnailProvider`)
|
||||||
|
func readPlist_Icon() -> Plist_Icon? {
|
||||||
|
if let x = self.readPayloadFile("Info.plist", osxSubdir: nil)?.asPlistOrNil() {
|
||||||
|
return Plist_Icon(x)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// MARK: - Plist_Icon
|
||||||
|
|
||||||
|
/// Representation of `Info.plist` (containing only the icon extractor).
|
||||||
|
/// Seperate from main class because everything else is not needed for `ThumbnailProvider`
|
||||||
|
struct Plist_Icon {
|
||||||
|
let filenames: [String]
|
||||||
|
|
||||||
|
init(_ plist: PlistDict) {
|
||||||
|
filenames = parseIconNames(plist)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Find icon filenames.
|
||||||
|
/// @return Filenames which do not necessarily exist on filesystem. This may include `@2x` and/or no file extension.
|
||||||
|
private func parseIconNames(_ plist: PlistDict) -> [String] {
|
||||||
|
// Check for CFBundleIcons (since 5.0)
|
||||||
|
if let icons = unpackNameList(plist["CFBundleIcons"]) {
|
||||||
|
return icons
|
||||||
|
}
|
||||||
|
// iPad-only apps
|
||||||
|
if let icons = unpackNameList(plist["CFBundleIcons~ipad"]) {
|
||||||
|
return icons
|
||||||
|
}
|
||||||
|
// Check for CFBundleIconFiles (since 3.2)
|
||||||
|
if let icons = plist["CFBundleIconFiles"] as? [String], !icons.isEmpty {
|
||||||
|
return icons
|
||||||
|
}
|
||||||
|
// key found on iTunesU app
|
||||||
|
if let icons = plist["Icon files"] as? [String], !icons.isEmpty {
|
||||||
|
return icons
|
||||||
|
}
|
||||||
|
// Check for CFBundleIconFile (legacy, before 3.2)
|
||||||
|
if let icon = plist["CFBundleIconFile"] as? String { // may be nil
|
||||||
|
return [icon]
|
||||||
|
}
|
||||||
|
return []
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Deep select icons from plist key `CFBundleIcons` and `CFBundleIcons~ipad`
|
||||||
|
/// @return Guarantees a non-empty array (or `nil`)
|
||||||
|
private func unpackNameList(_ bundleDict: Any?) -> [String]? {
|
||||||
|
if let bundleDict = bundleDict as? PlistDict {
|
||||||
|
if let primaryDict = bundleDict["CFBundlePrimaryIcon"] as? PlistDict {
|
||||||
|
if let icons = primaryDict["CFBundleIconFiles"] as? [String], !icons.isEmpty {
|
||||||
|
return icons
|
||||||
|
}
|
||||||
|
if let name = primaryDict["CFBundleIconName"] as? String { // key found on a .tipa file
|
||||||
|
return [name]
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
70
src/Data - Apple/Plist+Info.swift
Normal file
70
src/Data - Apple/Plist+Info.swift
Normal file
@@ -0,0 +1,70 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
extension MetaInfo {
|
||||||
|
/// Read `Info.plist`. (used for `PreviewProvider`)
|
||||||
|
func readPlist_Info() -> Plist_Info? {
|
||||||
|
if let x = self.readPayloadFile("Info.plist", osxSubdir: nil)?.asPlistOrNil() {
|
||||||
|
return Plist_Info(x, isOSX: isOSX)
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// MARK: - Plist_Info
|
||||||
|
|
||||||
|
/// Representation of `Info.plist` of an `.ipa` bundle
|
||||||
|
struct Plist_Info {
|
||||||
|
let bundleId: String?
|
||||||
|
let name: String?
|
||||||
|
let version: String?
|
||||||
|
let buildVersion: String?
|
||||||
|
|
||||||
|
let exePath: String?
|
||||||
|
let sdkVersion: String?
|
||||||
|
let minOS: String?
|
||||||
|
let extensionType: String?
|
||||||
|
|
||||||
|
let icons: [String]
|
||||||
|
let deviceFamily: [String]
|
||||||
|
let transportSecurity: PlistDict?
|
||||||
|
|
||||||
|
init(_ plist: PlistDict, isOSX: Bool) {
|
||||||
|
bundleId = plist["CFBundleIdentifier"] as? String
|
||||||
|
name = plist["CFBundleDisplayName"] as? String ?? plist["CFBundleName"] as? String
|
||||||
|
version = plist["CFBundleShortVersionString"] as? String
|
||||||
|
buildVersion = plist["CFBundleVersion"] as? String
|
||||||
|
exePath = plist["CFBundleExecutable"] as? String
|
||||||
|
sdkVersion = plist["DTSDKName"] as? String
|
||||||
|
minOS = plist[isOSX ? "LSMinimumSystemVersion" : "MinimumOSVersion"] as? String
|
||||||
|
extensionType = (plist["NSExtension"] as? PlistDict)?["NSExtensionPointIdentifier"] as? String
|
||||||
|
icons = Plist_Icon(plist).filenames
|
||||||
|
deviceFamily = parseDeviceFamily(plist, isOSX: isOSX)
|
||||||
|
transportSecurity = plist["NSAppTransportSecurity"] as? PlistDict
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private func parseDeviceFamily(_ plist: PlistDict, isOSX: Bool) -> [String] {
|
||||||
|
if isOSX {
|
||||||
|
return plist["CFBundleSupportedPlatforms"] as? [String] ?? ["macOS"]
|
||||||
|
}
|
||||||
|
|
||||||
|
if let platforms = (plist["UIDeviceFamily"] as? [Int])?.compactMap({
|
||||||
|
switch $0 {
|
||||||
|
case 1: "iPhone"
|
||||||
|
case 2: "iPad"
|
||||||
|
case 3: "TV"
|
||||||
|
case 4: "Watch"
|
||||||
|
default: nil
|
||||||
|
}
|
||||||
|
}), platforms.count > 0 {
|
||||||
|
return platforms
|
||||||
|
}
|
||||||
|
|
||||||
|
if let minVersion = plist["MinimumOSVersion"] as? String {
|
||||||
|
if minVersion.hasPrefix("1.") || minVersion.hasPrefix("2.") || minVersion.hasPrefix("3.") {
|
||||||
|
return ["iPhone"]
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return []
|
||||||
|
}
|
||||||
61
src/Data - Apple/Plist+MobileProvision.swift
Normal file
61
src/Data - Apple/Plist+MobileProvision.swift
Normal file
@@ -0,0 +1,61 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
extension MetaInfo {
|
||||||
|
/// Read `embedded.mobileprovision` (if available) and decode with CMS decoder.
|
||||||
|
func readPlist_MobileProvision() -> Plist_MobileProvision? {
|
||||||
|
guard let provisionData = self.readPayloadFile("embedded.mobileprovision", osxSubdir: nil),
|
||||||
|
let plist = provisionData.decodeCMS().asPlistOrNil() else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
return Plist_MobileProvision(plist, isOSX: self.isOSX)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// MARK: - Plist_MobileProvision
|
||||||
|
|
||||||
|
/// Representation of `embedded.mobileprovision`
|
||||||
|
struct Plist_MobileProvision {
|
||||||
|
let creationDate: Date?
|
||||||
|
let expireDate: Date?
|
||||||
|
let profileId: String?
|
||||||
|
let profileName: String?
|
||||||
|
/// Something like "Development" or "Distribution (App Store)".
|
||||||
|
let profileType: String
|
||||||
|
/// Either "Mac" or "iOS"
|
||||||
|
let profilePlatform: String
|
||||||
|
let teamName: String?
|
||||||
|
let teamIds: [String]
|
||||||
|
let devices: [String]
|
||||||
|
let certificates: [ProvisioningCertificate]
|
||||||
|
let entitlements: PlistDict?
|
||||||
|
|
||||||
|
init(_ plist: PlistDict, isOSX: Bool) {
|
||||||
|
creationDate = plist["CreationDate"] as? Date
|
||||||
|
expireDate = plist["ExpirationDate"] as? Date
|
||||||
|
profileId = plist["UUID"] as? String
|
||||||
|
profileName = plist["Name"] as? String
|
||||||
|
profileType = parseProfileType(plist, isOSX: isOSX)
|
||||||
|
profilePlatform = isOSX ? "Mac" : "iOS"
|
||||||
|
teamName = plist["TeamName"] as? String
|
||||||
|
teamIds = plist["TeamIdentifier"] as? [String] ?? []
|
||||||
|
devices = plist["ProvisionedDevices"] as? [String] ?? []
|
||||||
|
certificates = (plist["DeveloperCertificates"] as? [Data] ?? []).compactMap {
|
||||||
|
ProvisioningCertificate($0)
|
||||||
|
}
|
||||||
|
entitlements = plist["Entitlements"] as? PlistDict
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns provision type string like "Development" or "Distribution (App Store)".
