fix: html modify instructions in readme

chore: bump version
fix: .appex for macOS extensions
2025-12-04 19:20:56 +01:00 · 2025-12-01 01:41:20 +01:00 · 2025-12-01 01:14:53 +01:00 · 2025-12-01 01:07:52 +01:00 · 2025-12-01 01:03:02 +01:00 · 2025-12-01 00:45:09 +01:00
63 changed files with 2197 additions and 949 deletions
--- a/App/App.entitlements
+++ b/App/App.entitlements
@@ -1,10 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
-<plist version="1.0">
-<dict>
-	<key>com.apple.security.app-sandbox</key>
-	<true/>
-	<key>com.apple.security.files.user-selected.read-only</key>
-	<true/>
-</dict>
-</plist>
--- a/App/Info.plist
+++ b/App/Info.plist
@@ -4,5 +4,49 @@
 <dict>
 	<key>CFBundleIconFile</key>
 	<string>AppIcon</string>
+	<key>UTImportedTypeDeclarations</key>
+	<array>
+		<dict>
+			<key>UTTypeConformsTo</key>
+			<array>
+				<string>public.data</string>
+			</array>
+			<key>UTTypeIdentifier</key>
+			<string>com.opa334.trollstore.tipa</string>
+			<key>UTTypeDescription</key>
+			<string>AirDrop friendly iOS app</string>
+			<key>UTTypeTagSpecification</key>
+			<dict>
+				<key>public.mime-type</key>
+				<array>
+					<string>application/trollstore-ipa</string>
+				</array>
+				<key>public.filename-extension</key>
+				<array>
+					<string>tipa</string>
+				</array>
+			</dict>
+		</dict>
+		<dict>
+			<key>UTTypeConformsTo</key>
+			<array>
+				<string>public.data</string>
+			</array>
+			<key>UTTypeIdentifier</key>
+			<string>com.google.android.apk</string>
+			<key>UTTypeTagSpecification</key>
+			<dict>
+				<key>public.mime-type</key>
+				<array>
+					<string>application/vnd.android.package-archive</string>
+				</array>
+				<key>public.filename-extension</key>
+				<array>
+					<string>apk</string>
+					<string>apkm</string>
+				</array>
+			</dict>
+		</dict>
+	</array>
 </dict>
 </plist>
--- a/AssetCarReader/AssetCarReader.swift
+++ b/AssetCarReader/AssetCarReader.swift
@@ -1,61 +1,55 @@
 import Foundation
 import AppKit // NSImage
-import CoreUI // CUICatalog
-import os // OSLog
+private import CoreUI // CUICatalog
+private import os // OSLog

-private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "AppIcon+Car")
+private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "AssetCarReader")

-// this has been written from scratch but general usage on
-// including the private framework has been taken from:
-// https://github.com/showxu/cartools
-// also see:
-// https://blog.timac.org/2018/1018-reverse-engineering-the-car-file-format/
-
-extension AppIcon {
-	/// Use `CUICatalog` to extract an image from `Assets.car`
-	func imageFromAssetsCar(_ imageName: String) -> NSImage? {
-		guard let data = meta.readPayloadFile("Assets.car") else {
-			return nil
-		}
-		let catalog: CUICatalog
+public class CarReader {
+	private let catalog: CUICatalog
+	
+	public init?(_ data: Data) {
 		do {
 			catalog = try data.withUnsafeBytes { try CUICatalog(bytes: $0.baseAddress!, length: UInt64(data.count)) }
 		} catch {
-			os_log(.error, log: log, "[icon-car] ERROR: could not open catalog: %{public}@", error.localizedDescription)
+			os_log(.error, log: log, "[asset-car] ERROR: could not open catalog: %{public}@", error.localizedDescription)
 			return nil
 		}
-		
-		if let validName = carVerifyNameExists(imageName, in: catalog) {
-			if let bestImage = carFindHighestResolutionIcon(catalog.images(withName: validName)) {
-				os_log(.debug, log: log, "[icon-car] using Assets.car with key %{public}@", validName)
+	}
+	
+	/// Use `CUICatalog` to extract an image from `Assets.car`
+	public func imageFromAssetsCar(_ imageName: String) -> NSImage? {
+		if let validName = verifyNameExists(imageName, in: catalog) {
+			if let bestImage = findHighestResolutionIcon(catalog.images(withName: validName)) {
+				os_log(.debug, log: log, "[asset-car] using Assets.car with key %{public}@", validName)
 				return NSImage(cgImage: bestImage.image, size: bestImage.size)
 			}
 		}
-		return nil;
+		return nil
 	}
 	
 	
-	// MARK: - Helper: Assets.car
+	// MARK: - Private methods
 	
 	/// Helper method to check available icon names. Will return a valid name or `nil` if no image with that key is found.
-	func carVerifyNameExists(_ imageName: String, in catalog: CUICatalog) -> String? {
+	private func verifyNameExists(_ imageName: String, in catalog: CUICatalog) -> String? {
 		if let availableNames = catalog.allImageNames(), !availableNames.contains(imageName) {
 			// Theoretically this should never happen. Assuming the image name is found in an image file.
-			os_log(.info, log: log, "[icon-car] WARN: key '%{public}@' does not match any available key", imageName)
+			os_log(.info, log: log, "[asset-car] WARN: key '%{public}@' does not match any available key", imageName)
 			
-			if let alternativeName = carSearchAlternativeName(imageName, inAvailable: availableNames) {
-				os_log(.info, log: log, "[icon-car] falling back to '%{public}@'", alternativeName)
+			if let alternativeName = searchAlternativeName(imageName, inAvailable: availableNames) {
+				os_log(.info, log: log, "[asset-car] falling back to '%{public}@'", alternativeName)
 				return alternativeName
 			}
-			os_log(.debug, log: log, "[icon-car] available keys: %{public}@", catalog.allImageNames() ?? [])
+			os_log(.debug, log: log, "[asset-car] available keys: %{public}@", catalog.allImageNames() ?? [])
 			return nil
 		}
-		return imageName;
+		return imageName
 	}
 	
 	/// If exact name does not exist in catalog, search for a name that shares the same prefix.
 	/// E.g., "AppIcon60x60" may match "AppIcon" or "AppIcon60x60_small"
-	func carSearchAlternativeName(_ originalName: String, inAvailable availableNames: [String]) -> String? {
+	private func searchAlternativeName(_ originalName: String, inAvailable availableNames: [String]) -> String? {
 		var bestOption: String? = nil
 		var bestDiff: Int = 999
 		
@@ -72,7 +66,7 @@ extension AppIcon {
 	}
 	
 	/// Given a list of `CUINamedImage`, return the one with the highest resolution. Vector graphics are ignored.
-	func carFindHighestResolutionIcon(_ availableImages: [CUINamedImage]) -> CUINamedImage? {
+	private func findHighestResolutionIcon(_ availableImages: [CUINamedImage]) -> CUINamedImage? {
 		var largestWidth: CGFloat = 0
 		var largestImage: CUINamedImage? = nil
 		// cast to NSArray is necessary as otherwise this will crash
--- a/AssetCarReader/AssetCarReader.xcconfig
+++ b/AssetCarReader/AssetCarReader.xcconfig
@@ -0,0 +1,9 @@
+// Configuration settings file format documentation can be found at:
+// https://help.apple.com/xcode/#/dev745c5c974
+
+FRAMEWORK_SEARCH_PATHS = $(PROJECT_DIR)/AssetCarReader/PrivateFrameworks
+SYSTEM_FRAMEWORK_SEARCH_PATHS = $(SYSTEM_LIBRARY_DIR)/PrivateFrameworks
+SWIFT_INCLUDE_PATHS = $(SRCROOT)/AssetCarReader/PrivateFrameworks/CoreUI.framework
+
+DYLIB_COMPATIBILITY_VERSION = 1
+DYLIB_CURRENT_VERSION = 42
--- a/AssetCarReader/PrivateFrameworks/CoreUI.framework/Headers
+++ b/AssetCarReader/PrivateFrameworks/CoreUI.framework/Headers
--- a/AssetCarReader/PrivateFrameworks/CoreUI.framework/Versions/A/Headers/CUICatalog.h
+++ b/AssetCarReader/PrivateFrameworks/CoreUI.framework/Versions/A/Headers/CUICatalog.h
--- a/AssetCarReader/PrivateFrameworks/CoreUI.framework/Versions/A/Headers/CUINamedImage.h
+++ b/AssetCarReader/PrivateFrameworks/CoreUI.framework/Versions/A/Headers/CUINamedImage.h
--- a/AssetCarReader/PrivateFrameworks/CoreUI.framework/Versions/A/Headers/CUINamedLookup.h
+++ b/AssetCarReader/PrivateFrameworks/CoreUI.framework/Versions/A/Headers/CUINamedLookup.h
--- a/AssetCarReader/PrivateFrameworks/CoreUI.framework/Versions/Current
+++ b/AssetCarReader/PrivateFrameworks/CoreUI.framework/Versions/Current
--- a/AssetCarReader/PrivateFrameworks/CoreUI.framework/module.modulemap
+++ b/AssetCarReader/PrivateFrameworks/CoreUI.framework/module.modulemap
--- a/CHANGELOG.md
+++ b/CHANGELOG.md
@@ -0,0 +1,60 @@
+# Changelog
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
+and this project does adhere to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+
+## [1.5.0] – 2025-12-01
+Fixed:
+- `.appex` macOS extensions (`Info.plist` was not found)
+- Removed `.appex` from `ThumbnailProvider` (extension probably dont have icons anyway)
+
+Changed:
+- Template uses `{{X}}` instead of `__X__`
+
+
+## [1.4.0] – 2025-11-29
+Added:
+- Support for `.apk` files
+- Support for `.apkm` files
+
+
+## [1.3.0] – 2025-11-06
+Added:
+- Show macOS apps in `.xcarchive`
+- Show `.xcarchive` developer notes
+
+Fixed:
+- Cancel preview (and allow other plugins to run) if there is no `Info.plist` in `.xcarchive`
+
+Changed:
+- Hide Transport Security and Entitlements if they are empty
+
+
+## [1.2.0] – 2025-11-04
+Added:
+- Customizable HTML template
+
+Fixed:
+- Properly handle `Assets.car` files by abstracting relevant code into `.framework`
+
+Changed:
+- Updated HTML template
+
+
+## [1.1.0] – 2025-10-30
+Added:
+- Support for `.tipa` files
+
+
+## [1.0.0] – 2025-10-30
+Initial release
+
+
+[1.5.0]: https://github.com/relikd/QLAppBundle/compare/v1.4.0...v1.5.0
+[1.4.0]: https://github.com/relikd/QLAppBundle/compare/v1.3.0...v1.4.0
+[1.3.0]: https://github.com/relikd/QLAppBundle/compare/v1.2.0...v1.3.0
+[1.2.0]: https://github.com/relikd/QLAppBundle/compare/v1.1.0...v1.2.0
+[1.1.0]: https://github.com/relikd/QLAppBundle/compare/v1.0.0...v1.1.0
+[1.0.0]: https://github.com/relikd/QLAppBundle/compare/9b0761318c85090d1ef22f12d3eab67a9a194882...v1.0.0
--- a/Config-debug.xcconfig
+++ b/Config-debug.xcconfig
@@ -0,0 +1,6 @@
+// Configuration settings file format documentation can be found at:
+// https://help.apple.com/xcode/#/dev745c5c974
+
+#include "Config.xcconfig"
+
+PRODUCT_BUNDLE_IDENTIFIER = de.relikd.QLAppBundle.debug
--- a/Config.xcconfig
+++ b/Config.xcconfig
@@ -0,0 +1,14 @@
+// Configuration settings file format documentation can be found at:
+// https://help.apple.com/xcode/#/dev745c5c974
+
+CODE_SIGN_STYLE = Manual
+CODE_SIGN_IDENTITY = Apple Development
+ENABLE_HARDENED_RUNTIME = YES
+
+SWIFT_VERSION = 5.0
+
+MACOSX_DEPLOYMENT_TARGET = 10.15
+MARKETING_VERSION = 1.5.0
+PRODUCT_NAME = QLAppBundle
+PRODUCT_BUNDLE_IDENTIFIER = de.relikd.QLAppBundle
+CURRENT_PROJECT_VERSION = 2018
--- a/QLAppBundle.xcodeproj/project.pbxproj
+++ b/QLAppBundle.xcodeproj/project.pbxproj
--- a/QLAppBundle.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved
+++ b/QLAppBundle.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved
@@ -0,0 +1,15 @@
+{
+  "originHash" : "c869761611793a3eebb4e2f56e7aebab4faa8db4159e6116b059292c98af7094",
+  "pins" : [
+    {
+      "identity" : "androidxml",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/relikd/AndroidXML",
+      "state" : {
+        "revision" : "d9fe646bcc3b05548aebbd20b4eee0af675c129f",
+        "version" : "0.9.4"
+      }
+    }
+  ],
+  "version" : 3
+}
--- a/QLAppBundle.xcodeproj/xcshareddata/xcschemes/QLPreview.xcscheme
+++ b/QLAppBundle.xcodeproj/xcshareddata/xcschemes/QLPreview.xcscheme
@@ -1,6 +1,6 @@
 <?xml version="1.0" encoding="UTF-8"?>
 <Scheme
-   LastUpgradeVersion = "1640"
+   LastUpgradeVersion = "2600"
   wasCreatedForAppExtension = "YES"
   version = "2.0">
   <BuildAction
@@ -17,8 +17,8 @@
            <BuildableReference
               BuildableIdentifier = "primary"
               BlueprintIdentifier = "54442C1F2E378BAF008A870E"
-               BuildableName = "QLPreview.appex"
-               BlueprintName = "QLPreview"
+               BuildableName = "QLAppBundle Preview Extension.appex"
+               BlueprintName = "QL Preview"
               ReferencedContainer = "container:QLAppBundle.xcodeproj">
            </BuildableReference>
         </BuildActionEntry>
@@ -32,7 +32,7 @@
               BuildableIdentifier = "primary"
               BlueprintIdentifier = "54442BF32E378B71008A870E"
               BuildableName = "QLAppBundle.app"
-               BlueprintName = "QLAppBundle"
+               BlueprintName = "App"
               ReferencedContainer = "container:QLAppBundle.xcodeproj">
            </BuildableReference>
         </BuildActionEntry>
@@ -63,7 +63,7 @@
            BuildableIdentifier = "primary"
            BlueprintIdentifier = "54442BF32E378B71008A870E"
            BuildableName = "QLAppBundle.app"
-            BlueprintName = "QLAppBundle"
+            BlueprintName = "App"
            ReferencedContainer = "container:QLAppBundle.xcodeproj">
         </BuildableReference>
      </BuildableProductRunnable>
@@ -82,7 +82,7 @@
            BuildableIdentifier = "primary"
            BlueprintIdentifier = "54442BF32E378B71008A870E"
            BuildableName = "QLAppBundle.app"
-            BlueprintName = "QLAppBundle"
+            BlueprintName = "App"
            ReferencedContainer = "container:QLAppBundle.xcodeproj">
         </BuildableReference>
      </BuildableProductRunnable>
--- a/QLAppBundle.xcodeproj/xcshareddata/xcschemes/QL
+++ b/QLAppBundle.xcodeproj/xcshareddata/xcschemes/QL
@@ -0,0 +1,97 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Scheme
+   LastUpgradeVersion = "2600"
+   wasCreatedForAppExtension = "YES"
+   version = "2.0">
+   <BuildAction
+      parallelizeBuildables = "YES"
+      buildImplicitDependencies = "YES"
+      buildArchitectures = "Automatic">
+      <BuildActionEntries>
+         <BuildActionEntry
+            buildForTesting = "YES"
+            buildForRunning = "YES"
+            buildForProfiling = "YES"
+            buildForArchiving = "YES"
+            buildForAnalyzing = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "54581FCE2EB29A0B0043A0B3"
+               BuildableName = "QLAppBundle Thumbnail Extension.appex"
+               BlueprintName = "QL Thumbnail"
+               ReferencedContainer = "container:QLAppBundle.xcodeproj">
+            </BuildableReference>
+         </BuildActionEntry>
+         <BuildActionEntry
+            buildForTesting = "YES"
+            buildForRunning = "YES"
+            buildForProfiling = "YES"
+            buildForArchiving = "YES"
+            buildForAnalyzing = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "54442BF32E378B71008A870E"
+               BuildableName = "QLAppBundle.app"
+               BlueprintName = "App"
+               ReferencedContainer = "container:QLAppBundle.xcodeproj">
+            </BuildableReference>
+         </BuildActionEntry>
+      </BuildActionEntries>
+   </BuildAction>
+   <TestAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      shouldUseLaunchSchemeArgsEnv = "YES"
+      shouldAutocreateTestPlan = "YES">
+   </TestAction>
+   <LaunchAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = ""
+      selectedLauncherIdentifier = "Xcode.IDEFoundation.Launcher.PosixSpawn"
+      launchStyle = "0"
+      askForAppToLaunch = "Yes"
+      useCustomWorkingDirectory = "NO"
+      ignoresPersistentStateOnLaunch = "NO"
+      debugDocumentVersioning = "YES"
+      debugServiceExtension = "internal"
+      allowLocationSimulation = "YES"
+      launchAutomaticallySubstyle = "2">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "54442BF32E378B71008A870E"
+            BuildableName = "QLAppBundle.app"
+            BlueprintName = "App"
+            ReferencedContainer = "container:QLAppBundle.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </LaunchAction>
+   <ProfileAction
+      buildConfiguration = "Release"
+      shouldUseLaunchSchemeArgsEnv = "YES"
+      savedToolIdentifier = ""
+      useCustomWorkingDirectory = "NO"
+      debugDocumentVersioning = "YES"
+      askForAppToLaunch = "Yes"
+      launchAutomaticallySubstyle = "2">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "54442BF32E378B71008A870E"
+            BuildableName = "QLAppBundle.app"
+            BlueprintName = "App"
+            ReferencedContainer = "container:QLAppBundle.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </ProfileAction>
+   <AnalyzeAction
+      buildConfiguration = "Debug">
+   </AnalyzeAction>
+   <ArchiveAction
+      buildConfiguration = "Release"
+      revealArchiveInOrganizer = "YES">
+   </ArchiveAction>
+</Scheme>
--- a/QLAppBundle.xcodeproj/xcshareddata/xcschemes/QLAppBundle.xcscheme
+++ b/QLAppBundle.xcodeproj/xcshareddata/xcschemes/QLAppBundle.xcscheme
@@ -1,6 +1,6 @@
 <?xml version="1.0" encoding="UTF-8"?>
 <Scheme
-   LastUpgradeVersion = "1640"
+   LastUpgradeVersion = "2600"
   version = "1.7">
   <BuildAction
      parallelizeBuildables = "YES"
@@ -17,7 +17,7 @@
               BuildableIdentifier = "primary"
               BlueprintIdentifier = "54442BF32E378B71008A870E"
               BuildableName = "QLAppBundle.app"
-               BlueprintName = "QLAppBundle"
+               BlueprintName = "App"
               ReferencedContainer = "container:QLAppBundle.xcodeproj">
            </BuildableReference>
         </BuildActionEntry>
@@ -46,7 +46,7 @@
            BuildableIdentifier = "primary"
            BlueprintIdentifier = "54442BF32E378B71008A870E"
            BuildableName = "QLAppBundle.app"
-            BlueprintName = "QLAppBundle"
+            BlueprintName = "App"
            ReferencedContainer = "container:QLAppBundle.xcodeproj">
         </BuildableReference>
      </BuildableProductRunnable>
@@ -63,7 +63,7 @@
            BuildableIdentifier = "primary"
            BlueprintIdentifier = "54442BF32E378B71008A870E"
            BuildableName = "QLAppBundle.app"
-            BlueprintName = "QLAppBundle"
+            BlueprintName = "App"
            ReferencedContainer = "container:QLAppBundle.xcodeproj">
         </BuildableReference>
      </BuildableProductRunnable>
--- a/QLPreview/Info.plist
+++ b/QLPreview/Info.plist
@@ -13,6 +13,12 @@
 				<string>com.apple.itunes.ipa</string>
 				<string>com.apple.application-and-system-extension</string>
 				<string>com.apple.xcode.archive</string>
+				<string>com.opa334.trollstore.tipa</string>
+				<string>dyn.ah62d4rv4ge81k4puqe</string>
+				<string>com.google.android.apk</string>
+				<string>dyn.ah62d4rv4ge80c6dp</string>
+				<string>public.archive.apk</string>
+				<string>dyn.ah62d4rv4ge80c6dpry</string>
 			</array>
 			<key>QLSupportsSearchableItems</key>
 			<false/>
--- a/QLPreview/PreviewViewController.swift
+++ b/QLPreview/PreviewViewController.swift
@@ -3,7 +3,6 @@ import Quartz // QLPreviewingController
 import WebKit // WebView
 import os // OSLog