|
||||||
|
private func parseProfileType(_ plist: PlistDict, isOSX: Bool) -> String {
|
||||||
|
let hasDevices = plist["ProvisionedDevices"] is [Any]
|
||||||
|
if isOSX {
|
||||||
|
return hasDevices ? "Development" : "Distribution (App Store)"
|
||||||
|
}
|
||||||
|
if hasDevices {
|
||||||
|
let getTaskAllow = (plist["Entitlements"] as? PlistDict)?["get-task-allow"] as? Bool ?? false
|
||||||
|
return getTaskAllow ? "Development" : "Distribution (Ad Hoc)"
|
||||||
|
}
|
||||||
|
let isEnterprise = plist["ProvisionsAllDevices"] as? Bool ?? false
|
||||||
|
return isEnterprise ? "Enterprise" : "Distribution (App Store)"
|
||||||
|
}
|
||||||
77
src/Data - Apple/Plist+iTunesMetadata.swift
Normal file
77
src/Data - Apple/Plist+iTunesMetadata.swift
Normal file
@@ -0,0 +1,77 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
extension MetaInfo {
|
||||||
|
/// Read `iTunesMetadata.plist` (if available)
|
||||||
|
func readPlist_iTunesMetadata() -> Plist_iTunesMetadata? {
|
||||||
|
assert(type == .IPA)
|
||||||
|
// not `readPayloadFile` because plist is in root dir
|
||||||
|
guard let plist = self.zipFile!.unzipFile("iTunesMetadata.plist")?.asPlistOrNil() else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
return Plist_iTunesMetadata(plist)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// MARK: - Plist_iTunesMetadata
|
||||||
|
|
||||||
|
/// Representation of `iTunesMetadata.plist`
|
||||||
|
struct Plist_iTunesMetadata {
|
||||||
|
let appId: Int?
|
||||||
|
let appName: String?
|
||||||
|
let price: String?
|
||||||
|
let genres: [String]
|
||||||
|
// purchase info
|
||||||
|
let releaseDate: Date?
|
||||||
|
let purchaseDate: Date?
|
||||||
|
// account info
|
||||||
|
let appleId: String?
|
||||||
|
let firstName: String?
|
||||||
|
let lastName: String?
|
||||||
|
|
||||||
|
init(_ plist: PlistDict) {
|
||||||
|
appId = plist["itemId"] as? Int
|
||||||
|
appName = plist["itemName"] as? String
|
||||||
|
price = plist["priceDisplay"] as? String
|
||||||
|
genres = formattedGenres(plist)
|
||||||
|
// download info
|
||||||
|
let downloadInfo = plist["com.apple.iTunesStore.downloadInfo"] as? PlistDict
|
||||||
|
purchaseDate = Date.parseAny(downloadInfo?["purchaseDate"] ?? plist["purchaseDate"])
|
||||||
|
releaseDate = Date.parseAny(downloadInfo?["releaseDate"] ?? plist["releaseDate"])
|
||||||
|
// AppleId & purchaser name
|
||||||
|
let accountInfo = downloadInfo?["accountInfo"] as? PlistDict ?? [:]
|
||||||
|
appleId = accountInfo["AppleID"] as? String ?? plist["appleId"] as? String
|
||||||
|
firstName = accountInfo["FirstName"] as? String
|
||||||
|
lastName = accountInfo["LastName"] as? String
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns `"<firstName> <lastName> (<appleId>)"` (with empty values omitted)
|
||||||
|
var purchaserName: String? {
|
||||||
|
let fn = firstName ?? ""
|
||||||
|
let ln = lastName ?? ""
|
||||||
|
let aid = appleId ?? ""
|
||||||
|
switch (fn.isEmpty, ln.isEmpty, aid.isEmpty) {
|
||||||
|
case (true, true, true): return nil
|
||||||
|
case (true, true, false): return "\(aid)"
|
||||||
|
case (_, _, false): return "\(fn) \(ln) (\(aid))"
|
||||||
|
case (_, _, true): return "\(fn) \(ln)"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Concatenate all (sub)genres into flat list.
|
||||||
|
private func formattedGenres(_ plist: PlistDict) -> [String] {
|
||||||
|
var genres: [String] = []
|
||||||
|
let genreId = plist["genreId"] as? Int ?? 0
|
||||||
|
if let mainGenre = AppCategories[genreId] ?? plist["genre"] as? String {
|
||||||
|
genres.append(mainGenre)
|
||||||
|
}
|
||||||
|
|
||||||
|
for subgenre in plist["subgenres"] as? [PlistDict] ?? [] {
|
||||||
|
let subgenreId = subgenre["genreId"] as? Int ?? 0
|
||||||
|
if let subgenreStr = AppCategories[subgenreId] ?? subgenre["genre"] as? String {
|
||||||
|
genres.append(subgenreStr)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return genres
|
||||||
|
}
|
||||||
58
src/Data - Apple/Provisioning.swift
Normal file
58
src/Data - Apple/Provisioning.swift
Normal file
@@ -0,0 +1,58 @@
|
|||||||
|
import Foundation
|
||||||
|
import os // OSLog
|
||||||
|
|
||||||
|
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "Provisioning")
|
||||||
|
|
||||||
|
extension Data {
|
||||||
|
/// In-memory decode of `embedded.mobileprovision`
|
||||||
|
func decodeCMS() -> Data {
|
||||||
|
var decoder: CMSDecoder? = nil
|
||||||
|
CMSDecoderCreate(&decoder)
|
||||||
|
return self.withUnsafeBytes { ptr in
|
||||||
|
CMSDecoderUpdateMessage(decoder!, ptr.baseAddress!, self.count)
|
||||||
|
CMSDecoderFinalizeMessage(decoder!)
|
||||||
|
var dataRef: CFData?
|
||||||
|
CMSDecoderCopyContent(decoder!, &dataRef)
|
||||||
|
return Data(referencing: dataRef!)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
struct ProvisioningCertificate {
|
||||||
|
let subject: String
|
||||||
|
let expiration: Date?
|
||||||
|
|
||||||
|
/// Parse subject and expiration date from certificate.
|
||||||
|
init?(_ data: Data) {
|
||||||
|
guard let cert = SecCertificateCreateWithData(nil, data as CFData) else {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
guard let subj = SecCertificateCopySubjectSummary(cert) as? String else {
|
||||||
|
os_log(.error, log: log, "Could not get subject from certificate")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
subject = subj
|
||||||
|
expiration = parseInvalidityDate(cert, subject: subj)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Process a single certificate. Extract invalidity / expiration date.
|
||||||
|
/// @param subject just used for printing error logs.
|
||||||
|
private func parseInvalidityDate(_ certificate: SecCertificate, subject: String) -> Date? {
|
||||||
|
var error: Unmanaged<CFError>?
|
||||||
|
guard let outerDict = SecCertificateCopyValues(certificate, [kSecOIDInvalidityDate] as CFArray, &error) as? PlistDict else {
|
||||||
|
os_log(.error, log: log, "Could not get values in '%{public}@' certificate, error = %{public}@", subject, error?.takeUnretainedValue().localizedDescription ?? "unknown error")
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
guard let innerDict = outerDict[kSecOIDInvalidityDate as String] as? PlistDict else {
|
||||||
|
os_log(.error, log: log, "No invalidity values in '%{public}@' certificate, dictionary = %{public}@", subject, outerDict)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
// NOTE: the invalidity date type of kSecPropertyTypeDate is documented as a CFStringRef in the "Certificate, Key, and Trust Services Reference".
|
||||||
|
// In reality, it's a __NSTaggedDate (presumably a tagged pointer representing an NSDate.) But to be sure, we'll check:
|
||||||
|
guard let dateString = innerDict[kSecPropertyKeyValue as String] else {
|
||||||
|
os_log(.error, log: log, "No invalidity date in '%{public}@' certificate, dictionary = %{public}@", subject, innerDict)
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
return Date.parseAny(dateString)
|
||||||
|
}
|
||||||
@@ -1,103 +0,0 @@
|
|||||||
import Foundation
|
|
||||||
|
|
||||||
/// Print recursive tree of key-value mappings.
|
|
||||||
private func recursiveDict(_ dictionary: [String: Any], withReplacements replacements: [String: String] = [:], _ level: Int = 0) -> String {
|
|
||||||
var output = ""
|
|
||||||
for (key, value) in dictionary {
|
|
||||||
let localizedKey = replacements[key] ?? key
|
|
||||||
for _ in 0..<level {
|
|
||||||
output += (level == 1) ? "- " : " "
|
|
||||||
}
|
|
||||||
|
|
||||||
if let subDict = value as? [String: Any] {
|
|
||||||
output += "\(localizedKey):<div class=\"list\">\n"
|
|
||||||
output += recursiveDict(subDict, withReplacements: replacements, level + 1)
|
|
||||||
output += "</div>\n"
|
|
||||||
} else if let number = value as? NSNumber {
|
|
||||||
output += "\(localizedKey): \(number.boolValue ? "YES" : "NO")<br />"
|
|
||||||
} else {
|
|
||||||
output += "\(localizedKey): \(value)<br />"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return output
|
|
||||||
}
|
|
||||||
|
|
||||||
extension HtmlGenerator {
|
|
||||||
/// @return List of ATS flags.
|
|
||||||
private func formattedAppTransportSecurity(_ appPlist: PlistDict) -> String {
|
|
||||||
if let value = appPlist["NSAppTransportSecurity"] as? PlistDict {
|
|
||||||
let localizedKeys = [
|
|
||||||
"NSAllowsArbitraryLoads": "Allows Arbitrary Loads",
|
|
||||||
"NSAllowsArbitraryLoadsForMedia": "Allows Arbitrary Loads for Media",
|
|
||||||
"NSAllowsArbitraryLoadsInWebContent": "Allows Arbitrary Loads in Web Content",
|
|
||||||
"NSAllowsLocalNetworking": "Allows Local Networking",
|
|
||||||
"NSExceptionDomains": "Exception Domains",
|
|
||||||
|
|
||||||
"NSIncludesSubdomains": "Includes Subdomains",
|
|
||||||
"NSRequiresCertificateTransparency": "Requires Certificate Transparency",
|
|
||||||
|
|
||||||
"NSExceptionAllowsInsecureHTTPLoads": "Allows Insecure HTTP Loads",
|
|
||||||
"NSExceptionMinimumTLSVersion": "Minimum TLS Version",
|
|
||||||
"NSExceptionRequiresForwardSecrecy": "Requires Forward Secrecy",
|
|
||||||
|
|
||||||
"NSThirdPartyExceptionAllowsInsecureHTTPLoads": "Allows Insecure HTTP Loads",
|
|
||||||
"NSThirdPartyExceptionMinimumTLSVersion": "Minimum TLS Version",
|
|
||||||
"NSThirdPartyExceptionRequiresForwardSecrecy": "Requires Forward Secrecy",
|
|
||||||
]
|
|
||||||
|
|
||||||
return "<div class=\"list\">\(recursiveDict(value, withReplacements: localizedKeys))</div>"
|
|
||||||
}
|
|
||||||
|
|
||||||
let sdkName = appPlist["DTSDKName"] as? String ?? "0"
|
|
||||||
let sdkNumber = Double(sdkName.trimmingCharacters(in: .letters)) ?? 0
|
|
||||||
if sdkNumber < 9.0 {
|
|
||||||
return "Not applicable before iOS 9.0"
|
|
||||||
}
|
|
||||||
return "No exceptions"
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Process info stored in `Info.plist`
|
|
||||||
mutating func procAppInfo(_ appPlist: PlistDict?) {
|
|
||||||
guard let appPlist else {
|
|
||||||
self.apply([
|
|
||||||
"AppInfoHidden": "hiddenDiv",
|
|
||||||
"ProvisionTitleHidden": "",
|
|
||||||
])
|
|
||||||
return
|
|
||||||
}
|
|
||||||
|
|
||||||
var platforms = (appPlist["UIDeviceFamily"] as? [Int])?.compactMap({
|
|
||||||
switch $0 {
|
|
||||||
case 1: return "iPhone"
|
|
||||||
case 2: return "iPad"
|
|
||||||
case 3: return "TV"
|
|
||||||
case 4: return "Watch"
|
|
||||||
default: return nil
|
|
||||||
}
|
|
||||||
}).joined(separator: ", ")
|
|
||||||
|
|
||||||
let minVersion = appPlist["MinimumOSVersion"] as? String ?? ""
|
|
||||||
if platforms?.isEmpty ?? true, minVersion.hasPrefix("1.") || minVersion.hasPrefix("2.") || minVersion.hasPrefix("3.") {
|
|
||||||
platforms = "iPhone"
|
|
||||||
}
|
|
||||||
|
|
||||||
let extensionType = (appPlist["NSExtension"] as? PlistDict)?["NSExtensionPointIdentifier"] as? String
|
|
||||||
self.apply([
|
|
||||||
"AppInfoHidden": "",
|
|
||||||
"ProvisionTitleHidden": "hiddenDiv",
|
|
||||||
|
|
||||||
"CFBundleName": appPlist["CFBundleDisplayName"] as? String ?? appPlist["CFBundleName"] as? String ?? "",
|
|
||||||
"CFBundleShortVersionString": appPlist["CFBundleShortVersionString"] as? String ?? "",
|
|
||||||
"CFBundleVersion": appPlist["CFBundleVersion"] as? String ?? "",
|
|
||||||
"CFBundleIdentifier": appPlist["CFBundleIdentifier"] as? String ?? "",
|
|
||||||
|
|
||||||
"ExtensionTypeHidden": extensionType != nil ? "" : "hiddenDiv",
|
|
||||||
"ExtensionType": extensionType ?? "",
|
|
||||||
|
|
||||||
"UIDeviceFamily": platforms ?? "",
|
|
||||||
"DTSDKName": appPlist["DTSDKName"] as? String ?? "",
|
|
||||||
"MinimumOSVersion": minVersion,
|
|
||||||
"AppTransportSecurityFormatted": formattedAppTransportSecurity(appPlist),
|
|
||||||
])
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,36 +0,0 @@
|
|||||||
import Foundation
|
|
||||||
|
|
||||||
extension HtmlGenerator {
|
|
||||||
/// Search for app binary and run `codesign` on it.
|
|
||||||
private func readEntitlements(_ meta: MetaInfo, _ bundleExecutable: String?) -> Entitlements {
|
|
||||||
guard let bundleExecutable else {
|
|
||||||
return Entitlements.withoutBinary()
|
|
||||||
}
|
|
||||||
|
|
||||||
switch meta.type {
|
|
||||||
case .IPA:
|
|
||||||
let tmpPath = NSTemporaryDirectory() + "/" + UUID().uuidString
|
|
||||||
try! FileManager.default.createDirectory(atPath: tmpPath, withIntermediateDirectories: true)
|
|
||||||
defer {
|
|
||||||
try? FileManager.default.removeItem(atPath: tmpPath)
|
|
||||||
}
|
|
||||||
try! meta.zipFile!.unzipFile("Payload/*.app/\(bundleExecutable)", toDir: tmpPath)
|
|
||||||
return Entitlements(forBinary: tmpPath + "/" + bundleExecutable)
|
|
||||||
case .Archive:
|
|
||||||
return Entitlements(forBinary: meta.effectiveUrl!.path + "/" + bundleExecutable)
|
|
||||||
case .Extension:
|
|
||||||
return Entitlements(forBinary: meta.url.path + "/" + bundleExecutable)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Process compiled binary and provision plist to extract `Entitlements`
|
|
||||||
mutating func procEntitlements(_ meta: MetaInfo, _ appPlist: PlistDict?, _ provisionPlist: PlistDict?) {
|
|
||||||
var entitlements = readEntitlements(meta, appPlist?["CFBundleExecutable"] as? String)
|
|
||||||
entitlements.applyFallbackIfNeeded(provisionPlist?["Entitlements"] as? PlistDict)
|
|
||||||
|
|
||||||
self.apply([
|
|
||||||
"EntitlementsWarningHidden": entitlements.hasError ? "" : "hiddenDiv",
|
|
||||||
"EntitlementsFormatted": entitlements.html ?? "No Entitlements",
|
|
||||||
])
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,160 +0,0 @@
|
|||||||
import Foundation
|
|
||||||
import os // OSLog
|
|
||||||
|
|
||||||
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "Html+Certificates")
|
|
||||||
|
|
||||||
|
|
||||||
extension MetaInfo {
|
|
||||||
/// Read `embedded.mobileprovision` file and decode with CMS decoder.
|
|
||||||
func readPlistProvision() -> PlistDict? {
|
|
||||||
guard let provisionData = self.readPayloadFile("embedded.mobileprovision") else {
|
|
||||||
os_log(.info, log: log, "No embedded.mobileprovision file for %{public}@", self.url.path)
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
|
|
||||||
var decoder: CMSDecoder? = nil
|
|
||||||
CMSDecoderCreate(&decoder)
|
|
||||||
let data = provisionData.withUnsafeBytes { ptr in
|
|
||||||
CMSDecoderUpdateMessage(decoder!, ptr.baseAddress!, provisionData.count)
|
|
||||||
CMSDecoderFinalizeMessage(decoder!)
|
|
||||||
var dataRef: CFData?
|
|
||||||
CMSDecoderCopyContent(decoder!, &dataRef)
|
|
||||||
return Data(referencing: dataRef!)
|
|
||||||
}
|
|
||||||
return data.asPlistOrNil()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
extension HtmlGenerator {
|
|
||||||
|
|
||||||
// MARK: - Certificates
|
|
||||||
|
|
||||||
/// Process a single certificate. Extract invalidity / expiration date.
|
|
||||||
/// @param subject just used for printing error logs.
|
|
||||||
private func getCertificateInvalidityDate(_ certificate: SecCertificate, subject: String) -> Date? {
|
|
||||||
var error: Unmanaged<CFError>?
|
|
||||||
guard let outerDict = SecCertificateCopyValues(certificate, [kSecOIDInvalidityDate] as CFArray, &error) as? PlistDict else {
|
|
||||||
os_log(.error, log: log, "Could not get values in '%{public}@' certificate, error = %{public}@", subject, error?.takeUnretainedValue().localizedDescription ?? "unknown error")
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
guard let innerDict = outerDict[kSecOIDInvalidityDate as String] as? PlistDict else {
|
|
||||||
os_log(.error, log: log, "No invalidity values in '%{public}@' certificate, dictionary = %{public}@", subject, outerDict)
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
// NOTE: the invalidity date type of kSecPropertyTypeDate is documented as a CFStringRef in the "Certificate, Key, and Trust Services Reference".