-// show Console logs with subsystem:de.relikd.QLApps
 private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "preview-plugin")

 class PreviewViewController: NSViewController, QLPreviewingController {
@@ -12,9 +11,24 @@ class PreviewViewController: NSViewController, QLPreviewingController {
 		return NSNib.Name("PreviewViewController")
 	}
 	
+	/// Load resource file either from user documents dir (if exists) or app bundle (default).
+	func bundleFile(filename: String, ext: String) throws -> String {
+		if let userFile = URL.UserModDir?.appendingPathComponent(filename + "." + ext, isDirectory: false), userFile.exists() {
+			return try String(contentsOf: userFile, encoding: .utf8)
+		// else: do NOT copy! Breaks on future updates
+		}
+		// else, load bundle file
+		let path = Bundle.main.url(forResource: filename, withExtension: ext)
+		return try String(contentsOf: path!, encoding: .utf8)
+	}
+	
 	func preparePreviewOfFile(at url: URL) async throws {
 		let meta = MetaInfo(url)
-		let html = HtmlGenerator(meta).applyHtmlTemplate()
+		// throws an exception if appPlist not found. Thus allowing another QuickLook plugin to try
+		let html = try PreviewGenerator(meta).generate(
+			template: try bundleFile(filename: "template", ext: "html"),
+			css: try bundleFile(filename: "style", ext: "css"),
+		)
 		// sure, we could use `WKWebView`, but that requires the `com.apple.security.network.client` entitlement
 		//let web = WKWebView(frame: self.view.bounds)
 		let web = WebView(frame: self.view.bounds)
--- a/QLPreview/QLPreview.entitlements
+++ b/QLPreview/QLPreview.entitlements
@@ -1,10 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
-<plist version="1.0">
-<dict>
-	<key>com.apple.security.app-sandbox</key>
-	<true/>
-	<key>com.apple.security.files.user-selected.read-only</key>
-	<true/>
-</dict>
-</plist>
--- a/QLThumbnail/Info.plist
+++ b/QLThumbnail/Info.plist
@@ -9,8 +9,13 @@
 			<key>QLSupportedContentTypes</key>
 			<array>
 				<string>com.apple.itunes.ipa</string>
-				<string>com.apple.application-and-system-extension</string>
 				<string>com.apple.xcode.archive</string>
+				<string>com.opa334.trollstore.tipa</string>
+				<string>dyn.ah62d4rv4ge81k4puqe</string>
+				<string>com.google.android.apk</string>
+				<string>dyn.ah62d4rv4ge80c6dp</string>
+				<string>public.archive.apk</string>
+				<string>dyn.ah62d4rv4ge80c6dpry</string>
 			</array>
 			<key>QLThumbnailMinimumDimension</key>
 			<integer>16</integer>
--- a/QLThumbnail/QLThumbnail.entitlements
+++ b/QLThumbnail/QLThumbnail.entitlements
@@ -1,10 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
-<plist version="1.0">
-<dict>
-    <key>com.apple.security.app-sandbox</key>
-    <true/>
-    <key>com.apple.security.files.user-selected.read-only</key>
-    <true/>
-</dict>
-</plist>
--- a/QLThumbnail/ThumbnailProvider.swift
+++ b/QLThumbnail/ThumbnailProvider.swift
@@ -1,7 +1,6 @@
 import QuickLookThumbnailing
 import os // OSLog

-// show Console logs with subsystem:de.relikd.QLApps
 private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "thumbnail-plugin")

 extension QLThumbnailReply {
@@ -17,13 +16,9 @@ extension QLThumbnailReply {
 }

 class ThumbnailProvider: QLThumbnailProvider {
-	
-	// TODO: sadly, this does not seem to work for .xarchive and .appex
-	// Probably overwritten by Apple somehow
-	
 	override func provideThumbnail(for request: QLFileThumbnailRequest, _ handler: @escaping (QLThumbnailReply?, Error?) -> Void) {
 		let meta = MetaInfo(request.fileURL)
-		let img = AppIcon(meta).extractImage(from: meta.readPlistApp()).withRoundCorners()
+		let img = AppIcon(meta).extractImageForThumbnail().withRoundCorners()
 		
 		// First way: Draw the thumbnail into the current context, set up with UIKit's coordinate system.
 		let reply = QLThumbnailReply(contextSize: request.maximumSize, currentContextDrawing: { () -> Bool in
@@ -39,3 +34,4 @@ class ThumbnailProvider: QLThumbnailProvider {
 		reply.setFlavor(meta.type == .Archive ? 12 : 0) // .archive looks like "in development"
 	}
 }
+
--- a/README.md
+++ b/README.md
@@ -6,9 +6,10 @@
 QLAppBundle
 ===========

-A QuickLook plugin for app bundles (`.ipa`, `.appex`, `.xcarchive`).
+A QuickLook plugin for app bundles (`.ipa`, `.tipa`, `.appex`, `.xcarchive`, `.apk`, `.apkm`).

-![screenshot](screenshot.png)
+![QuickLook for IPA file](screenshot.png)
+![QuickLook for APK file](screenshot2.png)


 ## Why?
@@ -24,31 +25,31 @@ I merely want things to be done.
 Also, I've removed support for provisioning profiles (`.mobileprovision`, `.provisionprofile`) to focus on app bundles.


-## ToDO

- [ ] support for `.apk` files
+## ToDo
+
+- [x] support for `.apk` files
+
+
+
+## Features
+
+### Customize HTML / CSS
+
+1. Right click on the app and select "Show Package Contents"
+2. Go to `PlugIns` and repeat "Show Package Contents" on the Preview extension.
+3. Copy `Contents/Resources/template.html` (or `style.css`)
+4. Open `~/Library/Containers/de.relikd.QLAppBundle.Preview/Data/Documents/`
+5. Paste the previous file and modify it to your liking
+6. `QLAppBundle` will use the new file from now on
+


 ## Development notes

-If you encounter compile errors like:
+### Debug

-```
-Command SwiftEmitModule failed with a nonzero exit code
-```
-
-or
-
-```
-Could not build Objective-C module 'ExtensionFoundation'
-```
-
-remove the `SYSTEM_FRAMEWORK_SEARCH_PATHS` attribute from Project > Build Settings then try to compile again (it will fail).
-Afterwards, restore the value in the attribute.
-Now, the build index should be up-to-date and the app should compile fine.
-
-I havent figured out the exact issue, consider it a workaround.
-It should only be necessary once (or if you delete your `DerivedData` folder).
+You can show Console logs with `subsystem:de.relikd.QLAppBundle`


 [1]: https://github.com/ealeksandrov/ProvisionQL
--- a/resources/style.css
+++ b/resources/style.css
@@ -6,7 +6,7 @@ body {
 	line-height: 1.3;
 }

-.hiddenDiv {
+.hidden, .not- {
 	display: none;
 }

--- a/resources/template.html
+++ b/resources/template.html
@@ -2,82 +2,100 @@
 <html lang="en">
 <head>
 	<meta charset="UTF-8">
-	<style>__CSS__</style>
+	<style>{{CSS}}</style>
 </head>
 <body>
-	<div class="app __AppInfoHidden__">
-		<h1>__AppInfoTitle__</h1>
-		<div class="floatLeft icon"><img alt="App icon" src="data:image/png;base64,__AppIcon__"/></div>
+	<h1>{{QuickLookTitle}}</h1>
+	
+	<div class="app {{AppInfoHidden}}">
+		<div class="floatLeft icon"><img alt="App icon" src="data:image/png;base64,{{AppIcon}}"/></div>
 		<div class="floatLeft info">
-			Name: <strong>__CFBundleName__</strong><br />
-			Version: __CFBundleShortVersionString__ (__CFBundleVersion__)<br />
-			BundleId: __CFBundleIdentifier__<br />
-			<div class="__ExtensionTypeHidden__">
-				Extension type: __ExtensionType__<br />
+			Name: <strong>{{AppName}}</strong><br />
+			Version: {{AppVersion}} ({{AppBuildVer}})<br />
+			BundleId: {{AppId}}<br />
+			<div class="{{AppExtensionTypeHidden}}">
+				Extension type: {{AppExtensionType}}<br />
 			</div>
-			DeviceFamily: __UIDeviceFamily__<br />
-			SDK: __DTSDKName__<br />
-			Minimum OS Version: __MinimumOSVersion__<br />
+			DeviceFamily: {{AppDeviceFamily}}<br />
+			SDK: {{AppSDK}}<br />
+			Minimum OS Version: {{AppMinOS}}<br />
 		</div>
 		<br class="clear" />
+	</div>
+	
+	<div class="not-{{AppInfoHidden}}">
+		Could not find any Info.plist
+	</div>
+	
+	<div class="{{ArchiveHidden}}">
+		<h2>Archive Notes</h2>
+		<pre>{{ArchiveComment}}</pre>
+	</div>
+	
+	<div class="{{iTunesHidden}}">
+		<h2>iTunes Metadata</h2>
+		iTunesId: {{iTunesId}}<br />
+		Title: {{iTunesName}}<br />
+		Genres: {{iTunesGenres}}<br />
+		Released: {{iTunesReleaseDate}}<br />
+		<br />
+		AppleId: {{iTunesAppleId}}<br />
+		Purchased: {{iTunesPurchaseDate}}<br />
+		Price: {{iTunesPrice}}<br />
+	</div>
+	
+	<div class="{{TransportSecurityHidden}}">
 		<h2>App Transport Security</h2>
-		__AppTransportSecurityFormatted__
+		{{TransportSecurityDict}}
 	</div>
-
-	<div class="__ProvisionHidden__">
-		<div class="__AppInfoHidden__">
-			<h2>Provisioning</h2>
-			Profile name: <strong>__ProfileName__</strong><br />
-		</div>
-		<div class="__ProvisionTitleHidden__">
-			<h1><span class="__ExpStatus__">__ProfileName__</span></h1>
-		</div>
-
-		Profile UUID: __ProfileUUID__<br />
-		Profile Type: __ProfilePlatform__ __ProfileType__<br />
-		Team: __TeamName__ (__TeamIds__)<br />
-		Creation date: __CreationDateFormatted__<br />
-		Expiration Date: <strong><span class="__ExpStatus__">__ExpirationDateFormatted__</span></strong><br />
-	</div>
-
-	<div>
+	
+	<div class="{{EntitlementsHidden}}">
 		<h2>Entitlements</h2>
-		<div class="__EntitlementsWarningHidden__ warning">
+		<div class="warning {{EntitlementsWarningHidden}}">
 			<strong>Entitlements extraction failed.</strong>
 		</div>
-		__EntitlementsFormatted__
+		{{EntitlementsDict}}
 	</div>
-
-	<div class="__ProvisionHidden__">
+	
+	<div class="{{ProvisionHidden}}">
+		<h2>Provisioning</h2>
+		Profile name: <strong>{{ProvisionProfileName}}</strong><br />
+		Profile UUID: {{ProvisionProfileId}}<br />
+		Profile Type: {{ProvisionProfilePlatform}} {{ProvisionProfileType}}<br />
+		Team: {{ProvisionTeamName}} ({{ProvisionTeamIds}})<br />
+		Creation date: {{ProvisionCreateDate}}<br />
+		Expiration Date: <strong><span class="{{ProvisionExpireStatus}}">{{ProvisionExpireDate}}</span></strong><br />
+		
 		<h2>Developer Certificates</h2>
-		__DeveloperCertificatesFormatted__
+		{{ProvisionDevelopCertificates}}
+		
+		<h2>Devices ({{ProvisionDeviceCount}})</h2>
+		{{ProvisionDeviceIds}}
 	</div>
-
-	<div class="__ProvisionHidden__">
-		<h2>Devices (__ProvisionedDevicesCount__)</h2>
-		__ProvisionedDevicesFormatted__
+	
+	<div class="{{ApkFeaturesRequiredHidden}}">
+		<h2>Features (required)</h2>
+		{{ApkFeaturesRequiredList}}
 	</div>
-
-	<div class="__iTunesHidden__">
-		<h2>iTunes Metadata</h2>
-		iTunesId: __iTunesId__<br />
-		Title: __iTunesName__<br />
-		Genres: __iTunesGenres__<br />
-		Released: __iTunesReleaseDate__<br />
-		<br />
-		AppleId: __iTunesAppleId__<br />
-		Purchased: __iTunesPurchaseDate__<br />
-		Price: __iTunesPrice__<br />
+	
+	<div class="{{ApkFeaturesOptionalHidden}}">
+		<h2>Features (optional)</h2>
+		{{ApkFeaturesOptionalList}}
 	</div>
-
+	
+	<div class="{{ApkPermissionsHidden}}">
+		<h2>Permissions</h2>
+		{{ApkPermissionsList}}
+	</div>
+	
 	<div>
 		<h2>File info</h2>
-		__FileName__<br />
-		__FileInfo__<br />
+		{{FileName}}<br />
+		{{FileSize}}, Modified {{FileModified}}<br />
 	</div>
 	
 	<div class="footer">
-		<p>__SrcAppName__ v__BundleShortVersionString__ (__BundleVersion__) (Github: <a href="__SrcLinkUrl__">__SrcLinkName__</a>)</p>
+		<p>{{SrcAppName}} v{{SrcVersion}} ({{SrcBuildVer}}) (Github: <a href="{{SrcLinkUrl}}">{{SrcLinkName}}</a>)</p>
 	</div>
 </body>
 </html>
--- a/screenshot.png
+++ b/screenshot.png
--- a/screenshot2.png
+++ b/screenshot2.png
--- a/src/Common/AppIcon.swift
+++ b/src/Common/AppIcon.swift
@@ -1,5 +1,6 @@
 import Foundation
 import AppKit // NSImage
+import AssetCarReader // CarReader
 import os // OSLog

 private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "AppIcon")
@@ -12,24 +13,44 @@ struct AppIcon {
 		self.meta = meta
 	}
 	
+	/// Convenience getter to extract app icon regardless of bundle-type.
+	func extractImageForThumbnail() -> NSImage {
+		switch meta.type {
+		case .IPA, .Archive, .Extension:
+			extractImage(from: meta.readPlist_Icon()?.filenames)
+		case .APK:
+			extractImage(from: meta.readApk_Icon())
+		}
+	}
+	
+	/// Extract image from Android app bundle.
+	func extractImage(from apkIcon: Apk_Icon?) -> NSImage {
+		if let data = apkIcon?.data, let img = NSImage(data: data) {
+			return img
+		}
+		return defaultIcon()
+	}
+	
 	/// Try multiple methods to extract image.
 	/// This method will always return an image even if none is found, in which case it returns the default image.
-	func extractImage(from appPlist: PlistDict?) -> NSImage {
+	func extractImage(from plistIcons: [String]?) -> NSImage {
 		// no need to unwrap the plist, and most .ipa should include the Artwork anyway
 		if meta.type == .IPA {
 			if let data = meta.zipFile!.unzipFile("iTunesArtwork") {
 				os_log(.debug, log: log, "[icon] using iTunesArtwork.")
 				return NSImage(data: data)!
 			}
+			// else, fallthrough
 		}
 		
 		// Extract image name from app plist
-		var plistImgNames = iconNamesFromPlist(appPlist)
+		var plistImgNames = plistIcons ?? []
 		os_log(.debug, log: log, "[icon] icon names in plist: %{public}@", plistImgNames)
 		
 		// If no previous filename works (or empty), try default icon names
 		plistImgNames.append("Icon")
 		plistImgNames.append("icon")
+		plistImgNames.append("AppIcon")
 		
 		// First, try if an image file with that name exists.
 		if let actualName = expandImageName(plistImgNames) {
@@ -47,55 +68,36 @@ struct AppIcon {
 		}
 		
 		// Fallback to default icon
+		return defaultIcon()
+	}
+	
+	/// Return the bundled default icon `"defaultIcon.png"`
+	private func defaultIcon() -> NSImage {
 		let iconURL = Bundle.main.url(forResource: "defaultIcon", withExtension: "png")!
 		return NSImage(contentsOf: iconURL)!
 	}
+	
+	/// Extract an image from `Assets.car`
+	func imageFromAssetsCar(_ imageName: String) -> NSImage? {
+		guard let data = meta.readPayloadFile("Assets.car", osxSubdir: "Resources") else {
+			return nil
+		}
+		return CarReader(data)?.imageFromAssetsCar(imageName)
+	}
 }


 // MARK: - Plist

 extension AppIcon {
-	/// Parse app plist to find the bundle icon filename.
-	/// @param appPlist If `nil`, will load plist on the fly (used for thumbnail)
-	/// @return Filenames which do not necessarily exist on filesystem. This may include `@2x` and/or no file extension.
-	private func iconNamesFromPlist(_ appPlist: PlistDict?) -> [String] {
-		let appPlist = appPlist == nil ? meta.readPlistApp()! : appPlist!
-		// Check for CFBundleIcons (since 5.0)
-		if let icons = unpackNameListFromPlistDict(appPlist["CFBundleIcons"]), !icons.isEmpty {
-			return icons
-		}
-		// iPad-only apps
-		if let icons = unpackNameListFromPlistDict(appPlist["CFBundleIcons~ipad"]), !icons.isEmpty {
-			return icons
-		}
-		// Check for CFBundleIconFiles (since 3.2)
-		if let icons = appPlist["CFBundleIconFiles"] as? [String], !icons.isEmpty {
-			return icons
-		}
-		// key found on iTunesU app
-		if let icons = appPlist["Icon files"] as? [String], !icons.isEmpty {
-			return icons
-		}
-		// Check for CFBundleIconFile (legacy, before 3.2)
-		if let icon = appPlist["CFBundleIconFile"] as? String { // may be nil
-			return [icon]
-		}
-		return [] // [self sortedByResolution:icons];
-	}
-	
 	/// Given a filename, search Bundle or Filesystem for files that match. Select the filename with the highest resolution.
 	private func expandImageName(_ iconList: [String]) -> String? {
 		var matches: [String] = []
 		switch meta.type {
 		case .IPA:
-			guard let zipFile = meta.zipFile else {
-				// in case unzip in memory is not available, fallback to pattern matching with dynamic suffix
-				return "Payload/*.app/\(iconList.first!)*"
-			}
 			for iconPath in iconList {
 				let zipPath = "Payload/*.app/\(iconPath)*"
-				for zip in zipFile.filesMatching(zipPath) {
+				for zip in meta.zipFile!.filesMatching(zipPath) {
 					if zip.sizeUncompressed > 0 {
 						matches.append(zip.filepath)
 					}
@@ -105,11 +107,13 @@ extension AppIcon {
 				}
 			}
 			
+		case .APK:
+			return nil // handled in `extractImage()`
+			
 		case .Archive, .Extension:
-			let basePath = meta.effectiveUrl ?? meta.url
 			for iconPath in iconList {
 				let fileName = iconPath.components(separatedBy: "/").last!
-				let parentDir = basePath.appendingPathComponent(iconPath, isDirectory: false).deletingLastPathComponent().path
+				let parentDir = meta.effectiveUrl("Resources", iconPath).parentDir().path
 				guard let files = try? FileManager.default.contentsOfDirectory(atPath: parentDir) else {
 					continue
 				}
@@ -130,21 +134,6 @@ extension AppIcon {
 		}
 		return matches.isEmpty ? nil : sortedByResolution(matches).first
 	}
-	
-	/// Deep select icons from plist key `CFBundleIcons` and `CFBundleIcons~ipad`
-	private func unpackNameListFromPlistDict(_ bundleDict: Any?) -> [String]? {
-		if let bundleDict = bundleDict as? PlistDict {
-			if let primaryDict = bundleDict["CFBundlePrimaryIcon"] as? PlistDict {
-				if let icons = primaryDict["CFBundleIconFiles"] as? [String] {
-					return icons
-				}
-				if let name = primaryDict["CFBundleIconName"] as? String { // key found on a .tipa file
-					return [name]
-				}
-			}
-		}
-		return nil
-	}

 	/// @return lower index means higher resolution.
 	private func resolutionIndex(_ iconName: String) -> Int {
@@ -210,7 +199,6 @@ extension NSImage {
 		
 	/// Convert image to PNG and encode with base64 to be embeded in html output.
 	func asBase64() -> String {
-		//	appIcon = [self roundCorners:appIcon];
 		let imageData = tiffRepresentation!
 		let imageRep = NSBitmapImageRep(data: imageData)!
 		let imageDataPNG = imageRep.representation(using: .png, properties: [:])!
--- a/src/Common/MetaInfo.swift
+++ b/src/Common/MetaInfo.swift
@@ -0,0 +1,134 @@
+import Foundation
+import os // OSLog
+
+private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "MetaInfo")
+
+typealias PlistDict = [String: Any] // basically an untyped Dict
+
+
+// Init QuickLook Type
+enum FileType {
+	case IPA
+	case Archive
+	case Extension
+	case APK
+}
+
+struct MetaInfo {
+	let UTI: String
+	let url: URL
+	private let effectiveUrl: URL // if set, will point to the app inside of an archive
+	
+	let type: FileType
+	let zipFile: ZipFile? // only set for zipped file types
+	let isOSX: Bool
+	
+	/// Use file url and UTI type to generate an info object to pass around.
+	init(_ url: URL) {
+		self.url = url
+		self.UTI = try! url.resourceValues(forKeys: [.typeIdentifierKey]).typeIdentifier ?? "Unknown"
+		
+		var isOSX = false
+		var effective: URL? = nil
+		var zipFile: ZipFile? = nil
+		
+		switch self.UTI {
+		case "com.apple.itunes.ipa", "com.opa334.trollstore.tipa", "dyn.ah62d4rv4ge81k4puqe" /* tipa */:
+			self.type = FileType.IPA
+			zipFile = ZipFile(self.url.path)
+		case "com.apple.xcode.archive":
+			self.type = FileType.Archive
+			let productsDir = url.appendingPathComponent("Products", isDirectory: true)
+			if productsDir.exists(), let bundleDir = recursiveSearchInfoPlist(productsDir) {
+				isOSX = bundleDir.appendingPathComponent("MacOS").exists() && bundleDir.lastPathComponent == "Contents"
+				effective = bundleDir
+			} else {
+				effective = productsDir // this is wrong but dont use `url` either because that will find the `Info.plist` of the archive itself
+			}
+		case "com.apple.application-and-system-extension":
+			self.type = FileType.Extension
+			if let bundleDir = recursiveSearchInfoPlist(url) {
+				isOSX = bundleDir.appendingPathComponent("MacOS").exists() && bundleDir.lastPathComponent == "Contents"
+				effective = bundleDir
+			}
+		case "com.google.android.apk", "dyn.ah62d4rv4ge80c6dp" /* apk */, "public.archive.apk", "dyn.ah62d4rv4ge80c6dpry" /* apkm */:
+			self.type = FileType.APK
+			zipFile = ZipFile(self.url.path)
+		default:
+			os_log(.error, log: log, "Unsupported file type: %{public}@", self.UTI)
+			fatalError()
+		}
+		self.isOSX = isOSX
+		self.zipFile = zipFile
+		self.effectiveUrl = effective ?? url
+	}
+	
+	/// Evaluate path with `osxSubdir` and `filename`
+	func effectiveUrl(_ osxSubdir: String?, _ filename: String) -> URL {
+		switch self.type {
+		case .IPA, .APK:
+			return effectiveUrl
+		case .Archive, .Extension:
+			if isOSX, let osxSubdir {
+				return effectiveUrl
+					.appendingPathComponent(osxSubdir, isDirectory: true)
+					.appendingPathComponent(filename, isDirectory: false)
+			}
+			return effectiveUrl.appendingPathComponent(filename, isDirectory: false)
+		}
+	}
+	
+	/// Load a file from bundle into memory. Either by file path or via unzip.
+	func readPayloadFile(_ filename: String, osxSubdir: String?) -> Data? {
+		switch self.type {
+		case .IPA:
+			return zipFile!.unzipFile("Payload/*.app/".appending(filename))
+		case .APK:
+			return nil // not applicable for .apk
+		case .Archive, .Extension:
+			return try? Data(contentsOf: self.effectiveUrl(osxSubdir, filename))
+		}
+	}
+}
+
+
+// MARK: - Plist
+
+extension Data {
+	/// Helper for optional chaining.
+	func asPlistOrNil() -> PlistDict? {
+		if self.isEmpty {
+			return nil
+		}
+		//	var format: PropertyListSerialization.PropertyListFormat = .xml
+		do {
+			return try PropertyListSerialization.propertyList(from: self, format: nil) as? PlistDict
+		} catch {
+			os_log(.error, log: log, "ERROR reading plist %{public}@", error.localizedDescription)
+			return nil
+		}
+	}
+}
+
+
+// MARK: - helper methods
+
+/// breadth-first search for `Info.plist`
+private func recursiveSearchInfoPlist(_ url: URL) -> URL? {
+	var queue: [URL] = [url]
+	while !queue.isEmpty {
+		let current = queue.removeLast()
+		if current.pathExtension == "framework" {
+			continue // do not evaluate bundled frameworks
+		}
+		if let subfiles = try? FileManager.default.contentsOfDirectory(at: current, includingPropertiesForKeys: []) {
+			for fname in subfiles {
+				if fname.lastPathComponent == "Info.plist" {
+					return fname.parentDir()
+				}
+			}
+			queue.append(contentsOf: subfiles)
+		}
+	}
+	return nil
+}
--- a/src/Common/NSBezierPath+RoundedRect.swift
+++ b/src/Common/NSBezierPath+RoundedRect.swift
--- a/src/Common/URL+File.swift
+++ b/src/Common/URL+File.swift
@@ -0,0 +1,17 @@
+import Foundation
+
+extension URL {
+	/// Folder where user can mofifications to html template
+	static let UserModDir: URL? =
+		FileManager.default.urls(for: .documentDirectory, in: .userDomainMask).first
+	
+	/// Returns `true` if file or folder exists.
+	@inlinable func exists() -> Bool {
+		FileManager.default.fileExists(atPath: self.path)
+	}
+	
+	/// Returns URL by deleting last path component
+	@inlinable func parentDir() -> URL {
+		self.deletingLastPathComponent()
+	}
+}
--- a/src/Common/Zip.swift
+++ b/src/Common/Zip.swift
@@ -175,7 +175,6 @@ func unzipFileEntry(_ path: String, _ entry: ZipEntry) -> Data? {
 	}
 	fp.seek(toFileOffset: UInt64(entry.offset))
 	let file_record = ZIP_LocalFile(fp.readData(ofLength: ZIP_LocalFile.LENGTH))
-	os_log(.debug, log: log, "header: %{public}@ vs  %{public}@", String(describing: file_record), String(describing: entry))
 	
 	// central directory size and local file size may differ! use local file for ground truth
 	let dataOffset = Int(entry.offset) + ZIP_LocalFile.LENGTH + Int(file_record.fileNameLength) + Int(file_record.extraFieldLength)
@@ -225,9 +224,9 @@ private func listZip(_ path: String) -> [ZipEntry] {
 	}
 	
 	guard let endRecord = findCentralDirectory(fp), endRecord.sizeOfCentralDirectory > 0 else {
-		return [];
+		return []
 	}
-	return listDirectoryEntries(fp, endRecord);
+	return listDirectoryEntries(fp, endRecord)
 }