|
|
||||||
// In reality, it's a __NSTaggedDate (presumably a tagged pointer representing an NSDate.) But to be sure, we'll check:
|
|
||||||
guard let dateString = innerDict[kSecPropertyKeyValue as String] else {
|
|
||||||
os_log(.error, log: log, "No invalidity date in '%{public}@' certificate, dictionary = %{public}@", subject, innerDict)
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
return Date.parseAny(dateString);
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Process list of all certificates. Return a two column table with subject and expiration date.
|
|
||||||
private func getCertificateList(_ provisionPlist: PlistDict) -> [TableRow] {
|
|
||||||
guard let certs = provisionPlist["DeveloperCertificates"] as? [Data] else {
|
|
||||||
return []
|
|
||||||
}
|
|
||||||
return certs.compactMap {
|
|
||||||
guard let cert = SecCertificateCreateWithData(nil, $0 as CFData) else {
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
guard let subject = SecCertificateCopySubjectSummary(cert) as? String else {
|
|
||||||
os_log(.error, log: log, "Could not get subject from certificate")
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
let expiration: String
|
|
||||||
if let invalidityDate = getCertificateInvalidityDate(cert, subject: subject) {
|
|
||||||
expiration = invalidityDate.relativeExpirationDateString()
|
|
||||||
} else {
|
|
||||||
expiration = "<span class='warning'>No invalidity date in certificate</span>"
|
|
||||||
}
|
|
||||||
return TableRow([subject, expiration])
|
|
||||||
}.sorted { $0[0] < $1[0] }
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// MARK: - Provisioning
|
|
||||||
|
|
||||||
/// Returns provision type string like "Development" or "Distribution (App Store)".
|
|
||||||
private func stringForProfileType(_ provisionPlist: PlistDict, isOSX: Bool) -> String {
|
|
||||||
let hasDevices = provisionPlist["ProvisionedDevices"] is [Any]
|
|
||||||
if isOSX {
|
|
||||||
return hasDevices ? "Development" : "Distribution (App Store)"
|
|
||||||
}
|
|
||||||
if hasDevices {
|
|
||||||
let getTaskAllow = (provisionPlist["Entitlements"] as? PlistDict)?["get-task-allow"] as? Bool ?? false
|
|
||||||
return getTaskAllow ? "Development" : "Distribution (Ad Hoc)"
|
|
||||||
}
|
|
||||||
let isEnterprise = provisionPlist["ProvisionsAllDevices"] as? Bool ?? false
|
|
||||||
return isEnterprise ? "Enterprise" : "Distribution (App Store)"
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Enumerate all entries from provison plist with key `ProvisionedDevices`
|
|
||||||
private func getDeviceList(_ provisionPlist: PlistDict) -> [TableRow] {
|
|
||||||
guard let devArr = provisionPlist["ProvisionedDevices"] as? [String] else {
|
|
||||||
return []
|
|
||||||
}
|
|
||||||
var currentPrefix: String? = nil
|
|
||||||
return devArr.sorted().map { device in
|
|
||||||
// compute the prefix for the first column of the table
|
|
||||||
let displayPrefix: String
|
|
||||||
let devicePrefix = String(device.prefix(1))
|
|
||||||
if currentPrefix != devicePrefix {
|
|
||||||
currentPrefix = devicePrefix
|
|
||||||
displayPrefix = "\(devicePrefix) ➞ "
|
|
||||||
} else {
|
|
||||||
displayPrefix = ""
|
|
||||||
}
|
|
||||||
return [displayPrefix, device]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Process info stored in `embedded.mobileprovision`
|
|
||||||
mutating func procProvision(_ provisionPlist: PlistDict?, isOSX: Bool) {
|
|
||||||
guard let provisionPlist else {
|
|
||||||
self.apply(["ProvisionHidden": "hiddenDiv"])
|
|
||||||
return
|
|
||||||
}
|
|
||||||
|
|
||||||
let creationDate = provisionPlist["CreationDate"] as? Date
|
|
||||||
let expireDate = provisionPlist["ExpirationDate"] as? Date
|
|
||||||
let devices = getDeviceList(provisionPlist)
|
|
||||||
let certs = getCertificateList(provisionPlist)
|
|
||||||
|
|
||||||
self.apply([
|
|
||||||
"ProvisionHidden": "",
|
|
||||||
"ProfileName": provisionPlist["Name"] as? String ?? "",
|
|
||||||
"ProfileUUID": provisionPlist["UUID"] as? String ?? "",
|
|
||||||
"TeamName": provisionPlist["TeamName"] as? String ?? "<em>Team name not available</em>",
|
|
||||||
"TeamIds": (provisionPlist["TeamIdentifier"] as? [String])?.joined(separator: ", ") ?? "<em>Team ID not available</em>",
|
|
||||||
"CreationDateFormatted": creationDate?.formattedCreationDate() ?? "",
|
|
||||||
"ExpirationDateFormatted": expireDate?.formattedExpirationDate() ?? "",
|
|
||||||
"ExpStatus": ExpirationStatus(expireDate).cssClass(),
|
|
||||||
|
|
||||||
"ProfilePlatform": isOSX ? "Mac" : "iOS",
|
|
||||||
"ProfileType": stringForProfileType(provisionPlist, isOSX: isOSX),
|
|
||||||
|
|
||||||
"ProvisionedDevicesCount": devices.isEmpty ? "No Devices" : "\(devices.count) Device\(devices.count == 1 ? "" : "s")",
|
|
||||||
"ProvisionedDevicesFormatted": devices.isEmpty ? "Distribution Profile" : formatAsTable(devices, header: ["", "UDID"]),
|
|
||||||
|
|
||||||
"DeveloperCertificatesFormatted": certs.isEmpty ? "No Developer Certificates" : formatAsTable(certs),
|
|
||||||
])
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
private typealias TableRow = [String]
|
|
||||||
|
|
||||||
/// Print html table with arbitrary number of columns
|
|
||||||
/// @param header If set, start the table with a `tr` column row.
|
|
||||||
private func formatAsTable(_ data: [[String]], header: TableRow? = nil) -> String {
|
|
||||||
var table = "<table>\n"
|
|
||||||
if let header = header {
|
|
||||||
table += "<tr><th>\(header.joined(separator: "</th><th>"))</th></tr>\n"
|
|
||||||
}
|
|
||||||
for row in data {
|
|
||||||
table += "<tr><td>\(row.joined(separator: "</td><td>"))</td></tr>\n"
|
|
||||||
}
|
|
||||||
return table + "</table>\n"
|
|
||||||
}
|
|
||||||
@@ -1,70 +0,0 @@
|
|||||||
import Foundation
|
|
||||||
|
|
||||||
extension MetaInfo {
|
|
||||||
/// Read `iTunesMetadata.plist` if available
|
|
||||||
func readPlistItunes() -> PlistDict? {
|
|
||||||
switch self.type {
|
|
||||||
case .IPA:
|
|
||||||
// not `readPayloadFile` because plist is in root dir
|
|
||||||
return self.zipFile!.unzipFile("iTunesMetadata.plist")?.asPlistOrNil()
|
|
||||||
case .Archive, .Extension:
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
extension HtmlGenerator {
|
|
||||||
/// Concatenate all (sub)genres into a comma separated list.
|
|
||||||
private func formattedGenres(_ itunesPlist: PlistDict) -> String {
|
|
||||||
var genres: [String] = []
|
|
||||||
let genreId = itunesPlist["genreId"] as? Int ?? 0
|
|
||||||
if let mainGenre = AppCategories[genreId] ?? itunesPlist["genre"] as? String {
|
|
||||||
genres.append(mainGenre)
|
|
||||||
}
|
|
||||||
|
|
||||||
for subgenre in itunesPlist["subgenres"] as? [PlistDict] ?? [] {
|
|
||||||
let subgenreId = subgenre["genreId"] as? Int ?? 0
|
|
||||||
if let subgenreStr = AppCategories[subgenreId] ?? subgenre["genre"] as? String {
|
|
||||||
genres.append(subgenreStr)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return genres.joined(separator: ", ")
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Process info stored in `iTunesMetadata.plist`
|
|
||||||
mutating func procItunesMeta(_ itunesPlist: PlistDict?) {
|
|
||||||
guard let itunesPlist else {
|
|
||||||
self.apply(["iTunesHidden": "hiddenDiv"])
|
|
||||||
return
|
|
||||||
}
|
|
||||||
|
|
||||||
let downloadInfo = itunesPlist["com.apple.iTunesStore.downloadInfo"] as? PlistDict
|
|
||||||
let accountInfo = downloadInfo?["accountInfo"] as? PlistDict ?? [:]
|
|
||||||
|
|
||||||
let purchaseDate = Date.parseAny(downloadInfo?["purchaseDate"] ?? itunesPlist["purchaseDate"])
|
|
||||||
let releaseDate = Date.parseAny(downloadInfo?["releaseDate"] ?? itunesPlist["releaseDate"])
|
|
||||||
// AppleId & purchaser name
|
|
||||||
let appleId = accountInfo["AppleID"] as? String ?? itunesPlist["appleId"] as? String ?? ""
|
|
||||||
let firstName = accountInfo["FirstName"] as? String ?? ""
|
|
||||||
let lastName = accountInfo["LastName"] as? String ?? ""
|
|
||||||
|
|
||||||
let name: String
|
|
||||||
if !firstName.isEmpty || !lastName.isEmpty {
|
|
||||||
name = "\(firstName) \(lastName) (\(appleId))"
|
|
||||||
} else {
|
|
||||||
name = appleId
|
|
||||||
}
|
|
||||||
self.apply([
|
|
||||||
"iTunesHidden": "",
|
|
||||||
"iTunesId": (itunesPlist["itemId"] as? Int)?.description ?? "", // description]
|
|
||||||
"iTunesName": itunesPlist["itemName"] as? String ?? "",
|
|
||||||
"iTunesGenres": formattedGenres(itunesPlist),
|
|
||||||
"iTunesReleaseDate": releaseDate?.mediumFormat() ?? "",
|
|
||||||
|
|
||||||
"iTunesAppleId": name,
|
|
||||||
"iTunesPurchaseDate": purchaseDate?.mediumFormat() ?? "",
|
|
||||||
"iTunesPrice": itunesPlist["priceDisplay"] as? String ?? "",
|
|
||||||
])
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,71 +0,0 @@
|
|||||||
import Foundation
|
|
||||||
|
|
||||||
struct HtmlGenerator {
|
|
||||||
var data: [String: String] = [:] // used for TAG replacements
|
|
||||||
let meta: MetaInfo
|
|
||||||
|
|
||||||
init(_ meta: MetaInfo) {
|
|
||||||
self.meta = meta
|
|
||||||
let plistApp = meta.readPlistApp()
|
|
||||||
let plistItunes = meta.readPlistItunes()
|
|
||||||
let plistProvision = meta.readPlistProvision()
|
|
||||||
|
|
||||||
data["AppInfoTitle"] = stringForFileType(meta)
|
|
||||||
|
|
||||||
procAppInfo(plistApp)
|
|
||||||
procItunesMeta(plistItunes)
|
|
||||||
procProvision(plistProvision, isOSX: meta.isOSX)
|
|
||||||
procEntitlements(meta, plistApp, plistProvision)
|
|
||||||
procFileInfo(meta.url)
|
|
||||||
procFooterInfo()
|
|
||||||
// App Icon (last, because the image uses a lot of memory)
|
|
||||||
data["AppIcon"] = AppIcon(meta).extractImage(from: plistApp).withRoundCorners().asBase64()
|
|
||||||
// insert CSS styles
|
|
||||||
let cssURL = Bundle.main.url(forResource: "style", withExtension: "css")!
|
|
||||||
data["CSS"] = try! String(contentsOf: cssURL, encoding: .utf8)
|
|
||||||
}
|
|
||||||
|
|
||||||
mutating func apply(_ values: [String: String]) {
|
|
||||||
data.merge(values) { (_, new) in new }
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Title of the preview window
|
|
||||||
private func stringForFileType(_ meta: MetaInfo) -> String {
|
|
||||||
switch meta.type {
|
|
||||||
case .IPA: return "App info"
|
|
||||||
case .Archive: return "Archive info"
|
|
||||||
case .Extension: return "App extension info"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// prepare html, replace values
|
|
||||||
func applyHtmlTemplate() -> String {
|
|
||||||
let templateURL = Bundle.main.url(forResource: "template", withExtension: "html")!
|
|
||||||
let html = try! String(contentsOf: templateURL, encoding: .utf8)
|
|
||||||
|
|
||||||
// this is less efficient
|
|
||||||
// for (key, value) in templateValues {
|
|
||||||
// html = html.replacingOccurrences(of: "__\(key)__", with: value)
|
|
||||||
// }
|
|
||||||
|
|
||||||
var rv = ""
|
|
||||||
var prevLoc = html.startIndex
|
|
||||||
let regex = try! NSRegularExpression(pattern: "__[^ _]{1,40}?__")
|
|
||||||
regex.enumerateMatches(in: html, range: NSRange(location: 0, length: html.count), using: { match, flags, stop in
|
|
||||||
let start = html.index(html.startIndex, offsetBy: match!.range.lowerBound)
|
|
||||||
let key = String(html[html.index(start, offsetBy: 2) ..< html.index(start, offsetBy: match!.range.length - 2)])
|
|
||||||
// append unrelated text up to this key
|
|
||||||
rv.append(contentsOf: html[prevLoc ..< start])
|
|
||||||
prevLoc = html.index(start, offsetBy: match!.range.length)
|
|
||||||
// append key if exists (else remove template-key)
|
|
||||||
if let value = data[key] {
|
|
||||||
rv.append(value)
|
|
||||||
} else {
|
|
||||||
// os_log(.debug, log: log, "unknown template key: %{public}@", key)
|
|
||||||
}
|
|
||||||
})
|
|
||||||
// append remaining text
|
|
||||||
rv.append(contentsOf: html[prevLoc ..< html.endIndex])
|
|
||||||
return rv
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,102 +0,0 @@
|
|||||||
import Foundation
|
|
||||||
import os // OSLog
|
|
||||||
|
|
||||||
private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "MetaInfo")
|
|
||||||
|
|
||||||
typealias PlistDict = [String: Any] // basically an untyped Dict
|
|
||||||
|
|
||||||
|
|
||||||
// Init QuickLook Type
|
|
||||||
enum FileType {
|
|
||||||
case IPA
|
|
||||||
case Archive
|
|
||||||
case Extension
|
|
||||||
}
|
|
||||||
|
|
||||||
struct MetaInfo {
|
|
||||||
let UTI: String
|
|
||||||
let url: URL
|
|
||||||
let effectiveUrl: URL? // if set, will point to the app inside of an archive
|
|
||||||
|
|
||||||
let type: FileType
|
|
||||||
let zipFile: ZipFile? // only set for zipped file types
|
|
||||||
let isOSX = false // relict of the past when ProvisionQL also processed provision profiles
|
|
||||||
|
|
||||||
/// Use file url and UTI type to generate an info object to pass around.
|
|
||||||
init(_ url: URL) {
|
|
||||||
self.url = url
|
|
||||||
self.UTI = try! url.resourceValues(forKeys: [.typeIdentifierKey]).typeIdentifier ?? "Unknown"
|
|
||||||
|
|
||||||
var effective: URL? = nil
|
|
||||||
var zipFile: ZipFile? = nil
|
|
||||||
|
|
||||||
switch self.UTI {
|
|
||||||
case "com.apple.itunes.ipa":
|
|
||||||
self.type = FileType.IPA;
|
|
||||||
zipFile = ZipFile(self.url.path);
|
|
||||||
case "com.apple.xcode.archive":
|
|
||||||
self.type = FileType.Archive;
|
|
||||||
effective = appPathForArchive(self.url);
|
|
||||||
case "com.apple.application-and-system-extension":
|
|
||||||
self.type = FileType.Extension;
|
|
||||||
default:
|
|
||||||
os_log(.error, log: log, "Unsupported file type: %{public}@", self.UTI)
|
|
||||||
fatalError()
|
|
||||||
}
|
|
||||||
self.zipFile = zipFile
|
|
||||||
self.effectiveUrl = effective
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Load a file from bundle into memory. Either by file path or via unzip.
|
|
||||||
func readPayloadFile(_ filename: String) -> Data? {
|
|
||||||
switch (self.type) {
|
|
||||||
case .IPA:
|
|
||||||
return zipFile!.unzipFile("Payload/*.app/".appending(filename))
|
|
||||||
case .Archive:
|
|
||||||
return try? Data(contentsOf: effectiveUrl!.appendingPathComponent(filename))
|
|
||||||
case .Extension:
|
|
||||||
return try? Data(contentsOf: url.appendingPathComponent(filename))
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Read app default `Info.plist`. (used for both, Preview and Thumbnail)
|
|
||||||
func readPlistApp() -> PlistDict? {
|
|
||||||
switch self.type {
|
|
||||||
case .IPA, .Archive, .Extension:
|
|
||||||
return self.readPayloadFile("Info.plist")?.asPlistOrNil()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// MARK: - Plist
|
|
||||||
|
|
||||||
extension Data {
|
|
||||||
/// Helper for optional chaining.
|
|
||||||
func asPlistOrNil() -> PlistDict? {
|
|
||||||
if self.isEmpty {
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
// var format: PropertyListSerialization.PropertyListFormat = .xml
|
|
||||||
do {
|
|
||||||
return try PropertyListSerialization.propertyList(from: self, format: nil) as? PlistDict
|
|
||||||
} catch {
|
|
||||||
os_log(.error, log: log, "ERROR reading plist %{public}@", error.localizedDescription)
|
|
||||||
return nil
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
// MARK: - Meta data for QuickLook
|
|
||||||
|
|
||||||
/// Search an archive for the .app or .ipa bundle.