 /// Find signature for central directory.
@@ -355,12 +354,23 @@ struct ZipFile {
 	/// Unzip file to filesystem.
 	/// @param filePath File path inside zip file.
 	/// @param targetDir Directory in which to unzip the file.
-	func unzipFile(_ filePath: String, toDir targetDir: String) throws {
-		if let data = self.unzipFile(filePath) {
-			let filename = filePath.components(separatedBy: "/").last!
-			let outputPath = targetDir.appending("/" + filename)
-			os_log(.debug, log: log, "[unzip] write to %{public}@", outputPath)
-			try data.write(to: URL(fileURLWithPath: outputPath), options: .atomic)
+	@discardableResult
+	func unzipFile(_ filePath: String, toDir targetDir: String) throws -> String? {
+		guard let data = self.unzipFile(filePath) else {
+			return nil
 		}
+		let filename = filePath.components(separatedBy: "/").last!
+		let outputPath = targetDir.appending("/" + filename)
+		os_log(.debug, log: log, "[unzip] write to %{public}@", outputPath)
+		try data.write(to: URL(fileURLWithPath: outputPath), options: .atomic)
+		return outputPath
+	}
+	
+	/// Extract selected `filePath` inside zip to a new temporary directory and return path to that file.
+	/// @return Path to extracted data. Returns `nil` or throws exception if data could not be extracted.
+	func unzipFileToTempDir(_ filePath: String) throws -> String? {
+		let tmpPath = NSTemporaryDirectory() + "/" + UUID().uuidString
+		try! FileManager.default.createDirectory(atPath: tmpPath, withIntermediateDirectories: true)
+		return try unzipFile(filePath, toDir: tmpPath)
 	}
 }
--- a/Android/AndroidSdkMap.swift
+++ b/Android/AndroidSdkMap.swift
@@ -0,0 +1,45 @@
+// see https://developer.android.com/guide/topics/manifest/uses-sdk-element#api-level-table
+
+let AndroidSdkMap: [Int: String] = [
+	1: "1.0",
+	2: "1.1",
+	3: "1.5",
+	4: "1.6",
+	5: "2.0",
+	6: "2.0.1",
+	7: "2.1.x",
+	8: "2.2.x",
+	9: "2.3, 2.3.1, 2.3.2",
+	10: "2.3.3, 2.3.4",
+	11: "3.0.x",
+	12: "3.1.x",
+	13: "3.2",
+	14: "4.0, 4.0.1, 4.0.2",
+	15: "4.0.3, 4.0.4",
+	16: "4.1, 4.1.1",
+	17: "4.2, 4.2.2",
+	18: "4.3",
+	19: "4.4",
+	20: "4.4W",
+	21: "5.0",
+	22: "5.1",
+	23: "6.0",
+	24: "7.0",
+	25: "7.1, 7.1.1",
+	26: "8.0",
+	27: "8.1",
+	28: "9",
+	29: "10",
+	30: "11",
+	31: "12",
+	32: "12",
+	33: "13",
+	34: "14",
+	35: "15",
+	36: "16",
+	// can we assume new versions will stick to this scheme?
+	37: "17",
+	38: "18",
+	39: "19",
+	40: "20",
+]
--- a/Android/Apk+Icon.swift
+++ b/Android/Apk+Icon.swift
@@ -0,0 +1,74 @@
+import Foundation
+import AndroidXML
+
+extension MetaInfo {
+	/// Read `AndroidManifest.xml` but only extract `appIcon`.
+	func readApk_Icon() -> Apk_Icon? {
+		assert(type == .APK)
+		var apk = Apk(self)
+		return Apk_Icon(&apk)
+	}
+}
+
+
+// MARK: - Apk_Icon
+
+/// Representation of `AndroidManifest.xml` (containing only the icon extractor).
+/// Seperate from main class because everything else is not needed for `ThumbnailProvider`
+struct Apk_Icon {
+	let path: String
+	let data: Data
+	
+	init?(_ apk: inout Apk, iconRef: String? = nil) {
+		if apk.isApkm, let iconData = apk.mainZip.unzipFile("icon.png") {
+			path = "icon.png"
+			data = iconData
+			return
+		}
+		
+		guard let manifest = apk.manifest else {
+			return nil
+		}
+		
+		var ref = iconRef
+		// no need to parse xml if reference already supplied
+		if ref == nil {
+			if let xml = try? AndroidXML.init(data: manifest) {
+				let parser = xml.parseXml()
+				try? parser.iterElements({ startTag, attributes in
+					if startTag == "application" {
+						ref = try? attributes.get("android:icon")?.resolve(parser.stringPool)
+					}
+				}) {_ in}
+			} else {
+				// fallback to xml-string parser
+				ref = ApkXmlIconParser().run(manifest)
+			}
+		}
+		
+		guard let img = apk.resolveIcon(&ref) else {
+			return nil
+		}
+		path = ref!
+		data = img
+	}
+}
+
+/// Shorter form of `ApkXmlManifestParser` to only exctract the icon reference (used for Thumbnail Provider)
+private class ApkXmlIconParser: NSObject, XMLParserDelegate {
+	var result: String? = nil
+	
+	func run(_ data: Data) -> String? {
+		let parser = XMLParser(data: data)
+		parser.delegate = self
+		parser.parse()
+		return result
+	}
+	
+	func parser(_ parser: XMLParser, didStartElement elementName: String, namespaceURI: String?, qualifiedName qName: String?, attributes attrs: [String : String] = [:]) {
+		if elementName == "application" {
+			result = attrs["android:icon"]
+			parser.abortParsing()
+		}
+	}
+}
--- a/Android/Apk+Manifest.swift
+++ b/Android/Apk+Manifest.swift
@@ -0,0 +1,123 @@
+import Foundation
+import AndroidXML
+
+extension MetaInfo {
+	/// Read `AndroidManifest.xml` and parse its content
+	func readApk_Manifest() -> Apk_Manifest? {
+		assert(type == .APK)
+		var apk = Apk(self)
+		return Apk_Manifest.from(&apk)
+	}
+}
+
+
+// MARK: - Apk_Manifest
+
+/// Representation of `AndroidManifest.xml`.
+/// See: <https://developer.android.com/guide/topics/manifest/manifest-element>
+struct Apk_Manifest {
+	var packageId: String? = nil
+	var appName: String? = nil
+	var icon: Apk_Icon? = nil
+	/// Computed property
+	var appIconData: Data? = nil
+	var versionName: String? = nil
+	var versionCode: String? = nil
+	var sdkVerMin: Int? = nil
+	var sdkVerTarget: Int? = nil
+	
+	var featuresRequired: [String] = []
+	var featuresOptional: [String] = []
+	var permissions: [String] = []
+	
+	static func from(_ apk: inout Apk) -> Self? {
+		guard let manifest = apk.manifest else {
+			return nil
+		}
+		
+		let storage = ApkXmlManifestParser()
+		if let xml = try? AndroidXML.init(data: manifest) {
+			let parser = xml.parseXml()
+			let ignore = XMLParser()
+			try? parser.iterElements({ startTag, attributes in
+				if ALLOWED_TAGS.contains(startTag) {
+					storage.parser(ignore, didStartElement: startTag, namespaceURI: nil, qualifiedName: nil, attributes: try attributes.asDictStr())
+				}
+			}) { endTag in
+				if ALLOWED_TAGS.contains(endTag) {
+					storage.parser(ignore, didEndElement: endTag, namespaceURI: nil, qualifiedName: nil)
+				}
+			}
+		} else {
+			// fallback to xml-string parser
+			let parser = XMLParser(data: manifest)
+			parser.delegate = storage
+			parser.parse()
+		}
+		
+		var rv = storage.result
+		apk.resolveName(&rv.appName)
+		rv.icon = Apk_Icon(&apk, iconRef: storage.iconRef)
+		return rv
+	}
+}
+
+// keep in sync with `ApkXmlManifestParser` below
+private let ALLOWED_TAGS = [
+	"manifest",
+	"application",
+	"uses-feature",
+	"uses-permission",
+	"uses-permission-sdk-23",
+	"uses-sdk",
+]
+
+/// Wrapper to use same code for binary-xml and string-xml parsing
+private class ApkXmlManifestParser: NSObject, XMLParserDelegate {
+	private var _scope: [String] = []
+	var result = Apk_Manifest()
+	var iconRef: String? = nil
+	
+	func parser(_ parser: XMLParser, didStartElement elementName: String, namespaceURI: String?, qualifiedName qName: String?, attributes attrs: [String : String] = [:]) {
+		// keep in sync with `ALLOWED_TAGS` above
+		switch elementName {
+		case "manifest":
+			if _scope == [] {
+				result.packageId = attrs["package"] // "org.bundle.id"
+				result.versionName = attrs["android:versionName"] // "7.62.3"
+				result.versionCode = attrs["android:versionCode"] // "160700"
+				// attrs["platformBuildVersionCode"] // "35"
+				// attrs["platformBuildVersionName"] // "15"
+			}
+		case "application":
+			if _scope == ["manifest"] {
+				result.appName = attrs["android:label"] // @resource-ref
+				iconRef = attrs["android:icon"] // @resource-ref
+			}
+		case "uses-permission", "uses-permission-sdk-23":
+			// no "permission" because that will produce duplicates with "uses-permission"
+			if _scope == ["manifest"], let name = attrs["android:name"] {
+				result.permissions.append(name)
+			}
+		case "uses-feature":
+			if _scope == ["manifest"], let name = attrs["android:name"] {
+				if attrs["android:required"] == "false" {
+					result.featuresOptional.append(name)
+				} else {
+					result.featuresRequired.append(name)
+				}
+			}
+		case "uses-sdk":
+			if _scope == ["manifest"] {
+				result.sdkVerMin = Int(attrs["android:minSdkVersion"] ?? "1") // "21"
+				result.sdkVerTarget = Int(attrs["android:targetSdkVersion"] ?? "-1") // "35"
+			}
+		default: break // ignore
+		}
+		_scope.append(elementName)
+	}
+	
+	func parser(_ parser: XMLParser, didEndElement elementName: String, namespaceURI: String?, qualifiedName qName: String?) {
+		_scope.removeLast()
+	}
+}
--- a/Android/Apk.swift
+++ b/Android/Apk.swift
@@ -0,0 +1,130 @@
+import Foundation
+import AndroidXML
+
+/// Data structure for processing the content of `.apk` files.
+struct Apk {
+	let isApkm: Bool
+	let mainZip: ZipFile
+	
+	init(_ meta: MetaInfo) {
+		isApkm = meta.url.pathExtension.lowercased() == "apkm"
+		mainZip = meta.zipFile!
+	}
+	
+	/// Unzip `AndroidManifest.xml` (once). Data is cached until deconstructor.
+	lazy var manifest: Data? = { effectiveZip?.unzipFile("AndroidManifest.xml") }()
+	
+	/// Select zip-file depending on `.apk` or `.apkm` extension
+	private lazy var effectiveZip: ZipFile? = { isApkm ? nestedZip : mainZip }()
+	
+	/// `.apkm` may contain multiple `.apk` files. (plus "icon.png" and "info.json" files)
+	private lazy var nestedZip: ZipFile? = {
+		if isApkm, let pth = try? mainZip.unzipFileToTempDir("base.apk") {
+			return ZipFile(pth)
+		}
+		return nil
+	}()
+	
+	/// Shared instance for resolving resources
+	private lazy var resourceParser: Tbl_Parser? = {
+		guard let data = effectiveZip?.unzipFile("resources.arsc"),
+			  let xml = try? AndroidXML.init(data: data), xml.type == .Table else {
+			return nil
+		}
+		return xml.parseTable()
+	}()
+	
+	/// Lookup app bundle name / label
+	mutating func resolveName(_ name: inout String?) {
+		if let val = name, let ref = try? TblTableRef(val), let parser = resourceParser {
+			name = parser.getName(ref)
+		}
+	}
+	
+	/// Lookup image path and image data
+	mutating func resolveIcon(_ iconRef: inout String?) -> Data? {
+		if let val = iconRef, let ref = try? TblTableRef(val), let parser = resourceParser {
+			if let iconPath = parser.getIconDirect(ref) ?? parser.getIconIndirect(ref) {
+				iconRef = iconPath
+				return effectiveZip?.unzipFile(iconPath)
+			}
+		}
+		return nil
+	}
+}
+
+
+private extension Tbl_Parser {
+	func getName(_ ref: TblTableRef) -> String? {
+		// why the heck are these even allowed?
+		// apparently there can be references onto references
+		var ref = ref
+		while let res = try? self.getResource(ref) {
+			guard let val = res.entries.first?.entry.value else {
+				return nil
+			}
+			switch val.dataType {
+			case .Reference: ref = val.asTableRef // and continue
+			case .String: return val.resolve(self.stringPool)
+			default: return nil
+			}
+		}
+		return nil
+	}
+	
+	/// Lookup resource with matching id. Choose the icon with the highest density.
+	func getIconDirect(_ ref: TblTableRef) -> String? {
+		guard let res = try? self.getResource(ref) else {
+			return nil
+		}
+		var best: ResValue? = nil
+		var bestScore: UInt16 = 0
+		for e in res.entries {
+			switch e.config.screenType.density {
+			case .Default, .any, .None: continue
+			case let density:
+				if density.rawValue > bestScore, let val = e.entry.value {
+					bestScore = density.rawValue
+					best = val
+				}
+			}
+		}
+		return best?.resolve(self.stringPool)
+	}
+	
+	/// Iterate over all entries and choose best-rated icon file.
+	/// Rating prefers files which have an attribute name `"app_icon"` or `"ic_launcher"`.
+	func getIconIndirect(_ ref: TblTableRef) -> String? {
+		// sadly we cannot just `getResource()` because that can point to an app banner
+		guard let pkg = try? self.getPackage(ref.package),
+			  var pool = pkg.stringPool(for: .Keys),
+			  let (_, types) = try? pkg.getType(ref.type) else {
+			return nil
+		}
+		// density is 120-640
+		let rates: [String: UInt16] = [
+			"app_icon": 1000,
+			"ic_launcher": 800,
+			"ic_launcher_foreground": 200,
+		]
+		var best: ResValue? = nil
+		var bestScore: UInt16 = 0
+		for typ in types {
+			switch typ.config.screenType.density {
+			case .any, .None: continue
+			case let density:
+				try? typ.iterValues {
+					if let val = $1.value {
+						let attrName = pool.getStringCached($1.key)
+						let score = density.rawValue + (rates[attrName] ?? 0)
+						if score > bestScore {
+							bestScore = score
+							best = val
+						}
+					}
+				}
+			}
+		}
+		return best?.resolve(self.stringPool)
+	}
+}
--- a/Apple/AppCategories.swift
+++ b/Apple/AppCategories.swift
@@ -1,5 +1,3 @@
-import Foundation
-
 /*
 #!/usr/bin/env python3
 # download: https://itunes.apple.com/WebObjects/MZStoreServices.woa/ws/genres
--- a/Apple/Entitlements.swift
+++ b/Apple/Entitlements.swift
@@ -67,6 +67,8 @@ struct Entitlements {
 	
 	// MARK: - SecCode in-memory reader
 	
+	// Same as system call:
+	// `codesign -d ./binary --entitlements - --xml` or: `codesign -d ./binary --entitlements :-`
 	/// use in-memory `SecCode` for entitlement extraction
 	private func getSecCodeEntitlements() -> PlistDict? {
 		let url = URL(fileURLWithPath: self.binaryPath)
@@ -84,13 +86,13 @@ struct Entitlements {
 		
 		// if 'entitlements-dict' key exists, use that one
 		os_log(.debug, log: log, "[entitlements] read SecCode 'entitlements-dict' key")
-		if let plist = requirementInfo[kSecCodeInfoEntitlementsDict as String] as? PlistDict {
+		if let plist = requirementInfo[kSecCodeInfoEntitlementsDict as String] as? PlistDict, !plist.isEmpty {
 			return plist
 		}
 		
 		// else, fallback to parse data from 'entitlements' key
 		os_log(.debug, log: log, "[entitlements] read SecCode 'entitlements' key")
-		guard let data = requirementInfo[kSecCodeInfoEntitlements as String] as? Data else {
+		guard let data = requirementInfo[kSecCodeInfoEntitlements as String] as? Data, !data.isEmpty else {
 			return nil
 		}
 		
@@ -107,7 +109,10 @@ struct Entitlements {
 			os_log(.error, log: log, "[entitlements] unpack error for FADE7171 size %lu != %lu", data.count, size)
 			// but try anyway
 		}
-		return data.subdata(in: 8..<data.count).asPlistOrNil()
+		guard let rv = data.subdata(in: 8..<data.count).asPlistOrNil(), !rv.isEmpty else {
+			return nil
+		}
+		return rv
 	}
 	
 	
--- a/Apple/Plist+Icon.swift
+++ b/Apple/Plist+Icon.swift
@@ -0,0 +1,65 @@
+
+extension MetaInfo {
+	/// Read `Info.plist`. (used for `ThumbnailProvider`)
+	func readPlist_Icon() -> Plist_Icon? {
+		if let x = self.readPayloadFile("Info.plist", osxSubdir: nil)?.asPlistOrNil() {
+			return Plist_Icon(x)
+		}
+		return nil
+	}
+}
+
+
+// MARK: - Plist_Icon
+
+/// Representation of `Info.plist` (containing only the icon extractor).
+/// Seperate from main class because everything else is not needed for `ThumbnailProvider`
+struct Plist_Icon {
+	let filenames: [String]
+	
+	init(_ plist: PlistDict) {
+		filenames = parseIconNames(plist)
+	}
+}
+
+/// Find icon filenames.
+/// @return Filenames which do not necessarily exist on filesystem. This may include `@2x` and/or no file extension.
+private func parseIconNames(_ plist: PlistDict) -> [String] {
+	// Check for CFBundleIcons (since 5.0)
+	if let icons = unpackNameList(plist["CFBundleIcons"]) {
+		return icons
+	}
+	// iPad-only apps
+	if let icons = unpackNameList(plist["CFBundleIcons~ipad"]) {
+		return icons
+	}
+	// Check for CFBundleIconFiles (since 3.2)
+	if let icons = plist["CFBundleIconFiles"] as? [String], !icons.isEmpty {
+		return icons
+	}
+	// key found on iTunesU app
+	if let icons = plist["Icon files"] as? [String], !icons.isEmpty {
+		return icons
+	}
+	// Check for CFBundleIconFile (legacy, before 3.2)
+	if let icon = plist["CFBundleIconFile"] as? String { // may be nil
+		return [icon]
+	}
+	return []
+}
+
+/// Deep select icons from plist key `CFBundleIcons` and `CFBundleIcons~ipad`
+/// @return Guarantees a non-empty array (or `nil`)
+private func unpackNameList(_ bundleDict: Any?) -> [String]? {
+	if let bundleDict = bundleDict as? PlistDict {
+		if let primaryDict = bundleDict["CFBundlePrimaryIcon"] as? PlistDict {
+			if let icons = primaryDict["CFBundleIconFiles"] as? [String], !icons.isEmpty {
+				return icons
+			}
+			if let name = primaryDict["CFBundleIconName"] as? String { // key found on a .tipa file
+				return [name]
+			}
+		}
+	}
+	return nil
+}
--- a/Apple/Plist+Info.swift
+++ b/Apple/Plist+Info.swift
@@ -0,0 +1,70 @@
+import Foundation
+
+extension MetaInfo {
+	/// Read `Info.plist`. (used for `PreviewProvider`)
+	func readPlist_Info() -> Plist_Info? {
+		if let x = self.readPayloadFile("Info.plist", osxSubdir: nil)?.asPlistOrNil() {
+			return Plist_Info(x, isOSX: isOSX)
+		}
+		return nil
+	}
+}
+
+
+// MARK: - Plist_Info
+
+/// Representation of `Info.plist` of an `.ipa` bundle
+struct Plist_Info {
+	let bundleId: String?
+	let name: String?
+	let version: String?
+	let buildVersion: String?
+	
+	let exePath: String?
+	let sdkVersion: String?
+	let minOS: String?
+	let extensionType: String?
+	
+	let icons: [String]
+	let deviceFamily: [String]
+	let transportSecurity: PlistDict?
+	
+	init(_ plist: PlistDict, isOSX: Bool) {
+		bundleId = plist["CFBundleIdentifier"] as? String
+		name = plist["CFBundleDisplayName"] as? String ?? plist["CFBundleName"] as? String
+		version = plist["CFBundleShortVersionString"] as? String
+		buildVersion = plist["CFBundleVersion"] as? String
+		exePath = plist["CFBundleExecutable"] as? String
+		sdkVersion = plist["DTSDKName"] as? String
+		minOS = plist[isOSX ? "LSMinimumSystemVersion" : "MinimumOSVersion"] as? String
+		extensionType = (plist["NSExtension"] as? PlistDict)?["NSExtensionPointIdentifier"] as? String
+		icons = Plist_Icon(plist).filenames
+		deviceFamily = parseDeviceFamily(plist, isOSX: isOSX)
+		transportSecurity = plist["NSAppTransportSecurity"] as? PlistDict
+	}
+}
+
+private func parseDeviceFamily(_ plist: PlistDict, isOSX: Bool) -> [String] {
+	if isOSX {
+		return plist["CFBundleSupportedPlatforms"] as? [String] ?? ["macOS"]
+	}
+	
+	if let platforms = (plist["UIDeviceFamily"] as? [Int])?.compactMap({
+		switch $0 {
+		case 1: "iPhone"
+		case 2: "iPad"
+		case 3: "TV"
+		case 4: "Watch"
+		default: nil
+		}
+	}), platforms.count > 0 {
+		return platforms
+	}
+	
+	if let minVersion = plist["MinimumOSVersion"] as? String {
+		if minVersion.hasPrefix("1.") || minVersion.hasPrefix("2.") || minVersion.hasPrefix("3.") {
+			return ["iPhone"]
+		}
+	}
+	return []
+}
--- a/Apple/Plist+MobileProvision.swift
+++ b/Apple/Plist+MobileProvision.swift
@@ -0,0 +1,61 @@
+import Foundation
+
+extension MetaInfo {
+	/// Read `embedded.mobileprovision` (if available) and decode with CMS decoder.
+	func readPlist_MobileProvision() -> Plist_MobileProvision? {
+		guard let provisionData = self.readPayloadFile("embedded.mobileprovision", osxSubdir: nil),
+			  let plist = provisionData.decodeCMS().asPlistOrNil() else {
+			return nil
+		}
+		return Plist_MobileProvision(plist, isOSX: self.isOSX)
+	}
+}
+
+// MARK: - Plist_MobileProvision
+
+/// Representation of `embedded.mobileprovision`
+struct Plist_MobileProvision {
+	let creationDate: Date?
+	let expireDate: Date?
+	let profileId: String?
+	let profileName: String?
+	/// Something like "Development" or "Distribution (App Store)".
+	let profileType: String
+	/// Either "Mac" or "iOS"
+	let profilePlatform: String
+	let teamName: String?
+	let teamIds: [String]
+	let devices: [String]
+	let certificates: [ProvisioningCertificate]
+	let entitlements: PlistDict?
+	
+	init(_ plist: PlistDict, isOSX: Bool) {
+		creationDate = plist["CreationDate"] as? Date
+		expireDate = plist["ExpirationDate"] as? Date
+		profileId = plist["UUID"] as? String
+		profileName = plist["Name"] as? String
+		profileType = parseProfileType(plist, isOSX: isOSX)
+		profilePlatform = isOSX ? "Mac" : "iOS"
+		teamName = plist["TeamName"] as? String
+		teamIds = plist["TeamIdentifier"] as? [String] ?? []
+		devices = plist["ProvisionedDevices"] as? [String] ?? []
+		certificates = (plist["DeveloperCertificates"] as? [Data] ?? []).compactMap {
+			ProvisioningCertificate($0)
+		}
+		entitlements = plist["Entitlements"] as? PlistDict
+	}
+}
+
+/// Returns provision type string like "Development" or "Distribution (App Store)".
+private func parseProfileType(_ plist: PlistDict, isOSX: Bool) -> String {
+	let hasDevices = plist["ProvisionedDevices"] is [Any]
+	if isOSX {
+		return hasDevices ? "Development" : "Distribution (App Store)"
+	}
+	if hasDevices {
+		let getTaskAllow = (plist["Entitlements"] as? PlistDict)?["get-task-allow"] as? Bool ?? false
+		return getTaskAllow ? "Development" : "Distribution (Ad Hoc)"
+	}
+	let isEnterprise = plist["ProvisionsAllDevices"] as? Bool ?? false
+	return isEnterprise ? "Enterprise" : "Distribution (App Store)"
+}
--- a/Apple/Plist+iTunesMetadata.swift
+++ b/Apple/Plist+iTunesMetadata.swift
@@ -0,0 +1,77 @@
+import Foundation
+
+extension MetaInfo {
+	/// Read `iTunesMetadata.plist` (if available)
+	func readPlist_iTunesMetadata() -> Plist_iTunesMetadata? {
+		assert(type == .IPA)
+		// not `readPayloadFile` because plist is in root dir
+		guard let plist = self.zipFile!.unzipFile("iTunesMetadata.plist")?.asPlistOrNil() else {
+			return nil
+		}
+		return Plist_iTunesMetadata(plist)
+	}
+}
+
+
+// MARK: - Plist_iTunesMetadata
+
+/// Representation of `iTunesMetadata.plist`
+struct Plist_iTunesMetadata {
+	let appId: Int?
+	let appName: String?
+	let price: String?
+	let genres: [String]
+	// purchase info
+	let releaseDate: Date?
+	let purchaseDate: Date?
+	// account info
+	let appleId: String?
+	let firstName: String?
+	let lastName: String?
+	
+	init(_ plist: PlistDict) {
+		appId = plist["itemId"] as? Int
+		appName = plist["itemName"] as? String
+		price = plist["priceDisplay"] as? String
+		genres = formattedGenres(plist)
+		// download info
+		let downloadInfo = plist["com.apple.iTunesStore.downloadInfo"] as? PlistDict
+		purchaseDate = Date.parseAny(downloadInfo?["purchaseDate"] ?? plist["purchaseDate"])
+		releaseDate = Date.parseAny(downloadInfo?["releaseDate"] ?? plist["releaseDate"])
+		// AppleId & purchaser name
+		let accountInfo = downloadInfo?["accountInfo"] as? PlistDict ?? [:]
+		appleId = accountInfo["AppleID"] as? String ?? plist["appleId"] as? String
+		firstName = accountInfo["FirstName"] as? String
+		lastName = accountInfo["LastName"] as? String
+	}
+	
+	/// Returns `"<firstName> <lastName> (<appleId>)"` (with empty values omitted)
+	var purchaserName: String? {
+		let fn = firstName ?? ""
+		let ln = lastName ?? ""
+		let aid = appleId ?? ""
+		switch (fn.isEmpty, ln.isEmpty, aid.isEmpty) {
+		case (true, true, true): return nil
+		case (true, true, false): return "\(aid)"
+		case (_, _, false): return "\(fn) \(ln) (\(aid))"
+		case (_, _, true): return "\(fn) \(ln)"
+		}
+	}
+}
+
+/// Concatenate all (sub)genres into flat list.
+private func formattedGenres(_ plist: PlistDict) -> [String] {
+	var genres: [String] = []
+	let genreId = plist["genreId"] as? Int ?? 0
+	if let mainGenre = AppCategories[genreId] ?? plist["genre"] as? String {
+		genres.append(mainGenre)
+	}
+	
+	for subgenre in plist["subgenres"] as? [PlistDict] ?? [] {
+		let subgenreId = subgenre["genreId"] as? Int ?? 0
+		if let subgenreStr = AppCategories[subgenreId] ?? subgenre["genre"] as? String {
+			genres.append(subgenreStr)
+		}
+	}
+	return genres
+}
--- a/Apple/Provisioning.swift
+++ b/Apple/Provisioning.swift
@@ -0,0 +1,58 @@
+import Foundation
+import os // OSLog
+
+private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "Provisioning")
+
+extension Data {
+	/// In-memory decode of `embedded.mobileprovision`
+	func decodeCMS() -> Data {
+		var decoder: CMSDecoder? = nil
+		CMSDecoderCreate(&decoder)
+		return self.withUnsafeBytes { ptr in
+			CMSDecoderUpdateMessage(decoder!, ptr.baseAddress!, self.count)
+			CMSDecoderFinalizeMessage(decoder!)
+			var dataRef: CFData?
+			CMSDecoderCopyContent(decoder!, &dataRef)
+			return Data(referencing: dataRef!)
+		}
+	}
+}
+
+struct ProvisioningCertificate {
+	let subject: String
+	let expiration: Date?
+	
+	/// Parse subject and expiration date from certificate.
+	init?(_ data: Data) {
+		guard let cert = SecCertificateCreateWithData(nil, data as CFData) else {
+			return nil
+		}
+		guard let subj = SecCertificateCopySubjectSummary(cert) as? String else {
+			os_log(.error, log: log, "Could not get subject from certificate")
+			return nil
+		}
+		subject = subj
+		expiration = parseInvalidityDate(cert, subject: subj)
+	}
+}
+
+/// Process a single certificate. Extract invalidity / expiration date.
+/// @param subject just used for printing error logs.
+private func parseInvalidityDate(_ certificate: SecCertificate, subject: String) -> Date? {
+	var error: Unmanaged<CFError>?
+	guard let outerDict = SecCertificateCopyValues(certificate, [kSecOIDInvalidityDate] as CFArray, &error) as? PlistDict else {
+		os_log(.error, log: log, "Could not get values in '%{public}@' certificate, error = %{public}@", subject, error?.takeUnretainedValue().localizedDescription ?? "unknown error")
+		return nil
+	}
+	guard let innerDict = outerDict[kSecOIDInvalidityDate as String] as? PlistDict else {
+		os_log(.error, log: log, "No invalidity values in '%{public}@' certificate, dictionary = %{public}@", subject, outerDict)
+		return nil
+	}
+	// NOTE: the invalidity date type of kSecPropertyTypeDate is documented as a CFStringRef in the "Certificate, Key, and Trust Services Reference".
+	// In reality, it's a __NSTaggedDate (presumably a tagged pointer representing an NSDate.) But to be sure, we'll check:
+	guard let dateString = innerDict[kSecPropertyKeyValue as String] else {
+		os_log(.error, log: log, "No invalidity date in '%{public}@' certificate, dictionary = %{public}@", subject, innerDict)
+		return nil
+	}
+	return Date.parseAny(dateString)
+}
--- a/src/Html+AppInfo.swift
+++ b/src/Html+AppInfo.swift
@@ -1,103 +0,0 @@
-import Foundation
-
-/// Print recursive tree of key-value mappings.
-private func recursiveDict(_ dictionary: [String: Any], withReplacements replacements: [String: String] = [:], _ level: Int = 0) -> String {
-	var output = ""
-	for (key, value) in dictionary {
-		let localizedKey = replacements[key] ?? key
-		for _ in 0..<level {
-			output += (level == 1) ? "- " : "&nbsp;&nbsp;"
-		}
-		
-		if let subDict = value as? [String: Any] {
-			output += "\(localizedKey):<div class=\"list\">\n"
-			output += recursiveDict(subDict, withReplacements: replacements, level + 1)
-			output += "</div>\n"
-		} else if let number = value as? NSNumber {
-			output += "\(localizedKey): \(number.boolValue ? "YES" : "NO")<br />"
-		} else {
-			output += "\(localizedKey): \(value)<br />"
-		}
-	}
-	return output
-}
-
-extension HtmlGenerator {
-	/// @return List of ATS flags.
-	private func formattedAppTransportSecurity(_ appPlist: PlistDict) -> String {
-		if let value = appPlist["NSAppTransportSecurity"] as? PlistDict {
-			let localizedKeys = [
-				"NSAllowsArbitraryLoads": "Allows Arbitrary Loads",
-				"NSAllowsArbitraryLoadsForMedia": "Allows Arbitrary Loads for Media",
-				"NSAllowsArbitraryLoadsInWebContent": "Allows Arbitrary Loads in Web Content",
-				"NSAllowsLocalNetworking": "Allows Local Networking",
-				"NSExceptionDomains": "Exception Domains",
-				
-				"NSIncludesSubdomains": "Includes Subdomains",
-				"NSRequiresCertificateTransparency": "Requires Certificate Transparency",
-				
-				"NSExceptionAllowsInsecureHTTPLoads": "Allows Insecure HTTP Loads",
-				"NSExceptionMinimumTLSVersion": "Minimum TLS Version",
-				"NSExceptionRequiresForwardSecrecy": "Requires Forward Secrecy",
-				
-				"NSThirdPartyExceptionAllowsInsecureHTTPLoads": "Allows Insecure HTTP Loads",
-				"NSThirdPartyExceptionMinimumTLSVersion": "Minimum TLS Version",
-				"NSThirdPartyExceptionRequiresForwardSecrecy": "Requires Forward Secrecy",
-			]
-			
-			return "<div class=\"list\">\(recursiveDict(value, withReplacements: localizedKeys))</div>"
-		}
-		
-		let sdkName = appPlist["DTSDKName"] as? String ?? "0"
-		let sdkNumber = Double(sdkName.trimmingCharacters(in: .letters)) ?? 0
-		if sdkNumber < 9.0 {
-			return "Not applicable before iOS 9.0"
-		}
-		return "No exceptions"
-	}
-	
-	/// Process info stored in `Info.plist`
-	mutating func procAppInfo(_ appPlist: PlistDict?) {
-		guard let appPlist else {
-			self.apply([
-				"AppInfoHidden": "hiddenDiv",
-				"ProvisionTitleHidden": "",
-			])
-			return
-		}
-		
-		var platforms = (appPlist["UIDeviceFamily"] as? [Int])?.compactMap({
-			switch $0 {
-			case 1: return "iPhone"
-			case 2: return "iPad"
-			case 3: return "TV"
-			case 4: return "Watch"
-			default: return nil
-			}
-		}).joined(separator: ", ")
-		
-		let minVersion = appPlist["MinimumOSVersion"] as? String ?? ""
-		if platforms?.isEmpty ?? true, minVersion.hasPrefix("1.") || minVersion.hasPrefix("2.") || minVersion.hasPrefix("3.") {
-			platforms = "iPhone"
-		}
-		
-		let extensionType = (appPlist["NSExtension"] as? PlistDict)?["NSExtensionPointIdentifier"] as? String
-		self.apply([
-			"AppInfoHidden": "",
-			"ProvisionTitleHidden": "hiddenDiv",
-			
-			"CFBundleName": appPlist["CFBundleDisplayName"] as? String ?? appPlist["CFBundleName"] as? String ?? "",
-			"CFBundleShortVersionString": appPlist["CFBundleShortVersionString"] as? String ?? "",
-			"CFBundleVersion": appPlist["CFBundleVersion"] as? String ?? "",
-			"CFBundleIdentifier": appPlist["CFBundleIdentifier"] as? String ?? "",
-			
-			"ExtensionTypeHidden": extensionType != nil ? "" : "hiddenDiv",
-			"ExtensionType": extensionType ?? "",
-			
-			"UIDeviceFamily": platforms ?? "",
-			"DTSDKName": appPlist["DTSDKName"] as? String ?? "",
-			"MinimumOSVersion": minVersion,
-			"AppTransportSecurityFormatted": formattedAppTransportSecurity(appPlist),
-		])
-	}
-}
--- a/src/Html+Entitlements.swift
+++ b/src/Html+Entitlements.swift
@@ -1,36 +0,0 @@
-import Foundation
-
-extension HtmlGenerator {
-	/// Search for app binary and run `codesign` on it.
-	private func readEntitlements(_ meta: MetaInfo, _ bundleExecutable: String?) -> Entitlements {
-		guard let bundleExecutable else {
-			return Entitlements.withoutBinary()
-		}
-		
-		switch meta.type {
-		case .IPA:
-			let tmpPath = NSTemporaryDirectory() + "/" + UUID().uuidString
-			try! FileManager.default.createDirectory(atPath: tmpPath, withIntermediateDirectories: true)
-			defer {
-				try? FileManager.default.removeItem(atPath: tmpPath)
-			}
-			try! meta.zipFile!.unzipFile("Payload/*.app/\(bundleExecutable)", toDir: tmpPath)
-			return Entitlements(forBinary: tmpPath + "/" + bundleExecutable)
-		case .Archive:
-			return Entitlements(forBinary: meta.effectiveUrl!.path + "/" + bundleExecutable)
-		case .Extension:
-			return Entitlements(forBinary: meta.url.path + "/" + bundleExecutable)
-		}
-	}
-	
-	/// Process compiled binary and provision plist to extract `Entitlements`
-	mutating func procEntitlements(_ meta: MetaInfo, _ appPlist: PlistDict?, _ provisionPlist: PlistDict?) {
-		var entitlements = readEntitlements(meta, appPlist?["CFBundleExecutable"] as? String)
-		entitlements.applyFallbackIfNeeded(provisionPlist?["Entitlements"] as? PlistDict)
-		
-		self.apply([
-			"EntitlementsWarningHidden": entitlements.hasError ? "" : "hiddenDiv",
-			"EntitlementsFormatted": entitlements.html ?? "No Entitlements",
-		])
-	}
-}
--- a/src/Html+Provisioning.swift
+++ b/src/Html+Provisioning.swift
@@ -1,160 +0,0 @@
-import Foundation
-import os // OSLog
-
-private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "Html+Certificates")
-
-
-extension MetaInfo {
-	/// Read `embedded.mobileprovision` file and decode with CMS decoder.
-	func readPlistProvision() -> PlistDict? {
-		guard let provisionData = self.readPayloadFile("embedded.mobileprovision") else {
-			os_log(.info, log: log, "No embedded.mobileprovision file for %{public}@", self.url.path)
-			return nil
-		}
-		
-		var decoder: CMSDecoder? = nil
-		CMSDecoderCreate(&decoder)
-		let data = provisionData.withUnsafeBytes { ptr in
-			CMSDecoderUpdateMessage(decoder!, ptr.baseAddress!, provisionData.count)
-			CMSDecoderFinalizeMessage(decoder!)
-			var dataRef: CFData?
-			CMSDecoderCopyContent(decoder!, &dataRef)
-			return Data(referencing: dataRef!)
-		}
-		return data.asPlistOrNil()
-	}
-}
-
-
-extension HtmlGenerator {
-	
-	// MARK: - Certificates
-	
-	/// Process a single certificate. Extract invalidity / expiration date.
-	/// @param subject just used for printing error logs.
-	private func getCertificateInvalidityDate(_ certificate: SecCertificate, subject: String) -> Date? {