|
|
||||||
private func appPathForArchive(_ url: URL) -> URL? {
|
|
||||||
let appsDir = url.appendingPathComponent("Products/Applications/")
|
|
||||||
if FileManager.default.fileExists(atPath: appsDir.path) {
|
|
||||||
if let x = try? FileManager.default.contentsOfDirectory(at: appsDir, includingPropertiesForKeys: nil), !x.isEmpty {
|
|
||||||
return x.first
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return nil;
|
|
||||||
}
|
|
||||||
55
src/Preview/Preview+AppInfo.swift
Normal file
55
src/Preview/Preview+AppInfo.swift
Normal file
@@ -0,0 +1,55 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
extension PreviewGenerator {
|
||||||
|
/// Process info stored in `Info.plist`
|
||||||
|
mutating func procAppInfoApple(_ appPlist: Plist_Info) {
|
||||||
|
self.apply([
|
||||||
|
"AppInfoHidden": CLASS_VISIBLE,
|
||||||
|
"AppName": appPlist.name ?? "",
|
||||||
|
"AppVersion": appPlist.version ?? "",
|
||||||
|
"AppBuildVer": appPlist.buildVersion ?? "",
|
||||||
|
"AppId": appPlist.bundleId ?? "",
|
||||||
|
|
||||||
|
"AppExtensionTypeHidden": appPlist.extensionType != nil ? CLASS_VISIBLE : CLASS_HIDDEN,
|
||||||
|
"AppExtensionType": appPlist.extensionType ?? "",
|
||||||
|
|
||||||
|
"AppDeviceFamily": appPlist.deviceFamily.joined(separator: ", "),
|
||||||
|
"AppSDK": appPlist.sdkVersion ?? "",
|
||||||
|
"AppMinOS": appPlist.minOS ?? "",
|
||||||
|
])
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Process info stored in `AndroidManifest.xml`
|
||||||
|
mutating func procAppInfoAndroid(_ manifest: Apk_Manifest) {
|
||||||
|
let featReq = manifest.featuresRequired
|
||||||
|
let featOpt = manifest.featuresOptional
|
||||||
|
let perms = manifest.permissions
|
||||||
|
|
||||||
|
func asList(_ list: [String]) -> String {
|
||||||
|
"<pre>\(list.joined(separator: "\n"))</pre>"
|
||||||
|
}
|
||||||
|
|
||||||
|
func resolveSDK(_ sdk: Int?) -> String {
|
||||||
|
sdk == nil ? "" : "\(sdk!) (Android \(AndroidSdkMap[sdk!] ?? "?"))"
|
||||||
|
}
|
||||||
|
self.apply([
|
||||||
|
"AppInfoHidden": CLASS_VISIBLE,
|
||||||
|
"AppName": manifest.appName ?? "",
|
||||||
|
"AppVersion": manifest.versionName ?? "",
|
||||||
|
"AppBuildVer": manifest.versionCode ?? "",
|
||||||
|
"AppId": manifest.packageId ?? "",
|
||||||
|
|
||||||
|
"ApkFeaturesRequiredHidden": featReq.isEmpty ? CLASS_HIDDEN : CLASS_VISIBLE,
|
||||||
|
"ApkFeaturesRequiredList": asList(featReq),
|
||||||
|
"ApkFeaturesOptionalHidden": featOpt.isEmpty ? CLASS_HIDDEN : CLASS_VISIBLE,
|
||||||
|
"ApkFeaturesOptionalList": asList(featOpt),
|
||||||
|
"ApkPermissionsHidden": perms.isEmpty ? CLASS_HIDDEN : CLASS_VISIBLE,
|
||||||
|
"ApkPermissionsList": asList(perms),
|
||||||
|
|
||||||
|
"AppDeviceFamily": "Android",
|
||||||
|
"AppSDK": resolveSDK(manifest.sdkVerTarget),
|
||||||
|
"AppMinOS": resolveSDK(manifest.sdkVerMin),
|
||||||
|
])
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
28
src/Preview/Preview+ArchiveInfo.swift
Normal file
28
src/Preview/Preview+ArchiveInfo.swift
Normal file
@@ -0,0 +1,28 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
extension MetaInfo {
|
||||||
|
/// Read `Info.plist` if type `.Archive`
|
||||||
|
func readPlistXCArchive() -> PlistDict? {
|
||||||
|
switch self.type {
|
||||||
|
case .Archive:
|
||||||
|
// not `readPayloadFile` because plist is in root dir
|
||||||
|
return try? Data(contentsOf: self.url.appendingPathComponent("Info.plist", isDirectory: false)).asPlistOrNil()
|
||||||
|
case .IPA, .Extension, .APK:
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
extension PreviewGenerator {
|
||||||
|
/// Process info of `.xcarchive` stored in root `Info.plist`
|
||||||
|
mutating func procArchiveInfo(_ archivePlist: PlistDict?) {
|
||||||
|
guard let archivePlist, let comment = archivePlist["Comment"] as? String else {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
self.apply([
|
||||||
|
"ArchiveHidden": CLASS_VISIBLE,
|
||||||
|
"ArchiveComment": comment,
|
||||||
|
])
|
||||||
|
}
|
||||||
|
}
|
||||||
39
src/Preview/Preview+Entitlements.swift
Normal file
39
src/Preview/Preview+Entitlements.swift
Normal file
@@ -0,0 +1,39 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
extension PreviewGenerator {
|
||||||
|
/// Search for app binary and run `codesign` on it.
|
||||||
|
private func readEntitlements(_ meta: MetaInfo, _ bundleExecutable: String?) -> Entitlements {
|
||||||
|
if let exe = bundleExecutable {
|
||||||
|
switch meta.type {
|
||||||
|
case .IPA:
|
||||||
|
if let tmpPath = try? meta.zipFile!.unzipFileToTempDir("Payload/*.app/\(exe)") {
|
||||||
|
defer {
|
||||||
|
try? FileManager.default.removeItem(atPath: tmpPath)
|
||||||
|
}
|
||||||
|
return Entitlements(forBinary: tmpPath + "/" + exe)
|
||||||
|
}
|
||||||
|
case .Archive, .Extension:
|
||||||
|
return Entitlements(forBinary: meta.effectiveUrl("MacOS", exe).path)
|
||||||
|
case .APK:
|
||||||
|
break // not applicable for Android
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return Entitlements.withoutBinary()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Process compiled binary and provision plist to extract `Entitlements`
|
||||||
|
mutating func procEntitlements(_ meta: MetaInfo, _ appPlist: Plist_Info?, _ provisionPlist: Plist_MobileProvision?) {
|
||||||
|
var entitlements = readEntitlements(meta, appPlist?.exePath)
|
||||||
|
entitlements.applyFallbackIfNeeded(provisionPlist?.entitlements)
|
||||||
|
|
||||||
|
if entitlements.html == nil && !entitlements.hasError {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
self.apply([
|
||||||
|
"EntitlementsHidden" : CLASS_VISIBLE,
|
||||||
|
"EntitlementsWarningHidden": entitlements.hasError ? CLASS_VISIBLE : CLASS_HIDDEN,
|
||||||
|
"EntitlementsDict": entitlements.html ?? "No Entitlements",
|
||||||
|
])
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,32 +1,12 @@
|
|||||||
import Foundation
|
import Foundation
|
||||||
|
|
||||||
extension HtmlGenerator {
|
extension PreviewGenerator {
|
||||||
/// Calculate file / folder size.
|
|
||||||
private func getFileSize(_ path: String) -> Int64 {
|
|
||||||
var isDir: ObjCBool = false
|
|
||||||
FileManager.default.fileExists(atPath: path, isDirectory: &isDir)
|
|
||||||
if !isDir.boolValue {
|
|
||||||
return try! FileManager.default.attributesOfItem(atPath: path)[.size] as! Int64
|
|
||||||
}
|
|
||||||
var fileSize: Int64 = 0
|
|
||||||
for child in try! FileManager.default.subpathsOfDirectory(atPath: path) {
|
|
||||||
fileSize += try! FileManager.default.attributesOfItem(atPath: path + "/" + child)[.size] as! Int64
|
|
||||||
}
|
|
||||||
return fileSize
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Process meta information about the file itself. Like file size and last modification.
|
/// Process meta information about the file itself. Like file size and last modification.
|
||||||
mutating func procFileInfo(_ url: URL) {
|
mutating func procFileInfo(_ url: URL) {
|
||||||
let formattedValue : String
|
|
||||||
if let attrs = try? FileManager.default.attributesOfItem(atPath: url.path) {
|
|
||||||
let size = ByteCountFormatter.string(fromByteCount: getFileSize(url.path), countStyle: .file)
|
|
||||||
formattedValue = "\(size), Modified \((attrs[.modificationDate] as! Date).mediumFormat())"
|
|
||||||
} else {
|
|
||||||
formattedValue = ""
|
|
||||||
}
|
|
||||||
self.apply([
|
self.apply([
|
||||||
"FileName": escapeXML(url.lastPathComponent),
|
"FileName": escapeXML(url.lastPathComponent),
|
||||||
"FileInfo": formattedValue,
|
"FileSize": url.fileSizeHuman(),
|
||||||
|
"FileModified": url.modificationDate()?.mediumFormat() ?? "",
|
||||||
])
|
])
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -41,3 +21,32 @@ private func escapeXML(_ stringToEscape: String) -> String {
|
|||||||
.replacingOccurrences(of: "<", with: "<")
|
.replacingOccurrences(of: "<", with: "<")
|
||||||
.replacingOccurrences(of: ">", with: ">")
|
.replacingOccurrences(of: ">", with: ">")
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
extension URL {
|
||||||
|
/// Last modification date of file (or folder)
|
||||||
|
@inlinable func modificationDate() -> Date? {
|
||||||
|
(try? FileManager.default.attributesOfItem(atPath: self.path))?[.modificationDate] as? Date
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Calls `fileSize()`. Will convert `Int` to human readable `String`.