-		var error: Unmanaged<CFError>?
-		guard let outerDict = SecCertificateCopyValues(certificate, [kSecOIDInvalidityDate] as CFArray, &error) as? PlistDict else {
-			os_log(.error, log: log, "Could not get values in '%{public}@' certificate, error = %{public}@", subject, error?.takeUnretainedValue().localizedDescription ?? "unknown error")
-			return nil
-		}
-		guard let innerDict = outerDict[kSecOIDInvalidityDate as String] as? PlistDict else {
-			os_log(.error, log: log, "No invalidity values in '%{public}@' certificate, dictionary = %{public}@", subject, outerDict)
-			return nil
-		}
-		// NOTE: the invalidity date type of kSecPropertyTypeDate is documented as a CFStringRef in the "Certificate, Key, and Trust Services Reference".
-		// In reality, it's a __NSTaggedDate (presumably a tagged pointer representing an NSDate.) But to be sure, we'll check:
-		guard let dateString = innerDict[kSecPropertyKeyValue as String] else {
-			os_log(.error, log: log, "No invalidity date in '%{public}@' certificate, dictionary = %{public}@", subject, innerDict)
-			return nil
-		}
-		return Date.parseAny(dateString);
-	}
-	
-	/// Process list of all certificates. Return a two column table with subject and expiration date.
-	private func getCertificateList(_ provisionPlist: PlistDict) -> [TableRow] {
-		guard let certs = provisionPlist["DeveloperCertificates"] as? [Data] else {
-			return []
-		}
-		return certs.compactMap {
-			guard let cert = SecCertificateCreateWithData(nil, $0 as CFData) else {
-				return nil
-			}
-			guard let subject = SecCertificateCopySubjectSummary(cert) as? String else {
-				os_log(.error, log: log, "Could not get subject from certificate")
-				return nil
-			}
-			let expiration: String
-			if let invalidityDate = getCertificateInvalidityDate(cert, subject: subject) {
-				expiration = invalidityDate.relativeExpirationDateString()
-			} else {
-				expiration = "<span class='warning'>No invalidity date in certificate</span>"
-			}
-			return TableRow([subject, expiration])
-		}.sorted { $0[0] < $1[0] }
-	}
-	
-	
-	// MARK: - Provisioning
-
-	/// Returns provision type string like "Development" or "Distribution (App Store)".
-	private func stringForProfileType(_ provisionPlist: PlistDict, isOSX: Bool) -> String {
-		let hasDevices = provisionPlist["ProvisionedDevices"] is [Any]
-		if isOSX {
-			return hasDevices ? "Development" : "Distribution (App Store)"
-		}
-		if hasDevices {
-			let getTaskAllow = (provisionPlist["Entitlements"] as? PlistDict)?["get-task-allow"] as? Bool ?? false
-			return getTaskAllow ? "Development" : "Distribution (Ad Hoc)"
-		}
-		let isEnterprise = provisionPlist["ProvisionsAllDevices"] as? Bool ?? false
-		return isEnterprise ? "Enterprise" : "Distribution (App Store)"
-	}
-	
-	/// Enumerate all entries from provison plist with key `ProvisionedDevices`
-	private func getDeviceList(_ provisionPlist: PlistDict) -> [TableRow] {
-		guard let devArr = provisionPlist["ProvisionedDevices"] as? [String] else {
-			return []
-		}
-		var currentPrefix: String? = nil
-		return devArr.sorted().map { device in
-			// compute the prefix for the first column of the table
-			let displayPrefix: String
-			let devicePrefix = String(device.prefix(1))
-			if currentPrefix != devicePrefix {
-				currentPrefix = devicePrefix
-				displayPrefix = "\(devicePrefix) ➞ "
-			} else {
-				displayPrefix = ""
-			}
-			return [displayPrefix, device]
-		}
-	}
-	
-	/// Process info stored in `embedded.mobileprovision`
-	mutating func procProvision(_ provisionPlist: PlistDict?, isOSX: Bool) {
-		guard let provisionPlist else {
-			self.apply(["ProvisionHidden": "hiddenDiv"])
-			return
-		}
-		
-		let creationDate = provisionPlist["CreationDate"] as? Date
-		let expireDate = provisionPlist["ExpirationDate"] as? Date
-		let devices = getDeviceList(provisionPlist)
-		let certs = getCertificateList(provisionPlist)
-		
-		self.apply([
-			"ProvisionHidden": "",
-			"ProfileName": provisionPlist["Name"] as? String ?? "",
-			"ProfileUUID": provisionPlist["UUID"] as? String ?? "",
-			"TeamName": provisionPlist["TeamName"] as? String ?? "<em>Team name not available</em>",
-			"TeamIds": (provisionPlist["TeamIdentifier"] as? [String])?.joined(separator: ", ") ?? "<em>Team ID not available</em>",
-			"CreationDateFormatted": creationDate?.formattedCreationDate() ?? "",
-			"ExpirationDateFormatted": expireDate?.formattedExpirationDate() ?? "",
-			"ExpStatus": ExpirationStatus(expireDate).cssClass(),
-			
-			"ProfilePlatform": isOSX ? "Mac" : "iOS",
-			"ProfileType": stringForProfileType(provisionPlist, isOSX: isOSX),
-			
-			"ProvisionedDevicesCount": devices.isEmpty ? "No Devices" : "\(devices.count) Device\(devices.count == 1 ? "" : "s")",
-			"ProvisionedDevicesFormatted": devices.isEmpty ? "Distribution Profile" : formatAsTable(devices, header: ["", "UDID"]),
-			
-			"DeveloperCertificatesFormatted": certs.isEmpty ? "No Developer Certificates" : formatAsTable(certs),
-		])
-	}
-}
-
-private typealias TableRow = [String]
-
-/// Print html table with arbitrary number of columns
-/// @param header If set, start the table with a `tr` column row.
-private func formatAsTable(_ data: [[String]], header: TableRow? = nil) -> String {
-	var table = "<table>\n"
-	if let header = header {
-		table += "<tr><th>\(header.joined(separator: "</th><th>"))</th></tr>\n"
-	}
-	for row in data {
-		table += "<tr><td>\(row.joined(separator: "</td><td>"))</td></tr>\n"
-	}
-	return table + "</table>\n"
-}
--- a/src/Html+iTunesPurchase.swift
+++ b/src/Html+iTunesPurchase.swift
@@ -1,70 +0,0 @@
-import Foundation
-
-extension MetaInfo {	
-	/// Read `iTunesMetadata.plist` if available
-	func readPlistItunes() -> PlistDict? {
-		switch self.type {
-		case .IPA:
-			// not `readPayloadFile` because plist is in root dir
-			return self.zipFile!.unzipFile("iTunesMetadata.plist")?.asPlistOrNil()
-		case .Archive, .Extension:
-			return nil
-		}
-	}
-}
-
-
-extension HtmlGenerator {
-	/// Concatenate all (sub)genres into a comma separated list.
-	private func formattedGenres(_ itunesPlist: PlistDict) -> String {
-		var genres: [String] = []
-		let genreId = itunesPlist["genreId"] as? Int ?? 0
-		if let mainGenre = AppCategories[genreId] ?? itunesPlist["genre"] as? String {
-			genres.append(mainGenre)
-		}
-		
-		for subgenre in itunesPlist["subgenres"] as? [PlistDict] ?? [] {
-			let subgenreId = subgenre["genreId"] as? Int ?? 0
-			if let subgenreStr = AppCategories[subgenreId] ?? subgenre["genre"] as? String {
-				genres.append(subgenreStr)
-			}
-		}
-		return genres.joined(separator: ", ")
-	}
-	
-	/// Process info stored in `iTunesMetadata.plist`
-	mutating func procItunesMeta(_ itunesPlist: PlistDict?) {
-		guard let itunesPlist else {
-			self.apply(["iTunesHidden": "hiddenDiv"])
-			return
-		}
-		
-		let downloadInfo = itunesPlist["com.apple.iTunesStore.downloadInfo"] as? PlistDict
-		let accountInfo = downloadInfo?["accountInfo"] as? PlistDict ?? [:]
-		
-		let purchaseDate = Date.parseAny(downloadInfo?["purchaseDate"] ?? itunesPlist["purchaseDate"])
-		let releaseDate = Date.parseAny(downloadInfo?["releaseDate"] ?? itunesPlist["releaseDate"])
-		// AppleId & purchaser name
-		let appleId = accountInfo["AppleID"] as? String ?? itunesPlist["appleId"] as? String ?? ""
-		let firstName = accountInfo["FirstName"] as? String ?? ""
-		let lastName = accountInfo["LastName"] as? String ?? ""
-		
-		let name: String
-		if !firstName.isEmpty || !lastName.isEmpty {
-			name = "\(firstName) \(lastName) (\(appleId))"
-		} else {
-			name = appleId
-		}
-		self.apply([
-			"iTunesHidden": "",
-			"iTunesId": (itunesPlist["itemId"] as? Int)?.description ?? "", // description]
-			"iTunesName": itunesPlist["itemName"] as? String ?? "",
-			"iTunesGenres": formattedGenres(itunesPlist),
-			"iTunesReleaseDate": releaseDate?.mediumFormat() ?? "",
-			
-			"iTunesAppleId": name,
-			"iTunesPurchaseDate": purchaseDate?.mediumFormat() ?? "",
-			"iTunesPrice": itunesPlist["priceDisplay"] as? String ?? "",
-		])
-	}
-}
--- a/src/HtmlGenerator.swift
+++ b/src/HtmlGenerator.swift
@@ -1,71 +0,0 @@
-import Foundation
-
-struct HtmlGenerator {
-	var data: [String: String] = [:] // used for TAG replacements
-	let meta: MetaInfo
-	
-	init(_ meta: MetaInfo) {
-		self.meta = meta
-		let plistApp = meta.readPlistApp()
-		let plistItunes = meta.readPlistItunes()
-		let plistProvision = meta.readPlistProvision()
-		
-		data["AppInfoTitle"] = stringForFileType(meta)
-		
-		procAppInfo(plistApp)
-		procItunesMeta(plistItunes)
-		procProvision(plistProvision, isOSX: meta.isOSX)
-		procEntitlements(meta, plistApp, plistProvision)
-		procFileInfo(meta.url)
-		procFooterInfo()
-		// App Icon (last, because the image uses a lot of memory)
-		data["AppIcon"] = AppIcon(meta).extractImage(from: plistApp).withRoundCorners().asBase64()
-		// insert CSS styles
-		let cssURL = Bundle.main.url(forResource: "style", withExtension: "css")!
-		data["CSS"] = try! String(contentsOf: cssURL, encoding: .utf8)
-	}
-	
-	mutating func apply(_ values: [String: String]) {
-		data.merge(values) { (_, new) in new }
-	}
-	
-	/// Title of the preview window
-	private func stringForFileType(_ meta: MetaInfo) -> String {
-		switch meta.type {
-		case .IPA:       return "App info"
-		case .Archive:   return "Archive info"
-		case .Extension: return "App extension info"
-		}
-	}
-	
-	/// prepare html, replace values
-	func applyHtmlTemplate() -> String {
-		let templateURL = Bundle.main.url(forResource: "template", withExtension: "html")!
-		let html = try! String(contentsOf: templateURL, encoding: .utf8)
-		
-		// this is less efficient
-		//	for (key, value) in templateValues {
-		//		html = html.replacingOccurrences(of: "__\(key)__", with: value)
-		//	}
-		
-		var rv = ""
-		var prevLoc = html.startIndex
-		let regex = try! NSRegularExpression(pattern: "__[^ _]{1,40}?__")
-		regex.enumerateMatches(in: html, range: NSRange(location: 0, length: html.count), using: { match, flags, stop  in
-			let start = html.index(html.startIndex, offsetBy: match!.range.lowerBound)
-			let key = String(html[html.index(start, offsetBy: 2) ..< html.index(start, offsetBy: match!.range.length - 2)])
-			// append unrelated text up to this key
-			rv.append(contentsOf: html[prevLoc ..< start])
-			prevLoc = html.index(start, offsetBy: match!.range.length)
-			// append key if exists (else remove template-key)
-			if let value = data[key] {
-				rv.append(value)
-			} else {
-				// os_log(.debug, log: log, "unknown template key: %{public}@", key)
-			}
-		})
-		// append remaining text
-		rv.append(contentsOf: html[prevLoc ..< html.endIndex])
-		return rv
-	}
-}
--- a/src/MetaInfo.swift
+++ b/src/MetaInfo.swift
@@ -1,102 +0,0 @@
-import Foundation
-import os // OSLog
-
-private let log = OSLog(subsystem: Bundle.main.bundleIdentifier!, category: "MetaInfo")
-
-typealias PlistDict = [String: Any] // basically an untyped Dict
-
-
-// Init QuickLook Type
-enum FileType {
-	case IPA
-	case Archive
-	case Extension
-}
-
-struct MetaInfo {
-	let UTI: String
-	let url: URL
-	let effectiveUrl: URL? // if set, will point to the app inside of an archive
-	
-	let type: FileType
-	let zipFile: ZipFile? // only set for zipped file types
-	let isOSX = false // relict of the past when ProvisionQL also processed provision profiles
-	
-	/// Use file url and UTI type to generate an info object to pass around.
-	init(_ url: URL) {
-		self.url = url
-		self.UTI = try! url.resourceValues(forKeys:  [.typeIdentifierKey]).typeIdentifier ?? "Unknown"
-		
-		var effective: URL? = nil
-		var zipFile: ZipFile? = nil
-		
-		switch self.UTI {
-		case "com.apple.itunes.ipa":
-			self.type = FileType.IPA;
-			zipFile = ZipFile(self.url.path);
-		case "com.apple.xcode.archive":
-			self.type = FileType.Archive;
-			effective = appPathForArchive(self.url);
-		case "com.apple.application-and-system-extension":
-			self.type = FileType.Extension;
-		default:
-			os_log(.error, log: log, "Unsupported file type: %{public}@", self.UTI)
-			fatalError()
-		}
-		self.zipFile = zipFile
-		self.effectiveUrl = effective
-	}
-	
-	/// Load a file from bundle into memory. Either by file path or via unzip.
-	func readPayloadFile(_ filename: String) -> Data? {
-		switch (self.type) {
-		case .IPA:
-			return zipFile!.unzipFile("Payload/*.app/".appending(filename))
-		case .Archive:
-			return try? Data(contentsOf: effectiveUrl!.appendingPathComponent(filename))
-		case .Extension:
-			return try? Data(contentsOf: url.appendingPathComponent(filename))
-		}
-	}
-	
-	/// Read app default `Info.plist`. (used for both, Preview and Thumbnail)
-	func readPlistApp() -> PlistDict? {
-		switch self.type {
-		case .IPA, .Archive, .Extension:
-			return self.readPayloadFile("Info.plist")?.asPlistOrNil()
-		}
-	}
-}
-
-
-// MARK: - Plist
-
-extension Data {
-	/// Helper for optional chaining.
-	func asPlistOrNil() -> PlistDict? {
-		if self.isEmpty {
-			return nil
-		}
-		//	var format: PropertyListSerialization.PropertyListFormat = .xml
-		do {
-			return try PropertyListSerialization.propertyList(from: self, format: nil) as? PlistDict
-		} catch {
-			os_log(.error, log: log, "ERROR reading plist %{public}@", error.localizedDescription)
-			return nil
-		}
-	}
-}
-
-
-// MARK: - Meta data for QuickLook
-
-/// Search an archive for the .app or .ipa bundle.
-private func appPathForArchive(_ url: URL) -> URL? {
-	let appsDir = url.appendingPathComponent("Products/Applications/")
-	if FileManager.default.fileExists(atPath: appsDir.path) {
-		if let x = try? FileManager.default.contentsOfDirectory(at: appsDir, includingPropertiesForKeys: nil), !x.isEmpty {
-			return x.first
-		}
-	}
-	return nil;
-}
--- a/src/Preview/Date+Format.swift
+++ b/src/Preview/Date+Format.swift
--- a/src/Preview/ExpirationStatus.swift
+++ b/src/Preview/ExpirationStatus.swift
--- a/src/Preview/Preview+AppInfo.swift
+++ b/src/Preview/Preview+AppInfo.swift
@@ -0,0 +1,55 @@
+import Foundation
+
+extension PreviewGenerator {
+	/// Process info stored in `Info.plist`
+	mutating func procAppInfoApple(_ appPlist: Plist_Info) {
+		self.apply([
+			"AppInfoHidden": CLASS_VISIBLE,
+			"AppName": appPlist.name ?? "",
+			"AppVersion": appPlist.version ?? "",
+			"AppBuildVer": appPlist.buildVersion ?? "",
+			"AppId": appPlist.bundleId ?? "",
+			
+			"AppExtensionTypeHidden": appPlist.extensionType != nil ? CLASS_VISIBLE : CLASS_HIDDEN,
+			"AppExtensionType": appPlist.extensionType ?? "",
+			
+			"AppDeviceFamily": appPlist.deviceFamily.joined(separator: ", "),
+			"AppSDK": appPlist.sdkVersion ?? "",
+			"AppMinOS": appPlist.minOS ?? "",
+		])
+	}
+	
+	/// Process info stored in `AndroidManifest.xml`
+	mutating func procAppInfoAndroid(_ manifest: Apk_Manifest) {
+		let featReq = manifest.featuresRequired
+		let featOpt = manifest.featuresOptional
+		let perms = manifest.permissions
+		
+		func asList(_ list: [String]) -> String {
+			"<pre>\(list.joined(separator: "\n"))</pre>"
+		}
+		
+		func resolveSDK(_ sdk: Int?) -> String {
+			sdk == nil ? "" : "\(sdk!) (Android \(AndroidSdkMap[sdk!] ?? "?"))"
+		}
+		self.apply([
+			"AppInfoHidden": CLASS_VISIBLE,
+			"AppName": manifest.appName ?? "",
+			"AppVersion": manifest.versionName ?? "",
+			"AppBuildVer": manifest.versionCode ?? "",
+			"AppId": manifest.packageId ?? "",
+			
+			"ApkFeaturesRequiredHidden": featReq.isEmpty ? CLASS_HIDDEN : CLASS_VISIBLE,
+			"ApkFeaturesRequiredList": asList(featReq),
+			"ApkFeaturesOptionalHidden": featOpt.isEmpty ? CLASS_HIDDEN : CLASS_VISIBLE,
+			"ApkFeaturesOptionalList": asList(featOpt),
+			"ApkPermissionsHidden": perms.isEmpty ? CLASS_HIDDEN : CLASS_VISIBLE,
+			"ApkPermissionsList": asList(perms),
+			
+			"AppDeviceFamily": "Android",
+			"AppSDK": resolveSDK(manifest.sdkVerTarget),
+			"AppMinOS": resolveSDK(manifest.sdkVerMin),
+		])
+	}
+}
+
--- a/src/Preview/Preview+ArchiveInfo.swift
+++ b/src/Preview/Preview+ArchiveInfo.swift
@@ -0,0 +1,28 @@
+import Foundation
+
+extension MetaInfo {
+	/// Read `Info.plist` if type `.Archive`
+	func readPlistXCArchive() -> PlistDict? {
+		switch self.type {
+		case .Archive:
+			// not `readPayloadFile` because plist is in root dir
+			return try? Data(contentsOf: self.url.appendingPathComponent("Info.plist", isDirectory: false)).asPlistOrNil()
+		case .IPA, .Extension, .APK:
+			return nil
+		}
+	}
+}
+
+extension PreviewGenerator {
+	/// Process info of `.xcarchive` stored in root `Info.plist`
+	mutating func procArchiveInfo(_ archivePlist: PlistDict?) {
+		guard let archivePlist, let comment = archivePlist["Comment"] as? String else {
+			return
+		}
+		
+		self.apply([
+			"ArchiveHidden": CLASS_VISIBLE,
+			"ArchiveComment": comment,
+		])
+	}
+}
--- a/src/Preview/Preview+Entitlements.swift
+++ b/src/Preview/Preview+Entitlements.swift
@@ -0,0 +1,39 @@
+import Foundation
+
+extension PreviewGenerator {
+	/// Search for app binary and run `codesign` on it.
+	private func readEntitlements(_ meta: MetaInfo, _ bundleExecutable: String?) -> Entitlements {
+		if let exe = bundleExecutable {
+			switch meta.type {
+			case .IPA:
+				if let tmpPath = try? meta.zipFile!.unzipFileToTempDir("Payload/*.app/\(exe)") {
+					defer {
+						try? FileManager.default.removeItem(atPath: tmpPath)
+					}
+					return Entitlements(forBinary: tmpPath + "/" + exe)
+				}
+			case .Archive, .Extension:
+				return Entitlements(forBinary: meta.effectiveUrl("MacOS", exe).path)
+			case .APK:
+				break // not applicable for Android
+			}
+		}
+		return Entitlements.withoutBinary()
+	}
+	
+	/// Process compiled binary and provision plist to extract `Entitlements`
+	mutating func procEntitlements(_ meta: MetaInfo, _ appPlist: Plist_Info?, _ provisionPlist: Plist_MobileProvision?) {
+		var entitlements = readEntitlements(meta, appPlist?.exePath)
+		entitlements.applyFallbackIfNeeded(provisionPlist?.entitlements)
+		
+		if entitlements.html == nil && !entitlements.hasError {
+			return
+		}
+		
+		self.apply([
+			"EntitlementsHidden" : CLASS_VISIBLE,
+			"EntitlementsWarningHidden": entitlements.hasError ? CLASS_VISIBLE : CLASS_HIDDEN,
+			"EntitlementsDict": entitlements.html ?? "No Entitlements",
+		])
+	}
+}
--- a/src/Preview/Preview+FileInfo.swift
+++ b/src/Preview/Preview+FileInfo.swift
@@ -1,32 +1,12 @@
 import Foundation