|
||||||
|
func fileSizeHuman() -> String {
|
||||||
|
ByteCountFormatter.string(fromByteCount: self.fileSize(), countStyle: .file)
|
||||||
|
}
|
||||||
|
|
||||||
|
// MARK: - private methods
|
||||||
|
|
||||||
|
/// Calculate file or folder size.
|
||||||
|
private func fileSize() -> Int64 {
|
||||||
|
var isDir: ObjCBool = false
|
||||||
|
FileManager.default.fileExists(atPath: self.path, isDirectory: &isDir)
|
||||||
|
if !isDir.boolValue {
|
||||||
|
return try! FileManager.default.attributesOfItem(atPath: self.path)[.size] as! Int64
|
||||||
|
}
|
||||||
|
var fileSize: Int64 = 0
|
||||||
|
for child in try! FileManager.default.subpathsOfDirectory(atPath: self.path) {
|
||||||
|
fileSize += try! FileManager.default.attributesOfItem(atPath: self.path + "/" + child)[.size] as! Int64
|
||||||
|
}
|
||||||
|
return fileSize
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,14 +1,14 @@
|
|||||||
import Foundation
|
import Foundation
|
||||||
|
|
||||||
extension HtmlGenerator {
|
extension PreviewGenerator {
|
||||||
/// Process meta information about the plugin. Like version and debug flag.
|
/// Process meta information about the plugin. Like version and debug flag.
|
||||||
mutating func procFooterInfo() {
|
mutating func procFooterInfo() {
|
||||||
self.apply([
|
self.apply([
|
||||||
"SrcAppName": "QLAppBundle",
|
"SrcAppName": "QLAppBundle",
|
||||||
"SrcLinkUrl": "https://github.com/relikd/QLAppBundle",
|
"SrcLinkUrl": "https://github.com/relikd/QLAppBundle",
|
||||||
"SrcLinkName": "relikd/QLAppBundle",
|
"SrcLinkName": "relikd/QLAppBundle",
|
||||||
"BundleShortVersionString": Bundle.main.infoDictionary?["CFBundleShortVersionString"] as? String ?? "",
|
"SrcVersion": Bundle.main.infoDictionary?["CFBundleShortVersionString"] as? String ?? "",
|
||||||
"BundleVersion": Bundle.main.infoDictionary?["CFBundleVersion"] as? String ?? "",
|
"SrcBuildVer": Bundle.main.infoDictionary?["CFBundleVersion"] as? String ?? "",
|
||||||
])
|
])
|
||||||
#if DEBUG
|
#if DEBUG
|
||||||
self.data["SrcAppName"]! += " (debug)"
|
self.data["SrcAppName"]! += " (debug)"
|
||||||
68
src/Preview/Preview+Provisioning.swift
Normal file
68
src/Preview/Preview+Provisioning.swift
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
extension PreviewGenerator {
|
||||||
|
/// Process info stored in `embedded.mobileprovision`
|
||||||
|
mutating func procProvision(_ provisionPlist: Plist_MobileProvision?) {
|
||||||
|
guard let provisionPlist else {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
let deviceCount = provisionPlist.devices.count
|
||||||
|
self.apply([
|
||||||
|
"ProvisionHidden": CLASS_VISIBLE,
|
||||||
|
"ProvisionProfileName": provisionPlist.profileName ?? "",
|
||||||
|
"ProvisionProfileId": provisionPlist.profileId ?? "",
|
||||||
|
"ProvisionTeamName": provisionPlist.teamName ?? "<em>Team name not available</em>",
|
||||||
|
"ProvisionTeamIds": provisionPlist.teamIds.isEmpty ? "<em>Team ID not available</em>" : provisionPlist.teamIds.joined(separator: ", "),
|
||||||
|
"ProvisionCreateDate": provisionPlist.creationDate?.formattedCreationDate() ?? "",
|
||||||
|
"ProvisionExpireDate": provisionPlist.expireDate?.formattedExpirationDate() ?? "",
|
||||||
|
"ProvisionExpireStatus": ExpirationStatus(provisionPlist.expireDate).cssClass(),
|
||||||
|
|
||||||
|
"ProvisionProfilePlatform": provisionPlist.profilePlatform,
|
||||||
|
"ProvisionProfileType": provisionPlist.profileType,
|
||||||
|
|
||||||
|
"ProvisionDeviceCount": deviceCount == 0 ? "No Devices" : "\(deviceCount) Device\(deviceCount == 1 ? "" : "s")",
|
||||||
|
"ProvisionDeviceIds": deviceCount == 0 ? "Distribution Profile" : formatAsTable(groupDevices(provisionPlist.devices), header: ["", "UDID"]),
|
||||||
|
|
||||||
|
"ProvisionDevelopCertificates": provisionPlist.certificates.isEmpty ? "No Developer Certificates"
|
||||||
|
: formatAsTable(
|
||||||
|
provisionPlist.certificates
|
||||||
|
.sorted { $0.subject < $1.subject }
|
||||||
|
.map {TableRow([$0.subject, $0.expiration?.relativeExpirationDateString() ?? "<span class='warning'>No invalidity date in certificate</span>"])}
|
||||||
|
),
|
||||||
|
])
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Group device ids by first letter (`d -> device02`)
|
||||||
|
private func groupDevices(_ devices: [String]) -> [TableRow] {
|
||||||
|
var currentPrefix: String? = nil
|
||||||
|
return devices.sorted().map { device in
|
||||||
|
// compute the prefix for the first column of the table
|
||||||
|
let displayPrefix: String
|
||||||
|
let devicePrefix = String(device.prefix(1))
|
||||||
|
if currentPrefix != devicePrefix {
|
||||||
|
currentPrefix = devicePrefix
|
||||||
|
displayPrefix = "\(devicePrefix) ➞ "
|
||||||
|
} else {
|
||||||
|
displayPrefix = ""
|
||||||
|
}
|
||||||
|
return [displayPrefix, device]
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
private typealias TableRow = [String]
|
||||||
|
|
||||||
|
/// Print html table with arbitrary number of columns
|
||||||
|
/// @param header If set, start the table with a `tr` column row.
|
||||||
|
private func formatAsTable(_ data: [[String]], header: TableRow? = nil) -> String {
|
||||||
|
var table = "<table>\n"
|
||||||
|
if let header = header {
|
||||||
|
table += "<tr><th>\(header.joined(separator: "</th><th>"))</th></tr>\n"
|
||||||
|
}
|
||||||
|
for row in data {
|
||||||
|
table += "<tr><td>\(row.joined(separator: "</td><td>"))</td></tr>\n"
|
||||||
|
}
|
||||||
|
return table + "</table>\n"
|
||||||
|
}
|
||||||
56
src/Preview/Preview+TransportSecurity.swift
Normal file
56
src/Preview/Preview+TransportSecurity.swift
Normal file
@@ -0,0 +1,56 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
private let TransportSecurityLocalizedKeys = [
|
||||||
|
"NSAllowsArbitraryLoads": "Allows Arbitrary Loads",
|
||||||
|
"NSAllowsArbitraryLoadsForMedia": "Allows Arbitrary Loads for Media",
|
||||||
|
"NSAllowsArbitraryLoadsInWebContent": "Allows Arbitrary Loads in Web Content",
|
||||||
|
"NSAllowsLocalNetworking": "Allows Local Networking",
|
||||||
|
"NSExceptionDomains": "Exception Domains",
|
||||||
|
|
||||||
|
"NSIncludesSubdomains": "Includes Subdomains",
|
||||||
|
"NSRequiresCertificateTransparency": "Requires Certificate Transparency",
|
||||||
|
|
||||||
|
"NSExceptionAllowsInsecureHTTPLoads": "Allows Insecure HTTP Loads",
|
||||||
|
"NSExceptionMinimumTLSVersion": "Minimum TLS Version",
|
||||||
|
"NSExceptionRequiresForwardSecrecy": "Requires Forward Secrecy",
|
||||||
|
|
||||||
|
"NSThirdPartyExceptionAllowsInsecureHTTPLoads": "Allows Insecure HTTP Loads",
|
||||||
|
"NSThirdPartyExceptionMinimumTLSVersion": "Minimum TLS Version",
|
||||||
|
"NSThirdPartyExceptionRequiresForwardSecrecy": "Requires Forward Secrecy",
|
||||||
|
]
|
||||||
|
|
||||||
|
/// Print recursive tree of key-value mappings.