-extension HtmlGenerator {
-	/// Calculate file / folder size.
-	private func getFileSize(_ path: String) -> Int64 {
-		var isDir: ObjCBool = false
-		FileManager.default.fileExists(atPath: path, isDirectory: &isDir)
-		if !isDir.boolValue {
-			return try! FileManager.default.attributesOfItem(atPath: path)[.size] as! Int64
-		}
-		var fileSize: Int64 = 0
-		for child in try! FileManager.default.subpathsOfDirectory(atPath: path) {
-			fileSize += try! FileManager.default.attributesOfItem(atPath: path + "/" + child)[.size] as! Int64
-		}
-		return fileSize
-	}
-	
+extension PreviewGenerator {
 	/// Process meta information about the file itself. Like file size and last modification.
 	mutating func procFileInfo(_ url: URL) {
-		let formattedValue : String
-		if let attrs = try? FileManager.default.attributesOfItem(atPath: url.path) {
-			let size = ByteCountFormatter.string(fromByteCount: getFileSize(url.path), countStyle: .file)
-			formattedValue = "\(size), Modified \((attrs[.modificationDate] as! Date).mediumFormat())"
-		} else {
-			formattedValue = ""
-		}
 		self.apply([
 			"FileName": escapeXML(url.lastPathComponent),
-			"FileInfo": formattedValue,
+			"FileSize": url.fileSizeHuman(),
+			"FileModified": url.modificationDate()?.mediumFormat() ?? "",
 		])
 	}
 }
@@ -41,3 +21,32 @@ private func escapeXML(_ stringToEscape: String) -> String {
 		.replacingOccurrences(of: "<", with: "&lt;")
 		.replacingOccurrences(of: ">", with: "&gt;")
 }
+
+
+extension URL {
+	/// Last modification date of file (or folder)
+	@inlinable func modificationDate() -> Date? {
+		(try? FileManager.default.attributesOfItem(atPath: self.path))?[.modificationDate] as? Date
+	}
+	
+	/// Calls `fileSize()`. Will convert `Int` to human readable `String`.
+	func fileSizeHuman() -> String {
+		ByteCountFormatter.string(fromByteCount: self.fileSize(), countStyle: .file)
+	}
+	
+	// MARK: - private methods
+	
+	/// Calculate file or folder size.
+	private func fileSize() -> Int64 {
+		var isDir: ObjCBool = false
+		FileManager.default.fileExists(atPath: self.path, isDirectory: &isDir)
+		if !isDir.boolValue {
+			return try! FileManager.default.attributesOfItem(atPath: self.path)[.size] as! Int64
+		}
+		var fileSize: Int64 = 0
+		for child in try! FileManager.default.subpathsOfDirectory(atPath: self.path) {
+			fileSize += try! FileManager.default.attributesOfItem(atPath: self.path + "/" + child)[.size] as! Int64
+		}
+		return fileSize
+	}
+}
--- a/src/Preview/Preview+Footer.swift
+++ b/src/Preview/Preview+Footer.swift
@@ -1,14 +1,14 @@
 import Foundation

-extension HtmlGenerator {
+extension PreviewGenerator {
 	/// Process meta information about the plugin. Like version and debug flag.
 	mutating func procFooterInfo() {
 		self.apply([
 			"SrcAppName": "QLAppBundle",
 			"SrcLinkUrl": "https://github.com/relikd/QLAppBundle",
 			"SrcLinkName": "relikd/QLAppBundle",
-			"BundleShortVersionString": Bundle.main.infoDictionary?["CFBundleShortVersionString"] as? String ?? "",
-			"BundleVersion": Bundle.main.infoDictionary?["CFBundleVersion"] as? String ?? "",
+			"SrcVersion": Bundle.main.infoDictionary?["CFBundleShortVersionString"] as? String ?? "",
+			"SrcBuildVer": Bundle.main.infoDictionary?["CFBundleVersion"] as? String ?? "",
 		])
 #if DEBUG
 		self.data["SrcAppName"]! += " (debug)"
--- a/src/Preview/Preview+Provisioning.swift
+++ b/src/Preview/Preview+Provisioning.swift
@@ -0,0 +1,68 @@
+import Foundation
+
+extension PreviewGenerator {
+	/// Process info stored in `embedded.mobileprovision`
+	mutating func procProvision(_ provisionPlist: Plist_MobileProvision?) {
+		guard let provisionPlist else {
+			return
+		}
+		
+		let deviceCount = provisionPlist.devices.count
+		self.apply([
+			"ProvisionHidden": CLASS_VISIBLE,
+			"ProvisionProfileName": provisionPlist.profileName ?? "",
+			"ProvisionProfileId": provisionPlist.profileId ?? "",
+			"ProvisionTeamName": provisionPlist.teamName ?? "<em>Team name not available</em>",
+			"ProvisionTeamIds": provisionPlist.teamIds.isEmpty ? "<em>Team ID not available</em>" : provisionPlist.teamIds.joined(separator: ", "),
+			"ProvisionCreateDate": provisionPlist.creationDate?.formattedCreationDate() ?? "",
+			"ProvisionExpireDate": provisionPlist.expireDate?.formattedExpirationDate() ?? "",
+			"ProvisionExpireStatus": ExpirationStatus(provisionPlist.expireDate).cssClass(),
+			
+			"ProvisionProfilePlatform": provisionPlist.profilePlatform,
+			"ProvisionProfileType": provisionPlist.profileType,
+			
+			"ProvisionDeviceCount": deviceCount == 0 ? "No Devices" : "\(deviceCount) Device\(deviceCount == 1 ? "" : "s")",
+			"ProvisionDeviceIds": deviceCount == 0 ? "Distribution Profile" : formatAsTable(groupDevices(provisionPlist.devices), header: ["", "UDID"]),
+			
+			"ProvisionDevelopCertificates": provisionPlist.certificates.isEmpty ? "No Developer Certificates"
+			: formatAsTable(
+				provisionPlist.certificates
+					.sorted { $0.subject < $1.subject }
+					.map {TableRow([$0.subject, $0.expiration?.relativeExpirationDateString() ?? "<span class='warning'>No invalidity date in certificate</span>"])}
+			),
+		])
+	}
+}
+
+/// Group device ids by first letter (`d -> device02`)
+private func groupDevices(_ devices: [String]) -> [TableRow] {
+	var currentPrefix: String? = nil
+	return devices.sorted().map { device in
+		// compute the prefix for the first column of the table
+		let displayPrefix: String
+		let devicePrefix = String(device.prefix(1))
+		if currentPrefix != devicePrefix {
+			currentPrefix = devicePrefix
+			displayPrefix = "\(devicePrefix) ➞ "
+		} else {
+			displayPrefix = ""
+		}
+		return [displayPrefix, device]
+	}
+}
+
+
+private typealias TableRow = [String]
+
+/// Print html table with arbitrary number of columns
+/// @param header If set, start the table with a `tr` column row.
+private func formatAsTable(_ data: [[String]], header: TableRow? = nil) -> String {
+	var table = "<table>\n"
+	if let header = header {
+		table += "<tr><th>\(header.joined(separator: "</th><th>"))</th></tr>\n"
+	}
+	for row in data {
+		table += "<tr><td>\(row.joined(separator: "</td><td>"))</td></tr>\n"
+	}
+	return table + "</table>\n"
+}
--- a/src/Preview/Preview+TransportSecurity.swift
+++ b/src/Preview/Preview+TransportSecurity.swift
@@ -0,0 +1,56 @@
+import Foundation
+
+private let TransportSecurityLocalizedKeys = [
+	"NSAllowsArbitraryLoads": "Allows Arbitrary Loads",
+	"NSAllowsArbitraryLoadsForMedia": "Allows Arbitrary Loads for Media",
+	"NSAllowsArbitraryLoadsInWebContent": "Allows Arbitrary Loads in Web Content",
+	"NSAllowsLocalNetworking": "Allows Local Networking",
+	"NSExceptionDomains": "Exception Domains",
+	
+	"NSIncludesSubdomains": "Includes Subdomains",
+	"NSRequiresCertificateTransparency": "Requires Certificate Transparency",
+	
+	"NSExceptionAllowsInsecureHTTPLoads": "Allows Insecure HTTP Loads",
+	"NSExceptionMinimumTLSVersion": "Minimum TLS Version",
+	"NSExceptionRequiresForwardSecrecy": "Requires Forward Secrecy",
+	
+	"NSThirdPartyExceptionAllowsInsecureHTTPLoads": "Allows Insecure HTTP Loads",
+	"NSThirdPartyExceptionMinimumTLSVersion": "Minimum TLS Version",
+	"NSThirdPartyExceptionRequiresForwardSecrecy": "Requires Forward Secrecy",
+]
+
+/// Print recursive tree of key-value mappings.
+private func recursiveTransportSecurity(_ dictionary: PlistDict, _ level: Int = 0) -> String {
+	var output = ""
+	for (key, value) in dictionary {
+		let localizedKey = TransportSecurityLocalizedKeys[key] ?? key
+		for _ in 0..<level {
+			output += (level == 1) ? "- " : "&nbsp;&nbsp;"
+		}
+		
+		if let subDict = value as? [String: Any] {
+			output += "\(localizedKey):<div class=\"list\">\n"
+			output += recursiveTransportSecurity(subDict, level + 1)
+			output += "</div>\n"
+		} else if let number = value as? NSNumber {
+			output += "\(localizedKey): \(number.boolValue ? "YES" : "NO")<br />"
+		} else {
+			output += "\(localizedKey): \(value)<br />"
+		}
+	}
+	return output
+}
+
+extension PreviewGenerator {
+	/// Process ATS info in `Info.plist`
+	mutating func procTransportSecurity(_ appPlist: Plist_Info?) {
+		guard let value = appPlist?.transportSecurity else {
+			return
+		}
+		
+		self.apply([
+			"TransportSecurityHidden": CLASS_VISIBLE,
+			"TransportSecurityDict": "<div class=\"list\">\(recursiveTransportSecurity(value))</div>",
+		])
+	}
+}
--- a/src/Preview/Preview+iTunesPurchase.swift
+++ b/src/Preview/Preview+iTunesPurchase.swift
@@ -0,0 +1,21 @@
+import Foundation
+
+extension PreviewGenerator {
+	/// Process info stored in `iTunesMetadata.plist`
+	mutating func procItunesMeta(_ itunesPlist: Plist_iTunesMetadata?) {
+		guard let itunesPlist else {
+			return
+		}
+		self.apply([
+			"iTunesHidden": CLASS_VISIBLE,
+			"iTunesId": itunesPlist.appId?.description ?? "",
+			"iTunesName": itunesPlist.appName ?? "",
+			"iTunesGenres": itunesPlist.genres.joined(separator: ", "),
+			"iTunesReleaseDate": itunesPlist.releaseDate?.mediumFormat() ?? "",
+			
+			"iTunesAppleId": itunesPlist.purchaserName ?? "",
+			"iTunesPurchaseDate": itunesPlist.purchaseDate?.mediumFormat() ?? "",
+			"iTunesPrice": itunesPlist.price ?? "",
+		])
+	}
+}
--- a/src/Preview/PreviewGenerator.swift
+++ b/src/Preview/PreviewGenerator.swift
@@ -0,0 +1,105 @@
+import Foundation
+
+let CLASS_HIDDEN = "hidden"
+let CLASS_VISIBLE = ""
+
+struct PreviewGenerator {
+	/// Used for TAG replacements
+	var data: [String: String] = [
+		// default: hide everything
+		"AppInfoHidden": CLASS_HIDDEN,
+		"AppExtensionTypeHidden": CLASS_HIDDEN,
+		"ArchiveHidden": CLASS_HIDDEN,
+		"iTunesHidden": CLASS_HIDDEN,
+		"TransportSecurityHidden": CLASS_HIDDEN,
+		"EntitlementsHidden": CLASS_HIDDEN,
+		"EntitlementsWarningHidden": CLASS_HIDDEN,
+		"ProvisionHidden": CLASS_HIDDEN,
+		"ApkFeaturesRequiredHidden": CLASS_HIDDEN,
+		"ApkFeaturesOptionalHidden": CLASS_HIDDEN,
+		"ApkPermissionsHidden": CLASS_HIDDEN,
+	]
+	let meta: MetaInfo
+	
+	init(_ meta: MetaInfo) throws {
+		self.meta = meta
+		
+		switch meta.type {
+		case .IPA, .Archive, .Extension:
+			guard let plistApp = meta.readPlist_Info() else {
+				throw RuntimeError("Info.plist not found")
+			}
+			procAppInfoApple(plistApp)
+			if meta.type == .IPA {
+				procItunesMeta(meta.readPlist_iTunesMetadata())
+			} else if meta.type == .Archive {
+				procArchiveInfo(meta.readPlistXCArchive())
+			}
+			procTransportSecurity(plistApp)
+			
+			let plistProvision = meta.readPlist_MobileProvision()
+			procEntitlements(meta, plistApp, plistProvision)
+			procProvision(plistProvision)
+			// App Icon (last, because the image uses a lot of memory)
+			data["AppIcon"] = AppIcon(meta).extractImage(from: plistApp.icons).withRoundCorners().asBase64()
+			
+		case .APK:
+			guard let manifest = meta.readApk_Manifest() else {
+				throw RuntimeError("AndroidManifest.xml not found")
+			}
+			procAppInfoAndroid(manifest)
+			// App Icon (last, because the image uses a lot of memory)
+			data["AppIcon"] = AppIcon(meta).extractImage(from: manifest.icon).withRoundCorners().asBase64()
+		}
+		
+		data["QuickLookTitle"] = stringForFileType(meta)
+		procFileInfo(meta.url)
+		procFooterInfo()
+	}
+	
+	mutating func apply(_ values: [String: String]) {
+		data.merge(values) { (_, new) in new }
+	}
+	
+	/// Title of the preview window
+	private func stringForFileType(_ meta: MetaInfo) -> String {
+		switch meta.type {
+		case .IPA, .APK: return "App info"
+		case .Archive:   return "Archive info"
+		case .Extension: return "App extension info"
+		}
+	}
+	
+	/// prepare html, replace values
+	func generate(template html: String, css: String) -> String {
+		let templateValues = data.merging(["CSS": css]) { (_, new) in new }
+		return html.regexReplace("\\{\\{([^ }]{1,40}?)\\}\\}") { templateValues[$0] }
+	}
+}
+
+extension String {
+	/// Replace regex-pattern with custom replacement.
+	/// @param pattern must include a regex group. (e.g. "a(b)c")
+	func regexReplace(_ pattern: String, with fn: (_ match: String) -> String?) -> String {
+		var rv = ""
+		var prevLoc = self.startIndex
+		let regex = try! NSRegularExpression(pattern: pattern)
+		regex.enumerateMatches(in: self, range: NSRange(location: 0, length: self.count), using: { match, flags, stop  in
+			let start = self.index(self.startIndex, offsetBy: match!.range.lowerBound)
+			// append unrelated text up to this key
+			rv.append(contentsOf: self[prevLoc ..< start])
+			prevLoc = self.index(start, offsetBy: match!.range.length)
+			// append key if exists (else remove template-key)
+			let key = String(self[Range(match!.range(at: 1), in: self)!])
+			if let value = fn(key) {
+				rv.append(value)
+			} else {
+				// do not append anything -> removes all template keys from template
+				// os_log(.debug, log: log, "unknown template key: %{public}@", key)
+			}
+		})
+		// append remaining text
+		rv.append(contentsOf: self[prevLoc ..< self.endIndex])
+		return rv
+	}
+}
--- a/src/Preview/RuntimeError.swift
+++ b/src/Preview/RuntimeError.swift
@@ -0,0 +1,14 @@
+import Foundation
+
+// used to quit QuickLook generation without returning a valid preview
+struct RuntimeError: LocalizedError {
+	let description: String
+
+	init(_ description: String) {
+		self.description = description
+	}
+
+	var errorDescription: String? {
+		description
+	}
+}
Author	SHA1	Message	Date
relikd	15f536cb79	fix: html modify instructions in readme	2025-12-04 19:20:56 +01:00
relikd	ac8b76d3fc	chore: bump version	2025-12-01 01:41:20 +01:00
relikd	62d1407d17	fix: .appex for macOS extensions	2025-12-01 01:14:53 +01:00
relikd	eb169ae0a2	ref: rm Thumbnail for .appex (can there even be an icon?)	2025-12-01 01:07:52 +01:00
relikd	abdee3b780	chore: move files around	2025-12-01 01:03:02 +01:00
relikd	38c861442c	ref: split ApkManifest into data parser and content	2025-12-01 00:45:09 +01:00
relikd	1ce5f3e069	chore: update log category	2025-11-30 16:53:37 +01:00
relikd	d0da644c26	ref: AndroidSdkMap	2025-11-30 16:41:58 +01:00
relikd	76e7e22b49	ref: template use {{X}} instead of __X__	2025-11-30 16:28:26 +01:00
relikd	72e395c5da	ref: data structures for plist files	2025-11-30 15:36:34 +01:00
relikd	be65aaa19a	chore: bump version	2025-11-29 20:32:39 +01:00
relikd	feae5aba3e	chore: downgrade package version	2025-11-29 20:30:18 +01:00
relikd	3a587ce730	feat: support for apkm	2025-11-29 20:24:29 +01:00
relikd	6bb62bdf82	ref: ApkManifest	2025-11-29 20:24:01 +01:00
relikd	f233d0e4a2	ref: icon preference rating	2025-11-29 20:11:40 +01:00
relikd	035276dcfc	ref: simplify readEntitlements() + unzip to tmp-dir shortcut	2025-11-29 01:59:38 +01:00
relikd	3a16277867	chore: update readme	2025-11-28 13:39:38 +01:00
relikd	591a75dabc	feat: support for apk	2025-11-28 13:39:24 +01:00
relikd	cde957b01f	ref: remove dead code for non-optional zipFile	2025-11-28 13:21:33 +01:00
relikd	71d1b35aac	ref: hide all html tags by default	2025-11-28 13:05:03 +01:00
relikd	5cd7034fc8	chore: support for xcconfig in version bump script	2025-11-06 03:21:39 +01:00
relikd	e0ccba1af8	chore: bump version	2025-11-06 02:00:34 +01:00
relikd	21c21ec059	feat: quit preview gracefully if Info.plist not found	2025-11-06 01:57:33 +01:00
relikd	cfb6b17bc7	feat: not-hidden combination	2025-11-06 01:25:35 +01:00
relikd	2d16cb666b	feat: show xcarchive developer notes	2025-11-06 01:06:53 +01:00
relikd	1a6d98a4b2	chore: upgrade to recommended settings	2025-11-06 00:33:49 +01:00
relikd	85c1ae95c1	feat: hide empty entitlements	2025-11-06 00:20:33 +01:00
relikd	fd13f13a3c	ref: parentDir()	2025-11-06 00:15:11 +01:00
relikd	8b916829d1	fix: preview of xcarchive for non app-like bundles	2025-11-06 00:10:10 +01:00
relikd	05f30ee755	feat: hide ATS if none are present	2025-11-05 23:53:50 +01:00
relikd	5166a67e48	ref: extract TransportSecurity into own class	2025-11-05 23:30:37 +01:00
relikd	d1aae4cc15	ref: introduce CLASS_VISIBLE	2025-11-05 23:29:37 +01:00
relikd	f38c1f802f	feat: make appPlist optional (again)	2025-11-05 18:36:45 +01:00
relikd	af9c398571	feat: support for macOS xcarchive	2025-11-05 18:18:08 +01:00
relikd	36e30a1fdf	chore: remove semicolons	2025-11-05 18:02:39 +01:00
relikd	fb8fa41dd0	ref: URL utils class	2025-11-05 17:54:29 +01:00
relikd	33cec015ab	ref: static TransportSecurity strings	2025-11-05 02:06:02 +01:00
relikd	6dec6530c5	fix: check for empty entitlements dict	2025-11-05 02:04:28 +01:00
relikd	596ad18412	fix: release compile error	2025-11-04 22:15:10 +01:00
relikd	fe282b445b	chore: add changelog	2025-11-04 21:33:12 +01:00
relikd	0ee94bcb0d	ref: move html chapters around	2025-11-04 20:39:07 +01:00
relikd	96001e4d40	ref: make app plist required	2025-11-04 20:18:43 +01:00
relikd	6898eeb42c	ref: rename template values	2025-11-04 19:26:07 +01:00
relikd	5250f48d38	ref: regexReplace template values	2025-11-04 16:49:31 +01:00
relikd	802daebe56	ref: rename PreviewGenerator	2025-11-02 16:10:08 +01:00
relikd	f49e184dbb	feat: customizable html	2025-11-02 00:45:54 +01:00
relikd	d634763eef	ref: config file	2025-11-02 00:40:24 +01:00
relikd	5902bf9aa3	fix: CoreUI support via Framework abstraction	2025-11-01 22:17:36 +01:00
relikd	6d91972e97	feat: use xcconfig	2025-10-31 21:36:54 +01:00
relikd	879a12f912	feat: support for .tipa	2025-10-30 19:06:08 +01:00
relikd	e4d421d4e0	doc: add Console instructions to readme	2025-10-30 18:52:33 +01:00
relikd	e2f65b540a	chore: rm os_log	2025-10-30 18:42:02 +01:00
relikd	5788b098e9	chore: add screenshot	2025-10-30 18:34:43 +01:00