|
||||||
|
private func recursiveTransportSecurity(_ dictionary: PlistDict, _ level: Int = 0) -> String {
|
||||||
|
var output = ""
|
||||||
|
for (key, value) in dictionary {
|
||||||
|
let localizedKey = TransportSecurityLocalizedKeys[key] ?? key
|
||||||
|
for _ in 0..<level {
|
||||||
|
output += (level == 1) ? "- " : " "
|
||||||
|
}
|
||||||
|
|
||||||
|
if let subDict = value as? [String: Any] {
|
||||||
|
output += "\(localizedKey):<div class=\"list\">\n"
|
||||||
|
output += recursiveTransportSecurity(subDict, level + 1)
|
||||||
|
output += "</div>\n"
|
||||||
|
} else if let number = value as? NSNumber {
|
||||||
|
output += "\(localizedKey): \(number.boolValue ? "YES" : "NO")<br />"
|
||||||
|
} else {
|
||||||
|
output += "\(localizedKey): \(value)<br />"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return output
|
||||||
|
}
|
||||||
|
|
||||||
|
extension PreviewGenerator {
|
||||||
|
/// Process ATS info in `Info.plist`
|
||||||
|
mutating func procTransportSecurity(_ appPlist: Plist_Info?) {
|
||||||
|
guard let value = appPlist?.transportSecurity else {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
self.apply([
|
||||||
|
"TransportSecurityHidden": CLASS_VISIBLE,
|
||||||
|
"TransportSecurityDict": "<div class=\"list\">\(recursiveTransportSecurity(value))</div>",
|
||||||
|
])
|
||||||
|
}
|
||||||
|
}
|
||||||
21
src/Preview/Preview+iTunesPurchase.swift
Normal file
21
src/Preview/Preview+iTunesPurchase.swift
Normal file
@@ -0,0 +1,21 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
extension PreviewGenerator {
|
||||||
|
/// Process info stored in `iTunesMetadata.plist`
|
||||||
|
mutating func procItunesMeta(_ itunesPlist: Plist_iTunesMetadata?) {
|
||||||
|
guard let itunesPlist else {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
self.apply([
|
||||||
|
"iTunesHidden": CLASS_VISIBLE,
|
||||||
|
"iTunesId": itunesPlist.appId?.description ?? "",
|
||||||
|
"iTunesName": itunesPlist.appName ?? "",
|
||||||
|
"iTunesGenres": itunesPlist.genres.joined(separator: ", "),
|
||||||
|
"iTunesReleaseDate": itunesPlist.releaseDate?.mediumFormat() ?? "",
|
||||||
|
|
||||||
|
"iTunesAppleId": itunesPlist.purchaserName ?? "",
|
||||||
|
"iTunesPurchaseDate": itunesPlist.purchaseDate?.mediumFormat() ?? "",
|
||||||
|
"iTunesPrice": itunesPlist.price ?? "",
|
||||||
|
])
|
||||||
|
}
|
||||||
|
}
|
||||||
105
src/Preview/PreviewGenerator.swift
Normal file
105
src/Preview/PreviewGenerator.swift
Normal file
@@ -0,0 +1,105 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
let CLASS_HIDDEN = "hidden"
|
||||||
|
let CLASS_VISIBLE = ""
|
||||||
|
|
||||||
|
struct PreviewGenerator {
|
||||||
|
/// Used for TAG replacements
|
||||||
|
var data: [String: String] = [
|
||||||
|
// default: hide everything
|
||||||
|
"AppInfoHidden": CLASS_HIDDEN,
|
||||||
|
"AppExtensionTypeHidden": CLASS_HIDDEN,
|
||||||
|
"ArchiveHidden": CLASS_HIDDEN,
|
||||||
|
"iTunesHidden": CLASS_HIDDEN,
|
||||||
|
"TransportSecurityHidden": CLASS_HIDDEN,
|
||||||
|
"EntitlementsHidden": CLASS_HIDDEN,
|
||||||
|
"EntitlementsWarningHidden": CLASS_HIDDEN,
|
||||||
|
"ProvisionHidden": CLASS_HIDDEN,
|
||||||
|
"ApkFeaturesRequiredHidden": CLASS_HIDDEN,
|
||||||
|
"ApkFeaturesOptionalHidden": CLASS_HIDDEN,
|
||||||
|
"ApkPermissionsHidden": CLASS_HIDDEN,
|
||||||
|
]
|
||||||
|
let meta: MetaInfo
|
||||||
|
|
||||||
|
init(_ meta: MetaInfo) throws {
|
||||||
|
self.meta = meta
|
||||||
|
|
||||||
|
switch meta.type {
|
||||||
|
case .IPA, .Archive, .Extension:
|
||||||
|
guard let plistApp = meta.readPlist_Info() else {
|
||||||
|
throw RuntimeError("Info.plist not found")
|
||||||
|
}
|
||||||
|
procAppInfoApple(plistApp)
|
||||||
|
if meta.type == .IPA {
|
||||||
|
procItunesMeta(meta.readPlist_iTunesMetadata())
|
||||||
|
} else if meta.type == .Archive {
|
||||||
|
procArchiveInfo(meta.readPlistXCArchive())
|
||||||
|
}
|
||||||
|
procTransportSecurity(plistApp)
|
||||||
|
|
||||||
|
let plistProvision = meta.readPlist_MobileProvision()
|
||||||
|
procEntitlements(meta, plistApp, plistProvision)
|
||||||
|
procProvision(plistProvision)
|
||||||
|
// App Icon (last, because the image uses a lot of memory)
|
||||||
|
data["AppIcon"] = AppIcon(meta).extractImage(from: plistApp.icons).withRoundCorners().asBase64()
|
||||||
|
|
||||||
|
case .APK:
|
||||||
|
guard let manifest = meta.readApk_Manifest() else {
|
||||||
|
throw RuntimeError("AndroidManifest.xml not found")
|
||||||
|
}
|
||||||
|
procAppInfoAndroid(manifest)
|
||||||
|
// App Icon (last, because the image uses a lot of memory)
|
||||||
|
data["AppIcon"] = AppIcon(meta).extractImage(from: manifest.icon).withRoundCorners().asBase64()
|
||||||
|
}
|
||||||
|
|
||||||
|
data["QuickLookTitle"] = stringForFileType(meta)
|
||||||
|
procFileInfo(meta.url)
|
||||||
|
procFooterInfo()
|
||||||
|
}
|
||||||
|
|
||||||
|
mutating func apply(_ values: [String: String]) {
|
||||||
|
data.merge(values) { (_, new) in new }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Title of the preview window
|
||||||
|
private func stringForFileType(_ meta: MetaInfo) -> String {
|
||||||
|
switch meta.type {
|
||||||
|
case .IPA, .APK: return "App info"
|
||||||
|
case .Archive: return "Archive info"
|
||||||
|
case .Extension: return "App extension info"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// prepare html, replace values
|
||||||
|
func generate(template html: String, css: String) -> String {
|
||||||
|
let templateValues = data.merging(["CSS": css]) { (_, new) in new }
|
||||||
|
return html.regexReplace("\\{\\{([^ }]{1,40}?)\\}\\}") { templateValues[$0] }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
extension String {
|
||||||
|
/// Replace regex-pattern with custom replacement.
|
||||||
|
/// @param pattern must include a regex group. (e.g. "a(b)c")
|
||||||
|
func regexReplace(_ pattern: String, with fn: (_ match: String) -> String?) -> String {
|
||||||
|
var rv = ""
|
||||||
|
var prevLoc = self.startIndex
|
||||||
|
let regex = try! NSRegularExpression(pattern: pattern)
|
||||||
|
regex.enumerateMatches(in: self, range: NSRange(location: 0, length: self.count), using: { match, flags, stop in
|
||||||
|
let start = self.index(self.startIndex, offsetBy: match!.range.lowerBound)
|
||||||
|
// append unrelated text up to this key
|
||||||
|
rv.append(contentsOf: self[prevLoc ..< start])
|
||||||
|
prevLoc = self.index(start, offsetBy: match!.range.length)
|
||||||
|
// append key if exists (else remove template-key)
|
||||||
|
let key = String(self[Range(match!.range(at: 1), in: self)!])
|
||||||
|
if let value = fn(key) {
|
||||||
|
rv.append(value)
|
||||||
|
} else {
|
||||||
|
// do not append anything -> removes all template keys from template
|
||||||
|
// os_log(.debug, log: log, "unknown template key: %{public}@", key)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
// append remaining text
|
||||||
|
rv.append(contentsOf: self[prevLoc ..< self.endIndex])
|
||||||
|
return rv
|
||||||
|
}
|
||||||
|
}
|
||||||
14
src/Preview/RuntimeError.swift
Normal file
14
src/Preview/RuntimeError.swift
Normal file
@@ -0,0 +1,14 @@
|
|||||||
|
import Foundation
|
||||||
|
|
||||||
|
// used to quit QuickLook generation without returning a valid preview
|
||||||
|
struct RuntimeError: LocalizedError {
|
||||||
|
let description: String
|
||||||
|
|
||||||
|
init(_ description: String) {
|
||||||
|
self.description = description
|
||||||
|
}
|
||||||
|
|
||||||
|
var errorDescription: String? {
|
||||||
|
description
|
||||||
|
}
|
||||||
|
}
|
||||||
Reference in New Issue
Block a user